CHEM? 152L QUIZ" 41 Total points 546210(BonusQuestion) is worth3 point1 O 1. What is the IUPAC...

Question

Question

Answer 1

Answer #1

Cno a) 3 2 1 Buut-1-eldydle -너 3 Helme group 凸ー V0 aldenyele group.

Answer 2

Similar Homework Help Questions

1. Using IUPAC rules, narne the following organic compounds: CH3CH-CCH2CH2C-CCH2CH2CH2CH2COH CH3CH2CH2NC CH2CH2CH2CHCH2 CH3 CH,CHCH,N CH.CH,CH,CHCH, CH...

1. Using IUPAC rules, narne the following organic compounds: CH3CH-CCH2CH2C-CCH2CH2CH2CH2COH CH3CH2CH2NC CH2CH2CH2CHCH2 CH3 CH,CHCH,N CH.CH,CH,CHCH, CH chichi CHCHicHCH.CH CH3CH2 H2CH2CH2CH2CH2CH CH CH2(CHala oČCHCH,CH,CH CH,ç-CH CH, CH CH2C
CH3 6. Assign IUPAC names for each of the following compounds: d) CHS-C-CH3 CH₂CH3 CH2CH2 C...

CH3 6. Assign IUPAC names for each of the following compounds: d) CHS-C-CH3 CH₂CH3 CH2CH2 C H2CH2CH3 CH3-CH2-CH2-C-CH2-CH2-C-CH3 H2 CH₂ CH₂ H CH2CH3
Provide the IUPAC names for the following hydrocarbons. Do NOT consider stereochemistry. A. CH, CH=CHCH=CHCH=CHCH=CH, B....

Provide the IUPAC names for the following hydrocarbons. Do NOT consider stereochemistry. A. CH, CH=CHCH=CHCH=CHCH=CH, B. CH3CH=CHC=CCH=CHCH=CHCH=CH2 Submit Answer Try Another Version 5 item attempts remaining Give IUPAC names for the following compounds: (a) 1) (CH3CH2)2C=CHC=CCH(CH3)C=CH CH2CH3 CH3 H2C=HCC=HCC=CCH=CC=CH2 CH2CH3

IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i....

IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
g. 1,1,3-trimethyllytun 2.27 Write expanded formulas for the following compounds, and name them using the IUPAC...

g. 1,1,3-trimethyllytun 2.27 Write expanded formulas for the following compounds, and name them using the IUPAC system: a. CH,(CH2)2CH, b. (CH),CHCH,CH,CH c. (CH3),CCH2CH2CH3 d. (CH2) e. CH,CH,CHFCH3 f. CH,CCI,CBrz h. MeBr g. i-Prci I. CH_CICHCI j. (CH3CH2)2CHCH(CH3)CHCH mon and IUPAC names for the following compounds: C.CH,C2
please provide nomenclature for a through j. thanks! Nomenclature Provide the IUPAC name for the following...

please provide nomenclature for a through j. thanks! Nomenclature Provide the IUPAC name for the following a. CHỊCH-CH(CH3)CH2CH(CHO)CH, C. (CH3)3CCH2C(CH3)3 d. C(CH3)4 f. CH3C(CI)2CH(CH3)2 h. (CH2CH2)2CHCH(CH3)CH2CH3 j. CH2CH(CH3)CCCH2CH3

What is the IUPAC name for the following molecule: CH2CH2C=CH2 CH3 What is the IUPAC name...

What is the IUPAC name for the following molecule: CH2CH2C=CH2 CH3 What is the IUPAC name for the following molecule: CH CH CHE CH2CH2CHCCH,CHCH нс Сн,сн What is the IUPAC name for the following molecule: CH2CH2CHCH2CH2CH2CH3 CH.CH What is the IUPAC name for the following molecule: Which of the following statements is true about this molecule: a. It has a cis configuration b.it has a trans configuration c. It is an alkyne d. it is saturated
2. Nomenclatures of the following compounds. (20 pts) Formula IUPAC nomenclature CH:CH2CH2CH2CH2F CH3 Br Functional name...

2. Nomenclatures of the following compounds. (20 pts) Formula IUPAC nomenclature CH:CH2CH2CH2CH2F CH3 Br Functional name (name it as alcohol) Substitutive name ?? Functional name Substitutive name CH,CHCH-C2C(CHs)s ?? Functional name Substitutive name CH3 H ??
help I need this before 11 pm QUESTION 1 What is the IUPAC name for this...

help I need this before 11 pm QUESTION 1 What is the IUPAC name for this compound? CH,CH= CHCH2CH2CH2CH, QUESTION 2 What is the IUPAC name for this compound? H3 CH2CH3 QUESTION 3 What is the IUPAC name for this compound? CHE CH3CH2CH2CCH CHE CHCH, QUESTION 4 What is the IUPAC name for this compound? CH3 CH3 QUESTION 5 Which of the following is NOT a type of unsaturated compound? O alkene O alkyne O aromatic O alkane

CHEM 1152K Total Points: 20 Seat: Quiz 1 Name: Lab Instructor: Lab Day: _Lab partner:__ Date:...

CHEM 1152K Total Points: 20 Seat: Quiz 1 Name: Lab Instructor: Lab Day: _Lab partner:__ Date: Lab time: 1. All of the following are representations of the same molecule except a) C4H8 b) cyclobutane c)CH2CH2CH2CH2 d) Ho-Cha Hobro 2. The various shapes taken on by an organic molecule are known as a) Conformations b) Constitutional isomers c) Configurations d) Geometrical isomers 3. How many hydrogens are found in a straight chain alkanes with four carbons? 4. Which of the following...