Homework Answers
![Lewis Structure W BH3 H:B:H NO2 [10:*:] (iii) SFG :: ted: :7:T: liv O₂ sē: 0 :: 0; W Pols 3 + 8 = ☺ How many of molecules hav](http://img.homeworklib.com/questions/79573ba0-4635-11ec-a30f-f7b016158a9c.png?x-oss-process=image/resize,w_560)
BH3 have trigonal planar shape
that's why dipole moment is zero
SF6 has Square bipyramidal shapes and PCl5 has trigonal bipyramidal shapes and have zero dipole moment .
Add Answer to:
QUESTION 14 Draw the Lewis structures of the molecules below and use them to answer the...
Draw the Lewis structures of the molecules below and use them to answer the following questions:...
Draw the Lewis structures of the molecules below and use them to answer the following questions: I. BH3 II. NO2 III. SF6 IV. O3 V. PCl5 How many of the molecules have no dipole moment? A. 2 B. 3 C. 1 D. 4 E. They are all polar.
Draw the Lewis structures of the molecules below (note: first atom is the central atom) and...
Draw the Lewis structures of the molecules below (note: first atom is the central atom) and use them to answer the following questions: I. BH3 II. SeF6 III. O3 IV. NO2 V. POCl3 Which molecule(s) obey(s) the Octet rule? A. IV and V B.III and IV C.I, III and IV D.III only E. IV only (Continuing from the previous question) How many of the molecules are planar (i.e., all atoms lie in the same plane)? One Two Three Four Five
3. Of the molecules listed, which does not have a dipole moment? (Hint: Draw them out as Lewis structures with prop...
3. Of the molecules listed, which does not have a dipole moment? (Hint: Draw them out as Lewis structures with proper geometry to see the bonds and lone pairs) C) CO D) BF3 A) HC B) NBR3 4. For the elements Rb, F, and O, the order of increasing electronegativity is: A) Rb < F<O B) O<F Rb C)F< Rb<O D) The correct answer is not listed. 5.A polar covalent bond is a bond in which (3): C) Atoms have...
(9) For each pair of molecules or ions below (i) Draw the Lewis dot structures. (If...
(9) For each pair of molecules or ions below (i) Draw the Lewis dot structures. (If there is resonance, draw it.) (ii) Draw/Describe the VSEPR structures, including bonded electron pairs and lone pairs. (iii) Describe the structure of the molecule, considering all the bonds and atoms (but not lone pairs.) i.e., is the molecule straight? bent? etc. Angles between atoms? (iv) Indicate whether each molecule has a dipole moment, and mark the positive and negative poles. (v) Choose which molecule...
3. Draw resonance structures for the following molecules. favorable structure, if any Calculate formal charge for...
3. Draw resonance structures for the following molecules. favorable structure, if any Calculate formal charge for each atom. Circle the most a) сОвг» b) CH CONH2 (connectivity as shown below) Н. H Н 4. For each of the following, draw all bond dipoles on the first structure, then draw the net dipole on the second structure. If non-polar, write "no net" Bond :O: dipoles ex: : F Net O: dipole F F H+H ex: 5. The following are the two...
5.) Draw Lewis dot structures for the following molecules below. Next, draw the three dimensional structure for each...
5.) Draw Lewis dot structures for the following molecules below. Next, draw the three dimensional structure for each molecule using lines, dashes and wedges. Write what the bond angles are in each case. Calculate the difference in electronegativity (AEN) between each pair of bonding atoms. Draw dipoles for each bond in the molecule and draw a net dipole if one exists. In there is no net dipole, write "NO NET DIPOLE". Use this information to determine if the molecule is...
Draw the best Lewis dot structures for the 6 molecules below, and answer the questions that...
Draw the best Lewis dot structures for the 6 molecules below, and answer the questions that follow. N2H2 BF3 I3+1 CN-1 SH4 CH3P Which compound(s) have an atom with more than 8 electrons? Which compound(s) have an atom with only 6 electrons?
Data Table Two Double Bond Molecular Models Molecule Valence Electrons Lewis Structure Molecular Geometry Polar o...
Data Table Two Double Bond Molecular Models Molecule Valence Electrons Lewis Structure Molecular Geometry Polar or Nonpolar Model Check САН. (Resonance) NIA NIA CO2 Report Sheet Questions 8 dashes and dots and draw an arrow over the Lewis Find the total number of valence electrons for the following molecules. mensional Lewis structure usine dashes and dots and draw an arrow on structure to show any net dipole moment. w any net dipole moment. Identify the molecular geometry and have Your...
13) Draw Lewis structures of the following molecules to show their bonds and lone pairs. Then answer the following...
13) Draw Lewis structures of the following molecules to show their bonds and lone pairs. Then answer the following questions about them. Include all the valence electrons in your drawings. H2O IF 3 CO2 How many valence electrons does each molecule have? How many core electrons does each molecule have? How many bonding electrons does each molecule have? How many lone pairs does each entire molecule have? What is it's electrónic geometry? What is it's molecular geometry? What is the...
Complete the following table. Hint: Drawing the Lewis structures for these molecules after obtaining the total valence e...
Complete the following table. Hint: Drawing the Lewis structures for these molecules after obtaining the total valence electrons will help you to complete the table) FIND: Molecule Total Valence Electrons in Molecule Total Electron Domains around Central Atom Electron-Domain Shape (Geometry) No. of Bonding Domains around Central Atom Number of Nonbonding Domains around Central Atom VSEPR Class Molecular Shape (Geometry) Polar? Y/N WITH THESE MOLECULES: HCN BH3 SnCl2 NH4+ H3 O+ NO2 SbF5 SeF4 BrF3 XeF2 SeF6 IF5 XeF4 2....
3. Of the molecules listed, which does not have a dipole moment? (Hint: Draw them out as Lewis structures with proper geometry to see the bonds and lone pairs) C) CO D) BF3 A) HC B) NBR3 4. For the elements Rb, F, and O, the order of increasing electronegativity is: A) Rb < F<O B) O<F Rb C)F< Rb<O D) The correct answer is not listed. 5.A polar covalent bond is a bond in which (3): C) Atoms have...
(9) For each pair of molecules or ions below (i) Draw the Lewis dot structures. (If there is resonance, draw it.) (ii) Draw/Describe the VSEPR structures, including bonded electron pairs and lone pairs. (iii) Describe the structure of the molecule, considering all the bonds and atoms (but not lone pairs.) i.e., is the molecule straight? bent? etc. Angles between atoms? (iv) Indicate whether each molecule has a dipole moment, and mark the positive and negative poles. (v) Choose which molecule...
3. Draw resonance structures for the following molecules. favorable structure, if any Calculate formal charge for each atom. Circle the most a) сОвг» b) CH CONH2 (connectivity as shown below) Н. H Н 4. For each of the following, draw all bond dipoles on the first structure, then draw the net dipole on the second structure. If non-polar, write "no net" Bond :O: dipoles ex: : F Net O: dipole F F H+H ex: 5. The following are the two...
5.) Draw Lewis dot structures for the following molecules below. Next, draw the three dimensional structure for each molecule using lines, dashes and wedges. Write what the bond angles are in each case. Calculate the difference in electronegativity (AEN) between each pair of bonding atoms. Draw dipoles for each bond in the molecule and draw a net dipole if one exists. In there is no net dipole, write "NO NET DIPOLE". Use this information to determine if the molecule is...
Data Table Two Double Bond Molecular Models Molecule Valence Electrons Lewis Structure Molecular Geometry Polar or Nonpolar Model Check САН. (Resonance) NIA NIA CO2 Report Sheet Questions 8 dashes and dots and draw an arrow over the Lewis Find the total number of valence electrons for the following molecules. mensional Lewis structure usine dashes and dots and draw an arrow on structure to show any net dipole moment. w any net dipole moment. Identify the molecular geometry and have Your...
13) Draw Lewis structures of the following molecules to show their bonds and lone pairs. Then answer the following questions about them. Include all the valence electrons in your drawings. H2O IF 3 CO2 How many valence electrons does each molecule have? How many core electrons does each molecule have? How many bonding electrons does each molecule have? How many lone pairs does each entire molecule have? What is it's electrónic geometry? What is it's molecular geometry? What is the...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 19 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago