Homework Answers
Add Answer to:
16,17,18,19
14. a) Is the following more likely a nucleophile or a base? b) Is the...
Ans! 79. Draw the mechanism and product for the following elimination. ОН conc. H2SO4 heat Ans:...
Ans! 79. Draw the mechanism and product for the following elimination. ОН conc. H2SO4 heat Ans: 81. Draw the mechanism and product for the following elimination. Br KOtBu 88. Is the following more likely a nucleophile or a base? YNY Ans: 90. Which of the following is the strongest nucleophile? = =0 MeOH Meo B. U. ODD. A. Ans:
2. Which of the following is the correct order of decreasing basicity (stronger base> weaker base)?...
2. Which of the following is the correct order of decreasing basicity (stronger base> weaker base)? A. NH,>MeNH2> H2O> MEOH B. CH,COONa> NaOH>NaOMe>NaNMe D. MeNH2>NH, > MeOH> CH 3. Which of the following terms describes the following reaction? + Br2 H2O OH A. substitution B.addition C. elimination D. rearrangements 4. According to the Hammond Postulate transition states for A. endothermic reactions more closely resemble the reagents. B. endothermic reactions more closely resemble the products. C. exothermic reactions more closely resemble...
5. Circle the better a) acid CH3OH CHiNH or b) nucleophile in protic solvent CI or...
5. Circle the better a) acid CH3OH CHiNH or b) nucleophile in protic solvent CI or c) base CH3S CH3O or 6. Write out the mechanism for the following elimination reaction. Show all steps am arrows, Be sure to show all organic products, indicating which is major/minor. Br H2O+ 7. Write out the mechanism for the following reaction. Show all steps and use cur НО +Br2
When determining which mechanism (E1 or E2) occurs, the following process is helpful: 1) Determine the...
When determining which mechanism (E1 or E2) occurs, the following process is helpful: 1) Determine the substitution (methyl, 1º, 2º, or 3“) of the alkyl halide 2) Determine the strength of the nucleophile Please fill out the following table, indicating the category of reaction (E1 or E2) that will occur in each set of alkyl halides and nucleophiles. If no reaction occurs, write 'NR: Alkyl Halide Strong Base Weak Base Methyl 1° 20 3° For each of the following reactions,...
Only need help with 12,13,14 14. Which of the following is true of intramolecular 0. Which...
Only need help with 12,13,14
14. Which of the following is true of intramolecular 0. Which skeletal structure corresponds to the proton transfers? A. They are not likely to occur B. They can occur only in basic conditions. C. They can occur only in acidic conditions. D. They are the most common way in which Fischer projection shown? protons are transferred онон 15. Which reaction conditions would be best suited A. O to form the major product shown? он H...
The following reaction follow an E1 mechanism. Propose an arrow-pushing mechanism for the following transformations using...
The following reaction follow an E1 mechanism. Propose an arrow-pushing mechanism for the following transformations using proper curved arrows: Conc. H2SO4 heat By what mechanisms are the following reactions likely to occur? Draw the major product(s) for each reaction. Show relevant stereochemistry if appropriate. If the expected products are racemic, just draw one enantiomer and write racemic. NaoMe NaoMe OTS NaSH OTS H20
1. What is the nucleophile in the following S2 reaction and what is the leaving group Br + NaCN 2. What are produc...
1. What is the nucleophile in the following S2 reaction and what is the leaving group Br + NaCN 2. What are products of the following sequences of elementary steps? ci 1. Proton transfer involving NaOH 2. Nucleophile elimination 3. Nucleophilic addition of CH,MgBr 4. Sy2 involving CH Br (c) 1. Electrophilic addition of C 2. Electrophile elimination of HC (b) 1. E2 involving NaOCH, 2. Electrophilic addition involving H 3. Coordination involving H20 4. Proton transfer involving H2O OH...
26. Which of the following alkenes is more stable? Ans: 29. Show the mechanism for the...
26. Which of the following alkenes is more stable? Ans: 29. Show the mechanism for the following elimination, assuming that it is a concerted reaction. Өоме - Br Ans: 33. Which of the following is the most reactive in an E2 reaction? Ans: 36. Draw the major product of the following elimination. CI Ans: 39. What is the product of the following elimination? CI Ооме Ans: o o w obwoll
Part A In the acid-base mechanism, the base is a proton acceptor, and the acid is...
Part A In the acid-base mechanism, the base is a proton acceptor, and the acid is the proton donor. An acid-base reaction is visualized as the reaction in which proton transfer takes place. However, in a nucleophilic substitution reaction, the nucleophile attacks a substrate (usually an electrophile), and the leaving group is removed from the substrate as a weaker nucleophile. The nature of the reactants determines whether a reaction will proceed as an acid-base reaction or a nucleophilic substitution reaction....
65. Draw the product of the following dehydration reaction. H2SO4 OH Ans: 68. Draw the mechanism...
65. Draw the product of the following dehydration reaction. H2SO4 OH Ans: 68. Draw the mechanism for the following dehydration. LOH H2SO4 Ans: 71. Draw an energy diagram for the following reaction, assuming that it is exothermic. OH H2SO4 Ans: 73. What are the steps of arrow pushing involved in the following mechanism? ОН H2SO4 Ans:
Ans! 79. Draw the mechanism and product for the following elimination. ОН conc. H2SO4 heat Ans: 81. Draw the mechanism and product for the following elimination. Br KOtBu 88. Is the following more likely a nucleophile or a base? YNY Ans: 90. Which of the following is the strongest nucleophile? = =0 MeOH Meo B. U. ODD. A. Ans:
2. Which of the following is the correct order of decreasing basicity (stronger base> weaker base)? A. NH,>MeNH2> H2O> MEOH B. CH,COONa> NaOH>NaOMe>NaNMe D. MeNH2>NH, > MeOH> CH 3. Which of the following terms describes the following reaction? + Br2 H2O OH A. substitution B.addition C. elimination D. rearrangements 4. According to the Hammond Postulate transition states for A. endothermic reactions more closely resemble the reagents. B. endothermic reactions more closely resemble the products. C. exothermic reactions more closely resemble...
5. Circle the better a) acid CH3OH CHiNH or b) nucleophile in protic solvent CI or c) base CH3S CH3O or 6. Write out the mechanism for the following elimination reaction. Show all steps am arrows, Be sure to show all organic products, indicating which is major/minor. Br H2O+ 7. Write out the mechanism for the following reaction. Show all steps and use cur НО +Br2
When determining which mechanism (E1 or E2) occurs, the following process is helpful: 1) Determine the substitution (methyl, 1º, 2º, or 3“) of the alkyl halide 2) Determine the strength of the nucleophile Please fill out the following table, indicating the category of reaction (E1 or E2) that will occur in each set of alkyl halides and nucleophiles. If no reaction occurs, write 'NR: Alkyl Halide Strong Base Weak Base Methyl 1° 20 3° For each of the following reactions,...
Only need help with 12,13,14
14. Which of the following is true of intramolecular 0. Which skeletal structure corresponds to the proton transfers? A. They are not likely to occur B. They can occur only in basic conditions. C. They can occur only in acidic conditions. D. They are the most common way in which Fischer projection shown? protons are transferred онон 15. Which reaction conditions would be best suited A. O to form the major product shown? он H...
The following reaction follow an E1 mechanism. Propose an arrow-pushing mechanism for the following transformations using proper curved arrows: Conc. H2SO4 heat By what mechanisms are the following reactions likely to occur? Draw the major product(s) for each reaction. Show relevant stereochemistry if appropriate. If the expected products are racemic, just draw one enantiomer and write racemic. NaoMe NaoMe OTS NaSH OTS H20
1. What is the nucleophile in the following S2 reaction and what is the leaving group Br + NaCN 2. What are products of the following sequences of elementary steps? ci 1. Proton transfer involving NaOH 2. Nucleophile elimination 3. Nucleophilic addition of CH,MgBr 4. Sy2 involving CH Br (c) 1. Electrophilic addition of C 2. Electrophile elimination of HC (b) 1. E2 involving NaOCH, 2. Electrophilic addition involving H 3. Coordination involving H20 4. Proton transfer involving H2O OH...
26. Which of the following alkenes is more stable? Ans: 29. Show the mechanism for the following elimination, assuming that it is a concerted reaction. Өоме - Br Ans: 33. Which of the following is the most reactive in an E2 reaction? Ans: 36. Draw the major product of the following elimination. CI Ans: 39. What is the product of the following elimination? CI Ооме Ans: o o w obwoll
Part A In the acid-base mechanism, the base is a proton acceptor, and the acid is the proton donor. An acid-base reaction is visualized as the reaction in which proton transfer takes place. However, in a nucleophilic substitution reaction, the nucleophile attacks a substrate (usually an electrophile), and the leaving group is removed from the substrate as a weaker nucleophile. The nature of the reactants determines whether a reaction will proceed as an acid-base reaction or a nucleophilic substitution reaction....
65. Draw the product of the following dehydration reaction. H2SO4 OH Ans: 68. Draw the mechanism for the following dehydration. LOH H2SO4 Ans: 71. Draw an energy diagram for the following reaction, assuming that it is exothermic. OH H2SO4 Ans: 73. What are the steps of arrow pushing involved in the following mechanism? ОН H2SO4 Ans:
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 44 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago