Abrasion resistance is generally proportional to hardness. why are elastomers abrasions-resistant?
Abrasion resistance is generally proportional to hardness. why are elastomers abrasions-resistant?
Homework Answers
Add Answer to:
Abrasion resistance is generally proportional to
hardness. why are elastomers abrasions-resistant?
Why is it generally thought that microbes are less likely to develop resistance to biocides? Group...
Why is it generally thought that microbes are less likely to develop resistance to biocides? Group of answer choices these compounds are only rarely used and do not accumulate in the environment biocides are generally non-toxic and so there is no benefit to resistance the biocide affects multiple cellular structures/functions in a susceptible cell microbes can safely degrade most biocides
Brief Background Penetration hardness is a measure of a materials resistance to indentation. The Rockwell Hardness...
Brief Background Penetration hardness is a measure of a materials resistance to indentation. The Rockwell Hardness test is a standard method for characterizing this property of a material. It uses a small indenter, either a hardened ball or diamond cone (Brale), which is pressed into the sample while measuring depth of penetration. There are several scales to select from as indicated in textbook or the chart found in lab. Each scale refers to the type of indenter used and the...
Rate the following materials based off of their fire resistance, 1 being least fire-resistant and 6...
Rate the following materials based off of their fire resistance, 1 being least fire-resistant and 6 being the most resistant. Steel, Masonry, Wood, Concrete, Polymer, Asphalt Explain why you chose your answers.
Antibiotic resistance occurs when disease-causing microbes become resistant to antibiotic drug therapy. Because this resistance is...
Antibiotic resistance occurs when disease-causing microbes become resistant to antibiotic drug therapy. Because this resistance is typically genetic and transferred to the next generation of microbes, it is a very serious public health problem. According to the CDC, 10% of gonorrhea cases tested in 2004 were resistant to the antibiotic ciprofloxacin. A physician prescribed ciprofloxacin for the treatment of 10 cases of gonorrhea during one week of 2004. Find the probability that at most 1 cases was resistant to ciprofloxacin....
If the bacterium proves to be resistant to cephalexin, resistance is likely due to what enzyme?
If the bacterium proves to be resistant to cephalexin, resistance is likely due to what enzyme?
Antibiotic resistance occurs when disease-causing microbes become resistant to antibiotic drug therapy. Because this resistance is...
Antibiotic resistance occurs when disease-causing microbes become resistant to antibiotic drug therapy. Because this resistance is typically genetic and transferred to the next generation of microbes, it is a very serious public health problem. According to the CDC, 7% of gonorrhea cases tested in 2004 were resistant to the antibiotic ciprofloxacin. A physician prescribed ciprofloxacin for the treatment of 10 cases of gonorrhea during one week in 2004. (c) What is that probability for exactly 2 out of 10?
If blood vessel resistance is proportional the inverse of the vessel radius, what would the magnitude...
If blood vessel resistance is proportional the inverse of the vessel radius, what would the magnitude of difference between a blood vessel with radius R versus a blood vessel with radius 2R? 2. a. Which of these would be better for oxygen transport, why?
Describe how you would generally design a superbug resistant to B-lactams, methicillin, streptomycin, daptomycin, and trimethoprim.
Describe how you would generally design a superbug resistant to B-lactams, methicillin, streptomycin, daptomycin, and trimethoprim.
Describe how you would generally design a superbug resistant to B-lactams, methicillin, streptomycin, daptomycin, and trimethoprim.
Describe how you would generally design a superbug resistant to B-lactams, methicillin, streptomycin, daptomycin, and trimethoprim.
Biochemistry chapter9 problem 15 (Berg, 8th) 45 Viva la resistance. Many patients become resistant to HIV...
Biochemistry chapter9 problem 15 (Berg, 8th)
45 Viva la resistance. Many patients become resistant to HIV protease inhibitors with the passage of time owing to mutations in the HIV gene that encodes the protease Mutations are not found in the aspartate residue that inter- acts with the drugs. Why not? Jiam
Brief Background Penetration hardness is a measure of a materials resistance to indentation. The Rockwell Hardness test is a standard method for characterizing this property of a material. It uses a small indenter, either a hardened ball or diamond cone (Brale), which is pressed into the sample while measuring depth of penetration. There are several scales to select from as indicated in textbook or the chart found in lab. Each scale refers to the type of indenter used and the...
If the bacterium proves to be resistant to cephalexin, resistance is likely due to what enzyme?
If blood vessel resistance is proportional the inverse of the vessel radius, what would the magnitude of difference between a blood vessel with radius R versus a blood vessel with radius 2R? 2. a. Which of these would be better for oxygen transport, why?
Biochemistry chapter9 problem 15 (Berg, 8th)
45 Viva la resistance. Many patients become resistant to HIV protease inhibitors with the passage of time owing to mutations in the HIV gene that encodes the protease Mutations are not found in the aspartate residue that inter- acts with the drugs. Why not? Jiam
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 24 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago