Homework Answers
Add Answer to:
What is the correct order for the atomic orbitals? Select one: O a. - p, d,...
Date 02/12/2020 PreLab Assignment Experiment 3: HESS is Just a Four Letter Word Consider the following...
Date 02/12/2020 PreLab Assignment Experiment 3: HESS is Just a Four Letter Word Consider the following reactions 1 CHaq) 2 Org) - CO2(g) + 2 H2O(l): AH=-890 kJ/mol 2 2 CHelg) + 4 Ong) -- 2 CO2(g) + 4H2O(l): AH=-1780 kJ/mol 3. CO2(g) + 2 H2O(l) - CHI(g) + 2 O2(g): AH= 890 kJ/mol 2 H2O(l) -- 2 H2O(g): AH = 88 kJ/mol Quantitatively, how does the change in enthalpy, AH for reaction #1 compare to the change in enthalpy...
(e) a- use of s and p atomic orbitals b- use of s, p, and d...
(e)
a- use of s and p atomic orbitals
b- use of s, p, and d atomic orbitals
c-use of only s orbitals
d-generation of more than four hybrid orbitals
Hybrid Orbitals Use the animation to answer the following questions. (a) Mixing yellow and blue atomic orbitals can produce: 2, 3 or 4 hybrid orbitals. O 4 or 5 hybrid orbitals. 1 or 2 hybrid orbital(s). O 5 or 6 hybrid orbitals. (b) Mixing one yellow atomic orbital and one...
After the s, p, d, and f orbitals, the next higher series is the g series....
After the s, p, d, and f orbitals, the next higher series is the g series. a. How many electrons does each g subshell hold? b. What is the lowest principal energy level in which g orbitals can exist?
Please help with both as its the last attempt remaining What is the AHF for the...
Please help with both as its the last attempt remaining
What is the AHF for the following reaction? C(s) + 2H2(g) - CHA(g) Use: CO2(g) = -393.15 kJ H2O(g) = -241.8 kJ H20 (1) = -285.8 kJ CaCO3(s) =-1206.9 kJ CaO(s)= -635.1k NH3(g) = 46.1 kJ CH4(g) = -74.8 kJ PC13(1) = -319.7 kJ C6H6(1) = +49.0 kj NO2(g) = +34.0 kJ CH3OH(1) = -239.0 kJ C3H18(1) = -269.0 kJ Al2O3(s) =-1675.7 kJ SiO2(s) =-910.9 kJ CuSO4(s) =-771.4 kJ OA....
DUE TOMORROW!!! Name Lab Instructor Date SS is Just a Four Letter Word UUUUUUU Pre Lab Assignment Experiment 3: HES...
DUE TOMORROW!!!
Name Lab Instructor Date SS is Just a Four Letter Word UUUUUUU Pre Lab Assignment Experiment 3: HESS is Just a Four Le Consider the following reactions 1. CH(g) + 2 O2(g) - CO2(g) + 2 H20(1): AH=-890 kJ/mol 2. 2 CH (9) + 4 O2(g) – 2 CO2(g) + 4H2O(): AH=-1780 kJ/mo 3. CO2(g) + 2 H2O(l) - CHug) +2 02(g): AH=890 kJ/mol 4. 2 H2O(l) + 2 H2O(g): AH = 88 kJ/mol Quantitatively, how does the...
Arrange the following gases in order of decreasing standard molar entropy: N204(9), NO(g), NO2(g). Select one:...
Arrange the following gases in order of decreasing standard molar entropy: N204(9), NO(g), NO2(g). Select one: O a. N204> NO > NOZ O b. N204 > NO2 > NO O C. NO2 > NO > N20. O d. NO > NO2 > N204 e. NO > N204 > NO2 Which of the following reactions will shift to the left if the volume is decreased? Select one: H2 (8) + Cl2 (8) DIL 2 HCI (8) OD b. 2 SO3 (8)...
Using the bond enthalpies in the Average Bond Enthalpies table, determine the approximate enthalpy (in kJ)...
Using the bond enthalpies in
the Average Bond Enthalpies table, determine the approximate
enthalpy (in kJ) for each of the following reactions. (Assume the
average bond enthalpy of the Cl–F bond is 254 kJ/mol.) (a) Cl2(g) +
3 F2(g) → 2 ClF3(g) (b) H2C=CH2(g) + H2(g) → H3CCH3(g) (c) 2
CH3(C=O)H(g) + 5 O2(g) → 4 CO2(g) + 4 H2O(g)
ITITIT Average Bond Enthalpies AH bond (kJ/mol) bond AHond (kJ/mol) bond AH bond (kJ/mol) bond bond AH bond (kJ/mol) С-Н...
Which one of the following statements is true? O H is the value of a measured...
Which one of the following statements is true? O H is the value of a measured under conditions of constant volume. The enthalpy change for a reaction is independent of the state of the reactants and products. Enthalpy is a state function. O Enthalpy is an intensive property. The enthalpy change of a reaction is the reciprocal of the AH of the reverse reaction. QUESTION 2 0.5 points Save Answer Given the following reactions N2 (g) + 2O2 (g) +...
please help with 3 and 8 please 3. Draw a properly labeled Bom-Haber cycle for the formation of MgF:(s) from Mg(o) and F-(S 4. Draw Lewis Electron Dot Structures for the following molecules: a)...
please help with 3 and 8 please
3. Draw a properly labeled Bom-Haber cycle for the formation of MgF:(s) from Mg(o) and F-(S 4. Draw Lewis Electron Dot Structures for the following molecules: a) H20 b) CO2 d) PF 5. Determine the structures for the following molecules using the VSEPR theory. b) SF4 a) NH3 c) CIF3 6. a) Determine the structures for each of the following ions using the VSEPR theory. 2- i) NOs i) CO b) Draw 2...
Date 02/12/2020 PreLab Assignment Experiment 3: HESS is Just a Four Letter Word Consider the following reactions 1 CHaq) 2 Org) - CO2(g) + 2 H2O(l): AH=-890 kJ/mol 2 2 CHelg) + 4 Ong) -- 2 CO2(g) + 4H2O(l): AH=-1780 kJ/mol 3. CO2(g) + 2 H2O(l) - CHI(g) + 2 O2(g): AH= 890 kJ/mol 2 H2O(l) -- 2 H2O(g): AH = 88 kJ/mol Quantitatively, how does the change in enthalpy, AH for reaction #1 compare to the change in enthalpy...
(e)
a- use of s and p atomic orbitals
b- use of s, p, and d atomic orbitals
c-use of only s orbitals
d-generation of more than four hybrid orbitals
Hybrid Orbitals Use the animation to answer the following questions. (a) Mixing yellow and blue atomic orbitals can produce: 2, 3 or 4 hybrid orbitals. O 4 or 5 hybrid orbitals. 1 or 2 hybrid orbital(s). O 5 or 6 hybrid orbitals. (b) Mixing one yellow atomic orbital and one...
Please help with both as its the last attempt remaining
What is the AHF for the following reaction? C(s) + 2H2(g) - CHA(g) Use: CO2(g) = -393.15 kJ H2O(g) = -241.8 kJ H20 (1) = -285.8 kJ CaCO3(s) =-1206.9 kJ CaO(s)= -635.1k NH3(g) = 46.1 kJ CH4(g) = -74.8 kJ PC13(1) = -319.7 kJ C6H6(1) = +49.0 kj NO2(g) = +34.0 kJ CH3OH(1) = -239.0 kJ C3H18(1) = -269.0 kJ Al2O3(s) =-1675.7 kJ SiO2(s) =-910.9 kJ CuSO4(s) =-771.4 kJ OA....
DUE TOMORROW!!!
Name Lab Instructor Date SS is Just a Four Letter Word UUUUUUU Pre Lab Assignment Experiment 3: HESS is Just a Four Le Consider the following reactions 1. CH(g) + 2 O2(g) - CO2(g) + 2 H20(1): AH=-890 kJ/mol 2. 2 CH (9) + 4 O2(g) – 2 CO2(g) + 4H2O(): AH=-1780 kJ/mo 3. CO2(g) + 2 H2O(l) - CHug) +2 02(g): AH=890 kJ/mol 4. 2 H2O(l) + 2 H2O(g): AH = 88 kJ/mol Quantitatively, how does the...
Arrange the following gases in order of decreasing standard molar entropy: N204(9), NO(g), NO2(g). Select one: O a. N204> NO > NOZ O b. N204 > NO2 > NO O C. NO2 > NO > N20. O d. NO > NO2 > N204 e. NO > N204 > NO2 Which of the following reactions will shift to the left if the volume is decreased? Select one: H2 (8) + Cl2 (8) DIL 2 HCI (8) OD b. 2 SO3 (8)...
Using the bond enthalpies in
the Average Bond Enthalpies table, determine the approximate
enthalpy (in kJ) for each of the following reactions. (Assume the
average bond enthalpy of the Cl–F bond is 254 kJ/mol.) (a) Cl2(g) +
3 F2(g) → 2 ClF3(g) (b) H2C=CH2(g) + H2(g) → H3CCH3(g) (c) 2
CH3(C=O)H(g) + 5 O2(g) → 4 CO2(g) + 4 H2O(g)
ITITIT Average Bond Enthalpies AH bond (kJ/mol) bond AHond (kJ/mol) bond AH bond (kJ/mol) bond bond AH bond (kJ/mol) С-Н...
Which one of the following statements is true? O H is the value of a measured under conditions of constant volume. The enthalpy change for a reaction is independent of the state of the reactants and products. Enthalpy is a state function. O Enthalpy is an intensive property. The enthalpy change of a reaction is the reciprocal of the AH of the reverse reaction. QUESTION 2 0.5 points Save Answer Given the following reactions N2 (g) + 2O2 (g) +...
please help with 3 and 8 please
3. Draw a properly labeled Bom-Haber cycle for the formation of MgF:(s) from Mg(o) and F-(S 4. Draw Lewis Electron Dot Structures for the following molecules: a) H20 b) CO2 d) PF 5. Determine the structures for the following molecules using the VSEPR theory. b) SF4 a) NH3 c) CIF3 6. a) Determine the structures for each of the following ions using the VSEPR theory. 2- i) NOs i) CO b) Draw 2...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 39 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago