Homework Answers
Add Answer to:
Theory Assessment (11-19/20) cor Value 0.50 points A possible set of quantum numbers to describe an...
Which of the following set of quantum numbers (ordered n,l,ml,ms) are possible for an electron in...
Which of the following set of quantum numbers (ordered
n,l,ml,ms) are possible for an electron in an atom?
Quantum Number Rules Learning Goal: To learn the restrictions on each quantum number. Quantum numbers can be thought of as labels for an electron. Every electron in an atom has a unique set of four quantum numbers. The principal quantum number n corresponds to the shell in which the electron is located. Thus n can therefore be any integer. For example, an...
QUESTION 28 Which of the following is a possible set of quantum numbers for the highest...
QUESTION 28 Which of the following is a possible set of quantum numbers for the highest energy electron in a zinc atom? n=3 l= 2 mj = 3 m = -12 n=3 l= 2 m =-1 m = -12 n=3 l=1 m =-1 ms = 12 n=4 l=2 m=0 ms = 12 n= 4 l=0 m = 1 mg = -12
Oe 404 06 64 11) [10 points] For each of the sets of quantum numbers below,...
Oe 404 06 64 11) [10 points] For each of the sets of quantum numbers below, explain briefly why they are not a possible set of quantum numbers for an electron in an atom, and change the incorrect value to make the set of numbers valid a) n-3, L 0, m +2, m +1/2 ifforonce between its first and
Question 1 of 25 Quantum numbers arise naturally from the mathematics used to describe the possible...
Question 1 of 25 Quantum numbers arise naturally from the mathematics used to describe the possible states of an electron in an atom. The four quantum numbers, the principal quantum number (n), the angular momentum quantum number (), the magnetic quantum number (m), and the spin quantum number (m,) have strict rules which govern the possible values. Identify all allowable combinations of quantum numbers for an electron. n=4, 3, me= 4, m, = + n=3,= -2, me = 1, m,...
27 and 28 QUESTION 27 Which of the following is a possible set of quantum numbers...
27 and 28
QUESTION 27 Which of the following is a possible set of quantum numbers for the highest energy electron in a zinc atom? n=3 l= 1 m = -1 ms = 12 n= 4 l=0 m] =1 mg = -4 n=3 l= 2 m = 3 mg = -1 n= 4 l= 2 m] = 0 mg = 1 n=3 l= 2 m=-1 mg = -1 QUESTION 28 Which of the following is a covalent compound? dioxygen difluoride...
Quantum numbers arise naturally from the mathematics used to describe the possible states of an electron...
Quantum numbers arise naturally from the mathematics used to describe the possible states of an electron in an atom. The four quantum numbers, the principal quantum number (n), the angular momentum quantum number (C), the magnetic quantum number (me), and the spin quantum number (ms) have strict rules which govern the possible values. Identify all allowable combinations of quantum numbers for an electron. N OOOOOO On= 2, = 1, me = 1, m, = 0 n= 3, P = 2,...
11. Answer the following questions: (a) Without using quantum numbers, describe the differences between the shells,...
11. Answer the following questions: (a) Without using quantum numbers, describe the differences between the shells, subshells, and orbitals of an atom. (b) How do the quantum numbers of the shells, subshells, and orbitals of an atom differ? 12. Identify the subshell in which electrons with the following quantum numbers are found: (a) n 3,1 2 (b)n 1,1 0 (c)n 4,1-3 13. Using complete subshell notation (not abbreviations, 1s 2s 2p, and so forth), predict the electron configuration of each...
3. Which one of the following sets of quantum numbers is not possible? mi A. 4...
3. Which one of the following sets of quantum numbers is not possible? mi A. 4 3 2+12 B. 3 2 32 C. 3 0 +12 D.4 1-12 E.2 0 0+12 4. A possible set of quantum numbers for the last electron added to complete an atom of gallium (Ga) its ground state is n m m, A. 4 0 0 142 B. 3 012 C. 4 1 0 +12 D. 3 1 +12 E. 4 2 12 5. Electrons...
quantum numbers arise naturally from the mathematics used fi describe the possible states of an electron in an atom. i...
quantum numbers arise naturally from the mathematics used fi
describe the possible states of an electron in an atom. identify
all allowable combinations kf quantum numbers for an
electrode.
Quantum numbers arise naturally from the mathematics used to describe the possible states of an electron in an atom. The four quantum numbers, the principal quantum number (n), the angular momentum quantum number(), the magnetic quantum number (me), and the spin quantum number (ms) have strict rules which govern the possible...
Question 18 (5 points) Which one of the following represents an acceptable set of quantum numbers...
Question 18 (5 points) Which one of the following represents an acceptable set of quantum numbers for an electron in an atom? (arranged as n, I, m, and ms) 1, 0, 0, 1/2 3, 3, 3,-1/2 2, 2, -1,-1/2 3, 3, 3, 1/2 5, 4,- 5, 1/2 Question 19 (5 points) Which one of the following represents an acceptable possible set of quantum numbers (in the order n, I, mi, ms) for an electron in an atom? 2, 1, 0,...
Which of the following set of quantum numbers (ordered
n,l,ml,ms) are possible for an electron in an atom?
Quantum Number Rules Learning Goal: To learn the restrictions on each quantum number. Quantum numbers can be thought of as labels for an electron. Every electron in an atom has a unique set of four quantum numbers. The principal quantum number n corresponds to the shell in which the electron is located. Thus n can therefore be any integer. For example, an...
QUESTION 28 Which of the following is a possible set of quantum numbers for the highest energy electron in a zinc atom? n=3 l= 2 mj = 3 m = -12 n=3 l= 2 m =-1 m = -12 n=3 l=1 m =-1 ms = 12 n=4 l=2 m=0 ms = 12 n= 4 l=0 m = 1 mg = -12
Oe 404 06 64 11) [10 points] For each of the sets of quantum numbers below, explain briefly why they are not a possible set of quantum numbers for an electron in an atom, and change the incorrect value to make the set of numbers valid a) n-3, L 0, m +2, m +1/2 ifforonce between its first and
Question 1 of 25 Quantum numbers arise naturally from the mathematics used to describe the possible states of an electron in an atom. The four quantum numbers, the principal quantum number (n), the angular momentum quantum number (), the magnetic quantum number (m), and the spin quantum number (m,) have strict rules which govern the possible values. Identify all allowable combinations of quantum numbers for an electron. n=4, 3, me= 4, m, = + n=3,= -2, me = 1, m,...
27 and 28
QUESTION 27 Which of the following is a possible set of quantum numbers for the highest energy electron in a zinc atom? n=3 l= 1 m = -1 ms = 12 n= 4 l=0 m] =1 mg = -4 n=3 l= 2 m = 3 mg = -1 n= 4 l= 2 m] = 0 mg = 1 n=3 l= 2 m=-1 mg = -1 QUESTION 28 Which of the following is a covalent compound? dioxygen difluoride...
Quantum numbers arise naturally from the mathematics used to describe the possible states of an electron in an atom. The four quantum numbers, the principal quantum number (n), the angular momentum quantum number (C), the magnetic quantum number (me), and the spin quantum number (ms) have strict rules which govern the possible values. Identify all allowable combinations of quantum numbers for an electron. N OOOOOO On= 2, = 1, me = 1, m, = 0 n= 3, P = 2,...
11. Answer the following questions: (a) Without using quantum numbers, describe the differences between the shells, subshells, and orbitals of an atom. (b) How do the quantum numbers of the shells, subshells, and orbitals of an atom differ? 12. Identify the subshell in which electrons with the following quantum numbers are found: (a) n 3,1 2 (b)n 1,1 0 (c)n 4,1-3 13. Using complete subshell notation (not abbreviations, 1s 2s 2p, and so forth), predict the electron configuration of each...
3. Which one of the following sets of quantum numbers is not possible? mi A. 4 3 2+12 B. 3 2 32 C. 3 0 +12 D.4 1-12 E.2 0 0+12 4. A possible set of quantum numbers for the last electron added to complete an atom of gallium (Ga) its ground state is n m m, A. 4 0 0 142 B. 3 012 C. 4 1 0 +12 D. 3 1 +12 E. 4 2 12 5. Electrons...
quantum numbers arise naturally from the mathematics used fi
describe the possible states of an electron in an atom. identify
all allowable combinations kf quantum numbers for an
electrode.
Quantum numbers arise naturally from the mathematics used to describe the possible states of an electron in an atom. The four quantum numbers, the principal quantum number (n), the angular momentum quantum number(), the magnetic quantum number (me), and the spin quantum number (ms) have strict rules which govern the possible...
Question 18 (5 points) Which one of the following represents an acceptable set of quantum numbers for an electron in an atom? (arranged as n, I, m, and ms) 1, 0, 0, 1/2 3, 3, 3,-1/2 2, 2, -1,-1/2 3, 3, 3, 1/2 5, 4,- 5, 1/2 Question 19 (5 points) Which one of the following represents an acceptable possible set of quantum numbers (in the order n, I, mi, ms) for an electron in an atom? 2, 1, 0,...
Most questions answered within 3 hours.
-
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 11 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 12 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 26 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago