Homework Answers
![DATE: NO (9) + NOLI (9) Initial 1.9 M Equilibrum (1.9-2x) M Cla (g) OM OM (2x) M (3) M k = [no] x [ciz [noci? -> 1.6x105 (2xj](http://img.homeworklib.com/questions/40fba280-5180-11ec-a996-f99ff49cc226.png?x-oss-process=image/resize,w_560)
Add Answer to:
please fill out all boxes
In a given experiment 3.8 moles of pure NOCI was placed...
Consider the following reaction for which K 1.60 x 10 at some temperature 2 NOCl (g)...
Consider the following reaction for which K 1.60 x 10 at some temperature 2 NOCl (g) ㄹ 2 NO (g) + Cl2(g) In a given experiment, 0.935 moles of NOCI(g) were placed in an otherwise empty 1.51 L vessel. Complete the following table by entering numerical values in the Initial row and values containing the variable "x" in the Change and Equilibrium rows. Define 2x as the amount (mol/L) of NOCI that reacts to reach equilbrium. Include signs in the...
Please help with this question 5. Using the Reaction, Initial, Change, Equilibrium (RICE) table started for...
Please help with this question
5. Using the Reaction, Initial, Change, Equilibrium (RICE) table started for calculating equinor concentrations of the reaction shown. what is the expression for the equilibrium constant 2NOCI(g) S 2NO(g) + Cl2(g) [NOCIJ [NO] (C12] 0.20 M OM ом NOCH N ICHT d. 2 + (0.2-2x) e. 4x² (0.2–2x)2 x3 (0.2-x)? 4x 4x3 (0.2x)
Please show all work. Provide equations used for full credit. Please use correct significant figures and...
Please show all work. Provide equations used for full credit. Please use correct significant figures and correct units in answers. The reaction, 2NOBr(g) + 2NO(g) + Br2(8) has an equilibrium constant, K = 0.42 at 373 K. a. Calculate Agºrxn at 373 K. b. Using the value of AHºrxn = 45.38 k) and the AGºrxn calculated in part a, calculate the ASºrxn at 373 K. Consider the reaction: 2NO(g) + C12(8) + 2NOCI(g) Given the following table of thermodynamic data,...
1. At a particular temperature, a 3.0-L flask contains 2.4 mol Cl2, 1.0 mol NOCI, and...
1. At a particular temperature, a 3.0-L flask contains 2.4 mol Cl2, 1.0 mol NOCI, and 4.5 x 10-3 mol NO. Calculate K at this temperature for the following reaction: 2NOCI(g) — 2NO(g) + C13(g) 2. At a particular temperature, 8.0 mol NO2 is placed into a 1.0-L container and the NO2 dissociates by the reaction: 2NO,(8) 2NO(g) + 0,(8) At equilibrium the concentration of NO(g) is 2.0 M. Calculate K for this reaction. 3. Ammonia is produced by the...
1. At a particular temperature, a 3.0-L flask contains 2.4 mol Cl2, 1.0 mol NOCI, and...
1. At a particular temperature, a 3.0-L flask contains 2.4 mol Cl2, 1.0 mol NOCI, and 4.5 x 10-3 mol NO. Calculate K at this temperature for the following reaction: 2NOCI(g) — 2NO(g) + C13(g) 2. At a particular temperature, 8.0 mol NO2 is placed into a 1.0-L container and the NO2 dissociates by the reaction: 2NO,(8) 2NO(g) + 0,(8) At equilibrium the concentration of NO(g) is 2.0 M. Calculate K for this reaction. 3. Ammonia is produced by the...
Consider the following reaction: N2(9) + 3H2(9) = 2NH3(9) In a given experiment, 1.42 moles of...
Consider the following reaction: N2(9) + 3H2(9) = 2NH3(9) In a given experiment, 1.42 moles of N (9) and 4.01 moles of H2(g) were placed in a 4.12 L vessel. Complete the following table by entering numerical values in the Initial row and values containing the variable "x" in the Change and Equilibrium rows. Define x as the amount (mol/L) of Ny that reacts to reach equilibrium. Include signs in the Change column to indicate a gain or loss of...
pages 2-4 please! its equilibrium worksheet 2. A sample of gaseous BrCl is allowed to decompose...
pages 2-4 please! its equilibrium worksheet
2. A sample of gaseous BrCl is allowed to decompose in a closed container at 25C according to the equation below: 2BrCl(g) Bra(g) + Cl2(g) When the reaction reaches equilibrium, the following concentrations were obtained: [BrCl] = 0.38 M, [Cl:] = 0.26 M & [Br2] = 0.26 M. Determine the equilibrium constant for the reaction 3. A mixture of gases NOCI, Cl and NO was allowed to reach equilibrium at a particular temperature. The...
Write the expressions for Kp for the following reactions: 1. a) 2NH3(g) + Co2(g) N2CH40(s) +...
Write the expressions for Kp for the following reactions: 1. a) 2NH3(g) + Co2(g) N2CH40(s) + H20 (I) b) CuO (s) + H2(g) Cu(l)+H20 (g) 2. At room temperature, a 1.5 L flask contains 3.0 moles of Cl, 0.5 mole of NOCI, and 4.0x10 mole of NO. Calculate Ke at this temperature for the following reaction: 2NO (g) + Cl2(g) 2NOCİ (g) 0.00245 M, does this represent a system at M, [No] 0.2 M and [Ch] If [NOCI] 2.0x 10...
please answer all. thank u Equm U ving reaction for Questions 1 - 3 and answer the questions based upon th sed upon...
please answer all. thank u
Equm U ving reaction for Questions 1 - 3 and answer the questions based upon th sed upon this Consider the following reaction reaction: co (g) + 3 H, (g) + CH (9) + H2O (g) 1. At 25°C. Kega 4.0. What must be Kes 4.0. What must be the coat equilibrium If the rulibrium concentrations on HJE 2.0M, (CH) = 5.OM, and [HO] - 3.OM? Answer: 0.469 M a way to keep track of...
Consider the following reaction for Questions 1.3 and answer the questions based upon this GU u...
Consider the following reaction for Questions 1.3 and answer the questions based upon this GU u IIULS reaction: CÓ (g) + 3 H (g) + CH4 (g) + H2O (G) 1. At 25°C, Keq=4.0. What must be the Co] at equilibrium If the equilibrium concentrations of [H.]= 2.0M. (CH) = 5.0M, and (HO) = 3.OM? Answer: 0.469 M The ICE table is a way to keep track of what is happening in the reaction vessel. The initial concentrations if given...
Consider the following reaction for which K 1.60 x 10 at some temperature 2 NOCl (g) ㄹ 2 NO (g) + Cl2(g) In a given experiment, 0.935 moles of NOCI(g) were placed in an otherwise empty 1.51 L vessel. Complete the following table by entering numerical values in the Initial row and values containing the variable "x" in the Change and Equilibrium rows. Define 2x as the amount (mol/L) of NOCI that reacts to reach equilbrium. Include signs in the...
Please help with this question
5. Using the Reaction, Initial, Change, Equilibrium (RICE) table started for calculating equinor concentrations of the reaction shown. what is the expression for the equilibrium constant 2NOCI(g) S 2NO(g) + Cl2(g) [NOCIJ [NO] (C12] 0.20 M OM ом NOCH N ICHT d. 2 + (0.2-2x) e. 4x² (0.2–2x)2 x3 (0.2-x)? 4x 4x3 (0.2x)
Please show all work. Provide equations used for full credit. Please use correct significant figures and correct units in answers. The reaction, 2NOBr(g) + 2NO(g) + Br2(8) has an equilibrium constant, K = 0.42 at 373 K. a. Calculate Agºrxn at 373 K. b. Using the value of AHºrxn = 45.38 k) and the AGºrxn calculated in part a, calculate the ASºrxn at 373 K. Consider the reaction: 2NO(g) + C12(8) + 2NOCI(g) Given the following table of thermodynamic data,...
1. At a particular temperature, a 3.0-L flask contains 2.4 mol Cl2, 1.0 mol NOCI, and 4.5 x 10-3 mol NO. Calculate K at this temperature for the following reaction: 2NOCI(g) — 2NO(g) + C13(g) 2. At a particular temperature, 8.0 mol NO2 is placed into a 1.0-L container and the NO2 dissociates by the reaction: 2NO,(8) 2NO(g) + 0,(8) At equilibrium the concentration of NO(g) is 2.0 M. Calculate K for this reaction. 3. Ammonia is produced by the...
1. At a particular temperature, a 3.0-L flask contains 2.4 mol Cl2, 1.0 mol NOCI, and 4.5 x 10-3 mol NO. Calculate K at this temperature for the following reaction: 2NOCI(g) — 2NO(g) + C13(g) 2. At a particular temperature, 8.0 mol NO2 is placed into a 1.0-L container and the NO2 dissociates by the reaction: 2NO,(8) 2NO(g) + 0,(8) At equilibrium the concentration of NO(g) is 2.0 M. Calculate K for this reaction. 3. Ammonia is produced by the...
Consider the following reaction: N2(9) + 3H2(9) = 2NH3(9) In a given experiment, 1.42 moles of N (9) and 4.01 moles of H2(g) were placed in a 4.12 L vessel. Complete the following table by entering numerical values in the Initial row and values containing the variable "x" in the Change and Equilibrium rows. Define x as the amount (mol/L) of Ny that reacts to reach equilibrium. Include signs in the Change column to indicate a gain or loss of...
pages 2-4 please! its equilibrium worksheet
2. A sample of gaseous BrCl is allowed to decompose in a closed container at 25C according to the equation below: 2BrCl(g) Bra(g) + Cl2(g) When the reaction reaches equilibrium, the following concentrations were obtained: [BrCl] = 0.38 M, [Cl:] = 0.26 M & [Br2] = 0.26 M. Determine the equilibrium constant for the reaction 3. A mixture of gases NOCI, Cl and NO was allowed to reach equilibrium at a particular temperature. The...
Write the expressions for Kp for the following reactions: 1. a) 2NH3(g) + Co2(g) N2CH40(s) + H20 (I) b) CuO (s) + H2(g) Cu(l)+H20 (g) 2. At room temperature, a 1.5 L flask contains 3.0 moles of Cl, 0.5 mole of NOCI, and 4.0x10 mole of NO. Calculate Ke at this temperature for the following reaction: 2NO (g) + Cl2(g) 2NOCİ (g) 0.00245 M, does this represent a system at M, [No] 0.2 M and [Ch] If [NOCI] 2.0x 10...
please answer all. thank u
Equm U ving reaction for Questions 1 - 3 and answer the questions based upon th sed upon this Consider the following reaction reaction: co (g) + 3 H, (g) + CH (9) + H2O (g) 1. At 25°C. Kega 4.0. What must be Kes 4.0. What must be the coat equilibrium If the rulibrium concentrations on HJE 2.0M, (CH) = 5.OM, and [HO] - 3.OM? Answer: 0.469 M a way to keep track of...
Consider the following reaction for Questions 1.3 and answer the questions based upon this GU u IIULS reaction: CÓ (g) + 3 H (g) + CH4 (g) + H2O (G) 1. At 25°C, Keq=4.0. What must be the Co] at equilibrium If the equilibrium concentrations of [H.]= 2.0M. (CH) = 5.0M, and (HO) = 3.OM? Answer: 0.469 M The ICE table is a way to keep track of what is happening in the reaction vessel. The initial concentrations if given...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 24 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 1 hour ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 1 hour ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago