The electron configuration of a manganese ion (Z = 25) is [Ar]3d 3. What is the...
The electron configuration of a manganese ion (Z = 25) is [Ar]3d 3. What is the charge on this ion?
Homework Answers
The electron configuration of a manganese ion is [Ar]3d3
so the total number of electrons in manganese ion are 21
The number of electrons in manganese are 25 so the charge = 25 - 21 = 4
Therefore, the charge on manganese ion would be +4
Add Answer to:
The electron configuration of a manganese ion (Z = 25) is [Ar]3d
3. What is the...
Write the electron configuration for Ga3+ ion. [Ar]\ 3d^{10}?
Write the electron configuration for Ga3+ ion. [Ar]\ 3d^{10}?
which element's 4+ ion would have the following electron configuration? [Ar]3d^10
which element's 4+ ion would have the following electron configuration? [Ar]3d^10
Why is electron configuration for V [Ar]4s^2 3d^3 instead of [Ar]4s^2 4d^3 Is it not in...
Why is electron configuration for V [Ar]4s^2 3d^3 instead of [Ar]4s^2 4d^3 Is it not in the 4th row??? Thanks.
What is the electron configuration for the Fe3+ ion? Please explain why a.) [Ne]3s23p10 b.) [Ar]4s13d6...
What is the electron configuration for the Fe3+ ion? Please explain why a.) [Ne]3s23p10 b.) [Ar]4s13d6 c.)[Ar]4s03d7 d.) [Ar]4s23d9 e.)[Ar]4s03d5
Identify the correct condensed electronic configuration for the Mn ion. A) [Ar]4s23d B) [Ar] C) [Ar]...
Identify the correct condensed electronic configuration for the Mn ion. A) [Ar]4s23d B) [Ar] C) [Ar] 4s23d2 D) [Ar]3d E) [Ar] 4s24d5
Can you help me answer these 5 questions? 1. What is the correct electron configuration for the Mn2+ ion? A. [Ar] 4s2 3d...
Can you help me answer these 5 questions? 1. What is the correct electron configuration for the Mn2+ ion? A. [Ar] 4s2 3d4 4p4 B. [Ar] 4s2 3d3 C. [Ne] 3s2 3d4 D. [Ar] 3d5 E. [Ar] 4s2 3d9 2. Which of the following formulas is incorrect? A. CaCO3 B. CaBr C. KOH D. Na2SO4 E. Na2O 3. Which of the following names are incorrect for the formula they're paired with? (Select ALLincorrect pairings) A. NH4F - ammonium fluoride B....
An atomic cation with a charge of +1 has the following electron configuration: 1s22s22p63s23p63d54s1 What is...
An atomic
cation with a charge of
+1
has the
following electron configuration:
1s22s22p63s23p63d54s1
What is the chemical symbol for the ion?
How many electrons does the ion have?
How many 2p electrons are in the ion?
An atomic cation with a charge of +1 has the following electron configuration: 1822s²2pº3s23p 3d 48 What is the chemical symbol for the ion? How many electrons does the ion have? How many 2p electrons are in the ion? 1 1 x 6...
A. An element with the valence electron configuration 4s would form a monatomic ion with a...
A. An element with the valence electron configuration 4s would form a monatomic ion with a charge of In order to form this ion, the element will electron(s) from/into the subshell(s). - the B. If an element with the valence configuration 4s23d loses 3 electron(s), these electron(s) would be removed from subshell(s). Submit Answer Retry Entire Group 8 more group attempts remalning A. A main group element with the valence electron configuration 5s1 is in periodic group It forms a...
A. An element with the valence electron configuration 4s2 would form a monatomic ion with a...
A. An element with the valence electron configuration 4s2 would form a monatomic ion with a charge of In order to form this ion, the element will electron(s) from/into the subshell(s). B. If an element with the valence configuration 4s13d10 loses 1 electron(s), these electron(s) would be removed from the subshell(s). A. A main group element with the valence electron configuration 3s 3p is in periodic group It forms a monatomic ion with a charge of B. A main group...
configuration for the following ions. Use the noble gas core abbreviation. Ion Electron Configuration Ion Electron...
configuration for the following ions. Use the noble gas core abbreviation. Ion Electron Configuration Ion Electron Configuration A/3+ Ni2+ P3 Sb3+ Br Te2- V3+ Pb2+
Identify the correct condensed electronic configuration for the Mn ion. A) [Ar]4s23d B) [Ar] C) [Ar] 4s23d2 D) [Ar]3d E) [Ar] 4s24d5
An atomic
cation with a charge of
+1
has the
following electron configuration:
1s22s22p63s23p63d54s1
What is the chemical symbol for the ion?
How many electrons does the ion have?
How many 2p electrons are in the ion?
An atomic cation with a charge of +1 has the following electron configuration: 1822s²2pº3s23p 3d 48 What is the chemical symbol for the ion? How many electrons does the ion have? How many 2p electrons are in the ion? 1 1 x 6...
A. An element with the valence electron configuration 4s would form a monatomic ion with a charge of In order to form this ion, the element will electron(s) from/into the subshell(s). - the B. If an element with the valence configuration 4s23d loses 3 electron(s), these electron(s) would be removed from subshell(s). Submit Answer Retry Entire Group 8 more group attempts remalning A. A main group element with the valence electron configuration 5s1 is in periodic group It forms a...
A. An element with the valence electron configuration 4s2 would form a monatomic ion with a charge of In order to form this ion, the element will electron(s) from/into the subshell(s). B. If an element with the valence configuration 4s13d10 loses 1 electron(s), these electron(s) would be removed from the subshell(s). A. A main group element with the valence electron configuration 3s 3p is in periodic group It forms a monatomic ion with a charge of B. A main group...
configuration for the following ions. Use the noble gas core abbreviation. Ion Electron Configuration Ion Electron Configuration A/3+ Ni2+ P3 Sb3+ Br Te2- V3+ Pb2+
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago