Homework Answers
Add Answer to:
YOU NEED TO SHOW ALL YOUR WORK TO RECEIVE FULL CREDITI Calculate the moles of Na2CO3...
2. Write the balanced equation with physical states 3. Calculate maximum/theoretical yield of MgCO3 from each...
2.
Write the balanced equation with physical states
3. Calculate maximum/theoretical yield of MgCO3 from each
reactant and determine limiting reactant of this reaction. How much
excess reactant is there?
Precipitate: 2. Write the balanced equation for the reaction to be performed in this experiment. Be sure to include physical states. CaCl2.2H2O + Na2CO3 3. In another experiment, a student used 0.50 g of MgSO4 and 0.30 g of Na2CO3. a. Calculate the maximum/theoretical yield of MgCO3 from each of...
Work each of the following problems. SHOW ALL WORK TO RECEIVE ANY CREDIT (Hint: Make sure...
Work each of the following problems. SHOW ALL WORK TO RECEIVE ANY CREDIT (Hint: Make sure your chemical equations are balanced.) 1. When 18.0 g of O2 reacts with 25.0 g of CHSOH, what is the limiting reactant? What is the theoretical yield in grams of CO2? C2HsOH +O2 CO2 +H2On 2. What is the limiting reactant when 126 g of Ag reacts with 142 g of HNO,? What is the theoretical yield in grams of AgNO3? AgNO (a) +NO+H2O...
Chem 143 - Lab 46) CALCULATE THE THEORETICAL YIELD Grams of sodium carbonate used Moles of...
Chem 143 - Lab 46) CALCULATE THE THEORETICAL YIELD Grams of sodium carbonate used Moles of sodium carbonate used Grams of calcium chloride used Moles of calcium chloride used Moles of precipitate expected Theoretical yield of precipitate in grams Actual yield of precipitate in grams Percent yield 5.6 Show detailed work for percent yield. Page 4 of 4 Chem 143 - Lab Pre-lab Exercise Show the details of each calculation to get full credit 1. Magnesium oxide, a white powdery...
D. Complete the following stoichiometry problems. Show ALL of your work to receive full credit. Equations...
D. Complete the following stoichiometry problems. Show ALL of your work to receive full credit. Equations and mole-to-mole relationships 21. For the following reaction: 4Cr(s) + 302(g) → 2Cr2O3(s) a. How many moles of oxygen (O2) would react with 0.35 moles of chromium (Cr)? b. Starting with 10.4g of Oz, how many moles of Cr203 can be produced: c. How many grams of Cr metal would be needed to produce 38.2g of chromium (III) oxide? 22. Sulfuric acid (H2SO4) is...
ASAP Stoichiometry can anyone tell me how to calculate NA2CO3+CACL2->CACO3+2NACL let's suppose mass of CACL2*2H2O =...
ASAP Stoichiometry can anyone tell me how to calculate NA2CO3+CACL2->CACO3+2NACL let's suppose mass of CACL2*2H2O = 1.0337g, vol of CACL2 = 17mL and NA2CO3 is 10mL. How can I get moles of Cacl2 and Na2CO3? limiting reagent, remaining excess reagent and theoretical yield as well!
What is the theoretical yield of sodium carbonate (Na2CO3) product, in moles, if all 3.21 g...
What is the theoretical yield of sodium carbonate (Na2CO3) product, in moles, if all 3.21 g of sodium bicarbonate starting material reacts? Show your work below, and record your answer in moles of sodium carbonate. Hint: Use the mole ratio from the balanced chemical equation.
(III) When 50.0 mL of a 0.3000 M AgNO, solution is added to 50.0 mL of...
(III) When 50.0 mL of a 0.3000 M AgNO, solution is added to 50.0 mL of a 0.2000 M solution of MgCl, an AgCl precipitate forms immediately. The precipitate is then filtered from the solution, dried, and weighed. If the recovered AgCl is found to have a mass of 1.7825 g, what is the percentage yield of the product, 1) Write the balanced equation for the reaction. 2) Calculate number of moles of each reactant and determine which one is...
part of one question perform ice stable on 2 all information needed is given, please read...
part of one question perform ice stable on 2
all
information needed is given, please read the question carefully on
#1 it's all connected
Green Limiting Reagent IN ne Write the balanced chemical equation for the reaction and complete the table below. Be sure use the correct number of significant figures. Remember that leading zeros are not considered nificant Reaction = Initial moles Change moles End moles End moles numerical + What does x equal? Calculate the molar masses for...
help with # 7 Data Table: Reactant 1 Identity_NaCO,H,O 124.00 g/mol Mass 1.02 g Reactant 2...
help with # 7
Data Table: Reactant 1 Identity_NaCO,H,O 124.00 g/mol Mass 1.02 g Reactant 2 Identity_MnS0, H,0 169.02 g/mol Mass_1.04 g Observation of chemical reaction. Include observations about color of precipitate! Immediately after adding the two aqueous solutions together a pale pink precipitate formed. 1.49 g Mass of filter paper + precipitate Mass of filter paper Mass of precipitate (actual yield) 0.83 g 0.66 g Analysis: 1. Write the balanced chemical equation for this reaction. 2. Use a solubility...
may you please provide details on how you recieved the answer thank you. 3 pages. Chem...
may
you please provide details on how you recieved the answer thank
you.
3 pages.
Chem 143 - Lab Pre-lab Exercise Show the details of each calculation to get full credit 1. Magnesium oxide, a white powdery substance can often be made by heating magnesium metal in presence of oxygen. a. Write the balanced chemical equation for this reaction (including the state symbols such as (s) () or (aq)] b. When 10.1 g magnesium is allowed to react with 10.5g...
2.
Write the balanced equation with physical states
3. Calculate maximum/theoretical yield of MgCO3 from each
reactant and determine limiting reactant of this reaction. How much
excess reactant is there?
Precipitate: 2. Write the balanced equation for the reaction to be performed in this experiment. Be sure to include physical states. CaCl2.2H2O + Na2CO3 3. In another experiment, a student used 0.50 g of MgSO4 and 0.30 g of Na2CO3. a. Calculate the maximum/theoretical yield of MgCO3 from each of...
Work each of the following problems. SHOW ALL WORK TO RECEIVE ANY CREDIT (Hint: Make sure your chemical equations are balanced.) 1. When 18.0 g of O2 reacts with 25.0 g of CHSOH, what is the limiting reactant? What is the theoretical yield in grams of CO2? C2HsOH +O2 CO2 +H2On 2. What is the limiting reactant when 126 g of Ag reacts with 142 g of HNO,? What is the theoretical yield in grams of AgNO3? AgNO (a) +NO+H2O...
Chem 143 - Lab 46) CALCULATE THE THEORETICAL YIELD Grams of sodium carbonate used Moles of sodium carbonate used Grams of calcium chloride used Moles of calcium chloride used Moles of precipitate expected Theoretical yield of precipitate in grams Actual yield of precipitate in grams Percent yield 5.6 Show detailed work for percent yield. Page 4 of 4 Chem 143 - Lab Pre-lab Exercise Show the details of each calculation to get full credit 1. Magnesium oxide, a white powdery...
D. Complete the following stoichiometry problems. Show ALL of your work to receive full credit. Equations and mole-to-mole relationships 21. For the following reaction: 4Cr(s) + 302(g) → 2Cr2O3(s) a. How many moles of oxygen (O2) would react with 0.35 moles of chromium (Cr)? b. Starting with 10.4g of Oz, how many moles of Cr203 can be produced: c. How many grams of Cr metal would be needed to produce 38.2g of chromium (III) oxide? 22. Sulfuric acid (H2SO4) is...
(III) When 50.0 mL of a 0.3000 M AgNO, solution is added to 50.0 mL of a 0.2000 M solution of MgCl, an AgCl precipitate forms immediately. The precipitate is then filtered from the solution, dried, and weighed. If the recovered AgCl is found to have a mass of 1.7825 g, what is the percentage yield of the product, 1) Write the balanced equation for the reaction. 2) Calculate number of moles of each reactant and determine which one is...
part of one question perform ice stable on 2
all
information needed is given, please read the question carefully on
#1 it's all connected
Green Limiting Reagent IN ne Write the balanced chemical equation for the reaction and complete the table below. Be sure use the correct number of significant figures. Remember that leading zeros are not considered nificant Reaction = Initial moles Change moles End moles End moles numerical + What does x equal? Calculate the molar masses for...
help with # 7
Data Table: Reactant 1 Identity_NaCO,H,O 124.00 g/mol Mass 1.02 g Reactant 2 Identity_MnS0, H,0 169.02 g/mol Mass_1.04 g Observation of chemical reaction. Include observations about color of precipitate! Immediately after adding the two aqueous solutions together a pale pink precipitate formed. 1.49 g Mass of filter paper + precipitate Mass of filter paper Mass of precipitate (actual yield) 0.83 g 0.66 g Analysis: 1. Write the balanced chemical equation for this reaction. 2. Use a solubility...
may
you please provide details on how you recieved the answer thank
you.
3 pages.
Chem 143 - Lab Pre-lab Exercise Show the details of each calculation to get full credit 1. Magnesium oxide, a white powdery substance can often be made by heating magnesium metal in presence of oxygen. a. Write the balanced chemical equation for this reaction (including the state symbols such as (s) () or (aq)] b. When 10.1 g magnesium is allowed to react with 10.5g...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 32 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago