Homework Answers
Add Answer to:
A)
Give THREE ways you could convert a ketone to a secondary alcohol.
List all necessary...
which of the following is the structure of 2-ethylbenzamide 3. (20 points) The following alcohol undergo...
which of the following is the structure of
2-ethylbenzamide
3. (20 points) The following alcohol undergo chromic acid test. Complete the blank for each alcohol Color after reaction is test positive or negative? Class of Alcohol CH₂ - CHCH, CH, CH, ан,— —днан, Color after reaction is test positive or negative? Class of Alcohol Color after reaction is test positive or negative? Class of Alcohol at CH2OH & CH₂ CH3 6th c Color after reaction is test positive or negative?...
After SB HW1 for Org Chem II. Part 1 (out of 3) 1. Write chemical equation,...
After SB HW1 for Org Chem II. Part 1 (out of 3) 1. Write chemical equation, showing all necessary reagents, for the preparation of 3-pentanol by reducing a ketone. 2. Which of the isomeric C5H120 alcohols can be prepared by lithium aluminum hydride reduction of a. An aldehyde b. A ketone c. A carboxylic acid 3. Write chemical equation, showing all necessary reagents, for the preparation of 3-pentanol using Grignard reagent. 4. Provide the structure of the product: OH on.o...
7) What reagents are needed to do the following transformation? Page 3 A) 1) BH, THF,...
7) What reagents are needed to do the following transformation? Page 3 A) 1) BH, THF, H,02, OH- 2) KMnO, OH 3) H30 B) 1) HBr 2) K,Cr, C) 1) LIATH. 2) H30* 3) PBr; 4) KCN D.1) PCC 2 H O 3) CHỊCOCI 4) NH” 8) Which compound is a soap? A) CH3(CH2)2COOH B) CH3(CH2)4COOH C) CH(CH2)14COOH D) CH3(CH2)14COOK 9) Name the carboxylic acid and the alcohol that react to produce this compound. (CH3)3CCH2COOCH(CH2CH3)2 A) 3,3-dimethylbutanoic acid and 3-pentanol...
Homework Problems 8.1 Draw the structural formula for each of the following: a. 5-chloro-4-methyl-2-hexanol b. 2,3-dimethylcyclopentanol...
Homework Problems 8.1 Draw the structural formula for each of the following: a. 5-chloro-4-methyl-2-hexanol b. 2,3-dimethylcyclopentanol c. 5,5-diethyl-1-heptanol d. 2-ethyl-4-isopropylcyclohexanol e. 4-ethylphenol f. 2-nitrophenol g. cyclopropyl methyl ether h. isopropyl propyl ether 8.2 Give the product for the dehydration of each of the following alcohols. CH-CH2-CH3 a. ОН b. ОН C. OH d. 8.3 What product would result from the oxidation of each of the following alcohols? Write the chemical equations. a. 2-butanol b. 2-methyl-2-pentanol c. cyclohexanol d. 3-ethylcyclopentanol Name...
Ketone alcohol alcohol alkyne aldehyde alkene amide amine Melatonin Bromatic Review Constanta Part A Give the...
Ketone alcohol alcohol alkyne aldehyde alkene amide amine Melatonin Bromatic Review Constanta Part A Give the IUPAC name of the ester shown. Carboxylic acid derivatives are organic compounds which the hydroxyl group of a carboxylic acid RCO-OH) is replaced with another group, such s an OR group (esters) or an-NH, NHR, + NR2 group (amides) determine the IUPAC name of an ester, follow he steps below 1. Name the R group of the COOR ester group as an alkyl group....
Questions for the lab: 1. Give a structure for each of the following formulas that show...
Questions for the lab: 1. Give a structure for each of the following formulas that show only one (1) peak in the proton NMR. a. CH&0 b. C110 2. How would you distinguish between each of the following compounds using H-NMR? a. O CH3 and Cl 12-C-OH methyl benzoate phenylacetic acid b. CH2-C-OH and H;C phenylacetic acid CH3 4-methylbenzoic acid ta c. CH3-C-CH3 and CH3-CH2-CH-??? 2-butanol ?? t-butyl alcohol and H3C CH3 1,4-dimethylbenzene 1,2-dimethylbenzene 3. Identify a compound, C,H2O, that...
What results when a secondary alcohol is oxidized? a. a ketone d. an acid b. an...
What results when a secondary alcohol is oxidized? a. a ketone d. an acid b. an amine e. no reaction c. an aldehyde Which of the following combinations will react spontaneously? A. 12 + Cu2+ B. Pb2+ + Ag C. Zn2+ + Mg D. Sn2+ + Ni2+ The general formula for a cycloalkane can be represented by which of the following? a. C,H, C. CH b. C.H2n+2 d. C.H21-2 In a certain reaction AH =-136 kJ and E, = 96...
organic chemistry 1.1 pt) Which reagent would you use to effect the following transformation of a...
organic chemistry
1.1 pt) Which reagent would you use to effect the following transformation of a diol into a keto acid? ОН Reagent? CH,CHCH,CH,CH,OH - CH,CCH,CH,сон a) Jones(H2Cr2O7) b) Tollens c) mCPBA d) Collins(PCC) e) LiAlH4 2.(2 pts) Circle the TWO compounds that yield a stable Grignard reagent when treated with magnesium in ether. Br CHÚC HỌC=CH- CH,OH HN 3.(2 pts each) Reactions. Complete each reaction shown here. HỌC=CH- + HC=CH- -CH OH он 1. CH CH MgBrCH,CH,CH=CHCCH2CH3 2.H2O Сн,...
Using the reagents below, list in order (by letter, no period) those necessary to convert the...
Using the reagents below, list in order (by letter, no period) those necessary to convert the starting material into the given product: OE- Note: Not all spaces provided may be needed. Type "na" in any space where no reagent a. heat, -CO2 b. NaoEt c. (CH3CH2)2Culi d. CH2Cl2, PCC e. C3H COCH(C2H5)C(0)CH f. CH3CH2LI 9. HA, CHOH h. i. C2H5OC(O)(O)OC2H5, NaoEt il. H30* 1. HNC(O)NH2 3. H(CH3)2 k. OH, H20, heat then H30* 1. H30 Step . 1 Step Step...
please answer all :) 250 Chapter 9 Chapter 9 Practice Test Which of the following reagents...
please answer all :)
250 Chapter 9 Chapter 9 Practice Test Which of the following reagents is the best one to use in order to wing reagents is the best one to use in order to convert methyl alcohol into methy bromide? 2. Br HBr Br NaBr Br* a. what would be the major product obtained from the reaction of the epoxide shown below containing 0.1 M HCI? CH2CH; CH CH3 b. What would be the major product obtained from...
which of the following is the structure of
2-ethylbenzamide
3. (20 points) The following alcohol undergo chromic acid test. Complete the blank for each alcohol Color after reaction is test positive or negative? Class of Alcohol CH₂ - CHCH, CH, CH, ан,— —днан, Color after reaction is test positive or negative? Class of Alcohol Color after reaction is test positive or negative? Class of Alcohol at CH2OH & CH₂ CH3 6th c Color after reaction is test positive or negative?...
After SB HW1 for Org Chem II. Part 1 (out of 3) 1. Write chemical equation, showing all necessary reagents, for the preparation of 3-pentanol by reducing a ketone. 2. Which of the isomeric C5H120 alcohols can be prepared by lithium aluminum hydride reduction of a. An aldehyde b. A ketone c. A carboxylic acid 3. Write chemical equation, showing all necessary reagents, for the preparation of 3-pentanol using Grignard reagent. 4. Provide the structure of the product: OH on.o...
7) What reagents are needed to do the following transformation? Page 3 A) 1) BH, THF, H,02, OH- 2) KMnO, OH 3) H30 B) 1) HBr 2) K,Cr, C) 1) LIATH. 2) H30* 3) PBr; 4) KCN D.1) PCC 2 H O 3) CHỊCOCI 4) NH” 8) Which compound is a soap? A) CH3(CH2)2COOH B) CH3(CH2)4COOH C) CH(CH2)14COOH D) CH3(CH2)14COOK 9) Name the carboxylic acid and the alcohol that react to produce this compound. (CH3)3CCH2COOCH(CH2CH3)2 A) 3,3-dimethylbutanoic acid and 3-pentanol...
Homework Problems 8.1 Draw the structural formula for each of the following: a. 5-chloro-4-methyl-2-hexanol b. 2,3-dimethylcyclopentanol c. 5,5-diethyl-1-heptanol d. 2-ethyl-4-isopropylcyclohexanol e. 4-ethylphenol f. 2-nitrophenol g. cyclopropyl methyl ether h. isopropyl propyl ether 8.2 Give the product for the dehydration of each of the following alcohols. CH-CH2-CH3 a. ОН b. ОН C. OH d. 8.3 What product would result from the oxidation of each of the following alcohols? Write the chemical equations. a. 2-butanol b. 2-methyl-2-pentanol c. cyclohexanol d. 3-ethylcyclopentanol Name...
Ketone alcohol alcohol alkyne aldehyde alkene amide amine Melatonin Bromatic Review Constanta Part A Give the IUPAC name of the ester shown. Carboxylic acid derivatives are organic compounds which the hydroxyl group of a carboxylic acid RCO-OH) is replaced with another group, such s an OR group (esters) or an-NH, NHR, + NR2 group (amides) determine the IUPAC name of an ester, follow he steps below 1. Name the R group of the COOR ester group as an alkyl group....
Questions for the lab: 1. Give a structure for each of the following formulas that show only one (1) peak in the proton NMR. a. CH&0 b. C110 2. How would you distinguish between each of the following compounds using H-NMR? a. O CH3 and Cl 12-C-OH methyl benzoate phenylacetic acid b. CH2-C-OH and H;C phenylacetic acid CH3 4-methylbenzoic acid ta c. CH3-C-CH3 and CH3-CH2-CH-??? 2-butanol ?? t-butyl alcohol and H3C CH3 1,4-dimethylbenzene 1,2-dimethylbenzene 3. Identify a compound, C,H2O, that...
What results when a secondary alcohol is oxidized? a. a ketone d. an acid b. an amine e. no reaction c. an aldehyde Which of the following combinations will react spontaneously? A. 12 + Cu2+ B. Pb2+ + Ag C. Zn2+ + Mg D. Sn2+ + Ni2+ The general formula for a cycloalkane can be represented by which of the following? a. C,H, C. CH b. C.H2n+2 d. C.H21-2 In a certain reaction AH =-136 kJ and E, = 96...
organic chemistry
1.1 pt) Which reagent would you use to effect the following transformation of a diol into a keto acid? ОН Reagent? CH,CHCH,CH,CH,OH - CH,CCH,CH,сон a) Jones(H2Cr2O7) b) Tollens c) mCPBA d) Collins(PCC) e) LiAlH4 2.(2 pts) Circle the TWO compounds that yield a stable Grignard reagent when treated with magnesium in ether. Br CHÚC HỌC=CH- CH,OH HN 3.(2 pts each) Reactions. Complete each reaction shown here. HỌC=CH- + HC=CH- -CH OH он 1. CH CH MgBrCH,CH,CH=CHCCH2CH3 2.H2O Сн,...
Using the reagents below, list in order (by letter, no period) those necessary to convert the starting material into the given product: OE- Note: Not all spaces provided may be needed. Type "na" in any space where no reagent a. heat, -CO2 b. NaoEt c. (CH3CH2)2Culi d. CH2Cl2, PCC e. C3H COCH(C2H5)C(0)CH f. CH3CH2LI 9. HA, CHOH h. i. C2H5OC(O)(O)OC2H5, NaoEt il. H30* 1. HNC(O)NH2 3. H(CH3)2 k. OH, H20, heat then H30* 1. H30 Step . 1 Step Step...
please answer all :)
250 Chapter 9 Chapter 9 Practice Test Which of the following reagents is the best one to use in order to wing reagents is the best one to use in order to convert methyl alcohol into methy bromide? 2. Br HBr Br NaBr Br* a. what would be the major product obtained from the reaction of the epoxide shown below containing 0.1 M HCI? CH2CH; CH CH3 b. What would be the major product obtained from...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 12 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago