Homework Answers
Add Answer to:
07 Question (1 point) If an alkaline battery produces a cell potential of 1.48 V, what...
CH17HW 07/30/20 flander 01 Question (1 point) @ See page 785 If an alkaline battery produces...
CH17HW 07/30/20 flander 01 Question (1 point) @ See page 785 If an alkaline battery produces a cell potential of 1.60 V, what is the value of AG ? The half-reactions in alkaline batteries are: ZnO(s) + H2O(1)+22 - Zn(s) + 2OH(aq) 2MnO,(s) +H20(1) +2e Mn,0,(s) +20H (94) 1st attempt Il See Periodic Table See Hint AG cell- ku SUBMIT ANSWER OOF 10 QUESTIONS COMPLETED < 01/10 > 1080
In kJ If an alkaline battery produces a cell potential of 1.62 V, what is the...
In kJ
If an alkaline battery produces a cell potential of 1.62 V, what is the value of AG cell? The half-reactions in alkaline batteries are: Zno(s) +H,0(1) +2e → Zn(s) +20H (aq) 2MnO2 (s) +H20(1) +22 → Mn,oz (s) +20H (aq)
The standard cell potential (Eocell) of the zinc-air battery is 1.65V. If at 25.0oC the partial...
The standard cell potential (Eocell) of the zinc-air battery is 1.65V. If at 25.0oC the partial pressure of oxygen in the air diffusing its cathode is 0.24 atm, what is the cell potential (Ecell)? Assume the cell reaction is: 2 Zn(s) + O2(g) yields 2 ZnO(s) The standard reduction potentials of the half-reactions in zinc-air batteries are: ZnO(s) +H2O(l) + 2e- yields Zn(s) + 2OH-(aq) Eored = -1.25V O2(g) + 2 H2O(l) + 4e- yields 4 OH-(aq) Eored= 0.401 Should...
See pa 05 Question (1 point) A battery can provide a current of 1.60 A at...
See pa 05 Question (1 point) A battery can provide a current of 1.60 A at 3.00 V for 5.00 hr. How much energy (in kJ) is produced? 2nd attempt hal See Periodic Table OS Energy- 25.11 1st attempt 06 Question (1 point) In the electrolysis of water, how long will it take to produce 1.000 x 102 L of H2 at STP (273K and 1.00 bar) using an electrolytic cell through which a current of 56.00 mA flows? 3rd...
Question 7 Using the table of standard reduction potentials shown below, calculate the standard cell potential for...
Question 7 Using the table of standard reduction potentials shown below, calculate the standard cell potential for a battery based on the following reactions. • Pet2 + 2e + Fe . 2 Li + 2 Li + 2e Reduction Half-Reaction F2 +2e + 2F MnO + 8H+ Se + Mn+2+ 4 H 0 Cl2 + 2e + 20 02 + 4H' + 4e + 2 H2O Ag+ e -- Ag Fet) + e + Fe2 O2 + 2 H2O +...
Question 4 Using the table of standard reduction potentials shown below, calculate the standard cell potential for...
Question 4 Using the table of standard reduction potentials shown below, calculate the standard cell potential for a battery based on the following reactions. • MnO4 +8H+ + 5e + Mn+2 +4 H20 . 5 Ag + 5 Ag+1 +5e Reduction Half-Reaction F2 +2e + 2F MnO4 + 8 H+ + 5e + Mn+2 + 4H2O Cl2 + 2e + 20 O2 + 4H+ + 4e + 2 H2O Ag++ e + Ag Fet3 Fe + Fet2 O2 + 2...
redox flow batteries are similar to fuel cells 14 Question (2 points) Redox flow batteries are...
redox flow batteries are similar to fuel cells
14 Question (2 points) Redox flow batteries are similar to fuel cells in that the reactants are continuously delivered to an electrochemical cell from large storage tanks. In the cell shown here, an ion exchange membrane separates the reactants from each other; the arrows indicate the direction of flow for the reactants. The reactions in one type of redox flow battery can be diagrammed as follows: C(s) IV2(aq, V3"(aq) IVO'(aq). Vo?'(aq) IC(s)...
5. The nickel-cadmium battery, despite issues with the toxicity of Cd, is still used in some...
5. The nickel-cadmium battery, despite issues with the toxicity of Cd, is still used in some rechargeable batteries because it has very consistent voltage over long discharge times. a) Using only half-cell reactions given in Table 16.1, write the overall reaction and give the highest AV° value possible for a NiCd battery. b) The actual half-cell reactions used in a Nicd battery are: Ca(OH)2(8) + 2e → Cds + 2OH(aq) (Vº = -0.86V) NiO(OH)) + H2O) +e Ni(OH)2(s) + OH(aq)...
the standard reduction potential is attached below Use the table of standard reduction potentials for the...
the standard reduction potential is attached below
Use the table of standard reduction potentials for the following exercises. 4. Predict the products of the following redox reactions, then identify which could spontaneously occur. a) H(aq) + Au (s) → b) H (aq) + Na (8) ► c) Au+ (aq) + Na (5) ► 5. Find a reagent that can oxidize Br" to Br2 but cannot oxidize CI'' to Cl? More than one reagent is possible, but you only need to...
A chemist designs a galvanic cell that uses these two half-reactions: standard reduction potential half-reaction +...
A chemist designs a galvanic cell that uses these two half-reactions: standard reduction potential half-reaction + O2(9)+4 H (aq)+4e' 2H20) = 1.23 V red Ered Fe+. (аq) Fe3(aq)+e = +0.771 V Answer the following questions about thiss cell Write a balanced equation for the half-reaction that happens at the cathode Write a balanced equation for the half-reaction that happens at the anode Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous...
CH17HW 07/30/20 flander 01 Question (1 point) @ See page 785 If an alkaline battery produces a cell potential of 1.60 V, what is the value of AG ? The half-reactions in alkaline batteries are: ZnO(s) + H2O(1)+22 - Zn(s) + 2OH(aq) 2MnO,(s) +H20(1) +2e Mn,0,(s) +20H (94) 1st attempt Il See Periodic Table See Hint AG cell- ku SUBMIT ANSWER OOF 10 QUESTIONS COMPLETED < 01/10 > 1080
In kJ
If an alkaline battery produces a cell potential of 1.62 V, what is the value of AG cell? The half-reactions in alkaline batteries are: Zno(s) +H,0(1) +2e → Zn(s) +20H (aq) 2MnO2 (s) +H20(1) +22 → Mn,oz (s) +20H (aq)
See pa 05 Question (1 point) A battery can provide a current of 1.60 A at 3.00 V for 5.00 hr. How much energy (in kJ) is produced? 2nd attempt hal See Periodic Table OS Energy- 25.11 1st attempt 06 Question (1 point) In the electrolysis of water, how long will it take to produce 1.000 x 102 L of H2 at STP (273K and 1.00 bar) using an electrolytic cell through which a current of 56.00 mA flows? 3rd...
Question 7 Using the table of standard reduction potentials shown below, calculate the standard cell potential for a battery based on the following reactions. • Pet2 + 2e + Fe . 2 Li + 2 Li + 2e Reduction Half-Reaction F2 +2e + 2F MnO + 8H+ Se + Mn+2+ 4 H 0 Cl2 + 2e + 20 02 + 4H' + 4e + 2 H2O Ag+ e -- Ag Fet) + e + Fe2 O2 + 2 H2O +...
Question 4 Using the table of standard reduction potentials shown below, calculate the standard cell potential for a battery based on the following reactions. • MnO4 +8H+ + 5e + Mn+2 +4 H20 . 5 Ag + 5 Ag+1 +5e Reduction Half-Reaction F2 +2e + 2F MnO4 + 8 H+ + 5e + Mn+2 + 4H2O Cl2 + 2e + 20 O2 + 4H+ + 4e + 2 H2O Ag++ e + Ag Fet3 Fe + Fet2 O2 + 2...
redox flow batteries are similar to fuel cells
14 Question (2 points) Redox flow batteries are similar to fuel cells in that the reactants are continuously delivered to an electrochemical cell from large storage tanks. In the cell shown here, an ion exchange membrane separates the reactants from each other; the arrows indicate the direction of flow for the reactants. The reactions in one type of redox flow battery can be diagrammed as follows: C(s) IV2(aq, V3"(aq) IVO'(aq). Vo?'(aq) IC(s)...
5. The nickel-cadmium battery, despite issues with the toxicity of Cd, is still used in some rechargeable batteries because it has very consistent voltage over long discharge times. a) Using only half-cell reactions given in Table 16.1, write the overall reaction and give the highest AV° value possible for a NiCd battery. b) The actual half-cell reactions used in a Nicd battery are: Ca(OH)2(8) + 2e → Cds + 2OH(aq) (Vº = -0.86V) NiO(OH)) + H2O) +e Ni(OH)2(s) + OH(aq)...
the standard reduction potential is attached below
Use the table of standard reduction potentials for the following exercises. 4. Predict the products of the following redox reactions, then identify which could spontaneously occur. a) H(aq) + Au (s) → b) H (aq) + Na (8) ► c) Au+ (aq) + Na (5) ► 5. Find a reagent that can oxidize Br" to Br2 but cannot oxidize CI'' to Cl? More than one reagent is possible, but you only need to...
A chemist designs a galvanic cell that uses these two half-reactions: standard reduction potential half-reaction + O2(9)+4 H (aq)+4e' 2H20) = 1.23 V red Ered Fe+. (аq) Fe3(aq)+e = +0.771 V Answer the following questions about thiss cell Write a balanced equation for the half-reaction that happens at the cathode Write a balanced equation for the half-reaction that happens at the anode Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous...
Most questions answered within 3 hours.
-
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 4 minutes ago -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 3 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 17 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago