8) Explain why you must lower the temperature sufficiently to improve electrical conduction in nanoparticles In...
Homework Answers
The very simple answer of this question is that in nano particals at low temperature sintering occour . Now the question is what is sintering and what is use of it
So ans of this is sintering is basically a process in which particals are agglomerat and forming a solid Mass or I can say improve the strength. Now we need sintering because sintering increase the melting point and provide compactness and strength otherwise it will melted
Add Answer to:
8)
Explain why you must lower the temperature sufficiently to
improve electrical conduction in nanoparticles
In...
Explain why we must make the following changes to a proton test for it to land...
Explain why we must make the following changes to a proton test for it to land where an electron and positron land? Why must we dramatically decrease an electrical field (Example: from 15 N/C to -27500 N/C) for a proton to land at the same position as an electron when Vo is kept constant? Why must we dramatically decrease Vo values (example: from 600,000ns to 14000ns) for a proton to land at the same position as a positron when electrical...
for cache? If yes, explain why. If no, explain why not. Question 20 (8 marks) Research...
for cache? If yes, explain why. If no, explain why not. Question 20 (8 marks) Research conducted at Charles Darwin University shows that it is possible to diagnose some problems with peoples hearing by playing sounds to them through headphones and recording electrical signal generated in the brain as a response to these sounds. To get effective information, the sound must be played to the person many times, sometimes in phase, sometimes out of phase, and the signals processed after...
Problem 2.74 The melt temperature of Li (180oC) is significantly lower than the melt temperature of...
Problem 2.74 The melt temperature of Li (180oC) is significantly lower than the melt temperature of its neighbor Be (1287oC). Can you explain this in terms of the differences in electronic structure? Problem 2.77 After ionization, why is the sodium ion smaller than the sodium atom? After ionization, why is the chloride ion larger than the chlorine atom?
1) Discuss the following: When you unplug certain electrical gadgets you see a spark. Use Faraday's law to explain...
1) Discuss the following: When you unplug certain electrical gadgets you see a spark. Use Faraday's law to explain why that might happen. Speculate on why it is more likely to occur when unplugging in the appliance than plugging it in. [Hint: Consider that most appliances will have electrical currents that make magnetic fields.]
1) Discuss the following: When you unplug certain electrical gadgets you see a spark. Use Faraday's law to explain why that might happen. Speculate on why...
You must label each answer with the number of question. Each question must have at least...
You must label each answer with the number of question. Each question must have at least three sentence answers. There is no maximum sentence, use as many as you wish to thoroughly answer the question. All answers must be complete sentences using proper grammar and spelling Josh, the manager of Boo, Inc bought 50 trucks for the business use. In Year 2 , he doubled the estimated life of the trucks. In Year 3, he increased the residual value. Requirements...
You must label each answer with the number of question. Each question must have at least...
You must label each answer with the number of question. Each question must have at least three sentence answers. There is no maximum sentence, use as many as you wish to thoroughly answer the question. All answers must be complete sentences using proper grammar and spelling Josh, the manager of Boo, Inc bought 50 trucks for the business use. In Year 2 , he doubled the estimated life of the trucks. In Year 3, he increased the residual value. Requirements...
can you explain why the lower the diversification ratio, the better the diversification? because i thought...
can you explain why the lower the diversification ratio, the
better the diversification? because i thought the higher the
Diversification ratio, the more diversified the portfolio.
4. A is correct. The lower the diversification ratio, the better the diversification
You MUST explain your answer in order to receive participation credit. Why are some of the...
You MUST explain your answer in order to receive participation credit. Why are some of the other options FALSE? >>>> Which of the following statements is CORRECT? Assume that the project being considered has normal cash flows,with one outflow followed by a series of inflows. a. A project’s NPV is found by compounding the cash inflows at the IRR to find the terminal value (TV), then discounting the TV at the WACC. b. The lower the WACC used to calculate...
Based on Albrektsson’s Interpretation: How would you improve Osseointegration? Explain why. 1) increase surface area? 2)...
Based on Albrektsson’s Interpretation: How would you improve Osseointegration? Explain why. 1) increase surface area? 2) increase surface volume? 3) enhance surface bioactivity?
explain each step F. What is the transistor? Why transistor use in electrical circuit? Design a...
explain each step
F. What is the transistor? Why transistor use in electrical circuit? Design a problem of the following circuit t help other students better understand transistors. Make sure you use reasonable number 15 pts R2 R Fove V R:
for cache? If yes, explain why. If no, explain why not. Question 20 (8 marks) Research conducted at Charles Darwin University shows that it is possible to diagnose some problems with peoples hearing by playing sounds to them through headphones and recording electrical signal generated in the brain as a response to these sounds. To get effective information, the sound must be played to the person many times, sometimes in phase, sometimes out of phase, and the signals processed after...
Problem 2.74 The melt temperature of Li (180oC) is significantly lower than the melt temperature of its neighbor Be (1287oC). Can you explain this in terms of the differences in electronic structure? Problem 2.77 After ionization, why is the sodium ion smaller than the sodium atom? After ionization, why is the chloride ion larger than the chlorine atom?
1) Discuss the following: When you unplug certain electrical gadgets you see a spark. Use Faraday's law to explain why that might happen. Speculate on why it is more likely to occur when unplugging in the appliance than plugging it in. [Hint: Consider that most appliances will have electrical currents that make magnetic fields.]
1) Discuss the following: When you unplug certain electrical gadgets you see a spark. Use Faraday's law to explain why that might happen. Speculate on why...
can you explain why the lower the diversification ratio, the
better the diversification? because i thought the higher the
Diversification ratio, the more diversified the portfolio.
4. A is correct. The lower the diversification ratio, the better the diversification
explain each step
F. What is the transistor? Why transistor use in electrical circuit? Design a problem of the following circuit t help other students better understand transistors. Make sure you use reasonable number 15 pts R2 R Fove V R:
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 10 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 41 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago