in a rigid, sealed container there are 6 moles of gas A, 4 moles of gas...
in a rigid, sealed container there are 6 moles of gas A, 4 moles of gas B, and 5 moles of gas C. If the total pressure in the container is measured to be 5 atm, what is the partial pressure of gas B? answer=1.33 atm idk how to get
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
in a rigid, sealed container there are 6 moles of gas A, 4 moles
of gas...
4. A) The gas pressure inside a sealed, rigid container is 1 atm at 100 K....
4. A) The gas pressure inside a sealed, rigid container is 1 atm at 100 K. What is the pressure at 200 K?
Ammonia is created in the Haber process in a rigid container (nitrogen gas plus hydrogen gas...
Ammonia is created in the Haber process in a rigid container (nitrogen gas plus hydrogen gas react to form ammonia gas). 2 moles of hydrogen gas are mixed with 4 moles of nitrogen gas. The initial pressure exerted on the container is 5 atm. Assuming the reaction runs to completion, what will the pressure (in atm) on the vessel be after the reaction takes place?
Consider a gas in a sealed, rigid container. Which of the following will increase if more...
Consider a gas in a sealed, rigid container. Which of the following will increase if more gas is pumped into the container at constant temperature? Check all that apply. View Available Hint(s) Check all that apply. a) the kinetic energy of the gas particles b) the volumes of the individual gas particles c) the speed of the gas particles d) the number of gas particles e) the collision frequency of the gas particles f) the pressure of the gas
0.189 moles of ethane gas are mixed with 2.1 moles of oxygen in a sealed container...
0.189 moles of ethane gas are mixed with 2.1 moles of oxygen in a sealed container and the mixture is then ignited (initiating a combustion reaction) to form carbon dioxide and water. 2 C2H6(g) + 702(g) 4CO2(g) + 6H2O(g) What is the volume of CO2 formed when the partial pressure of CO2 is 200 kPa and a temperature of 200 °C? (Assume that all gases behave ideally). (A) (B) (C) (D) (E) 7.4 x 10-3 m3 3.7* 10-3 m3 4.1...
1.Ammonia is created in the Haber process in a rigid container (nitrogen gas plus hydrogen gas react to form ammonia gas...
1.Ammonia is created in the Haber process in a rigid container (nitrogen gas plus hydrogen gas react to form ammonia gas). 2.0 moles of hydrogen gas are mixed with 4.0 moles of nitrogen gas. The initial pressure exerted on the container is 5.0 atm. Assuming the reaction runs to completion, what will the pressure (in atm) on the vessel be after the reaction takes place? 2.Pentane gas reacts with oxygen gas to give carbon dioxide gas and water vapor (gas)....
a) A sealed container filled with an ideal gas is heated such that it expands isobarically...
a) A sealed container filled with an ideal gas is heated such that it expands isobarically from a volume of 1 m^3 to 3 m^3 at a pressure of 1 kPa. How much work is done by the gas? b) The gas is then heated isochorically to a pressure of 2 kPa. How much work is done by the gas? c) The gas now has a volume of 3 m^3 and a pressure of 2 kPa. If there are 2...
Ideal Gas Law and Partial Pressures Name Directions: Calculate/answer the following: 1. 7.70 moles of Argon...
Ideal Gas Law and Partial Pressures Name Directions: Calculate/answer the following: 1. 7.70 moles of Argon at a pressure of 0.190 atm and at a temperature of 65.8 °C, what is the volume of the container that the gas is in? 2. A sample of gas is 17.0 moles at a temperature of 77.0 °C, and a volume of 98.9 liters, what is the pressure of the gas? 3. 28.0 moles of gas held at a pressure of 580 atm...
a. if a container which has a volume of 10cc is sealed with O2 T 25...
a. if a container which has a volume of 10cc is sealed with O2 T 25 degree Celsius and 1.00 atm pressure. If the container is heated to 500 Celsius, what will be the pressure exerted by O2 gas in the container? b. a sample of 1000mL of Ne gas is at a pressure of 290 mm Hg at 290K. What volume it will occupy if the pressure is increased to 500mm Hg and temperature to 600K? c. how many...
Part A A gas sample enclosed in a rigid metal container at room temperature (20.0∘C) has...
Part A A gas sample enclosed in a rigid metal container at room temperature (20.0∘C) has an absolute pressure p1. The container is immersed in hot water until it warms to 40.0∘C. What is the new absolute pressure p2? Express your answer in terms of p1. p2 = 1.0682p1 Part B Nitrogen gas is introduced into a large deflated plastic bag. No gas is allowed to escape, but as more and more nitrogen is added, the bag inflates to accommodate...
Submit A glass container was initially charged with 2.00 moles of a gas sample at 3.75...
Submit A glass container was initially charged with 2.00 moles of a gas sample at 3.75 atm and 21.7 °C Some of the gas was released as the temperature was increased to 28.1 °C, so the final pressure in the container was reduced to 0.998 atm. How many moles of the gas sample are present at the end? mol 1 23 6 9 0 4 5 7 8 x10
4. A) The gas pressure inside a sealed, rigid container is 1 atm at 100 K. What is the pressure at 200 K?
Ammonia is created in the Haber process in a rigid container (nitrogen gas plus hydrogen gas react to form ammonia gas). 2 moles of hydrogen gas are mixed with 4 moles of nitrogen gas. The initial pressure exerted on the container is 5 atm. Assuming the reaction runs to completion, what will the pressure (in atm) on the vessel be after the reaction takes place?
0.189 moles of ethane gas are mixed with 2.1 moles of oxygen in a sealed container and the mixture is then ignited (initiating a combustion reaction) to form carbon dioxide and water. 2 C2H6(g) + 702(g) 4CO2(g) + 6H2O(g) What is the volume of CO2 formed when the partial pressure of CO2 is 200 kPa and a temperature of 200 °C? (Assume that all gases behave ideally). (A) (B) (C) (D) (E) 7.4 x 10-3 m3 3.7* 10-3 m3 4.1...
Ideal Gas Law and Partial Pressures Name Directions: Calculate/answer the following: 1. 7.70 moles of Argon at a pressure of 0.190 atm and at a temperature of 65.8 °C, what is the volume of the container that the gas is in? 2. A sample of gas is 17.0 moles at a temperature of 77.0 °C, and a volume of 98.9 liters, what is the pressure of the gas? 3. 28.0 moles of gas held at a pressure of 580 atm...
Submit A glass container was initially charged with 2.00 moles of a gas sample at 3.75 atm and 21.7 °C Some of the gas was released as the temperature was increased to 28.1 °C, so the final pressure in the container was reduced to 0.998 atm. How many moles of the gas sample are present at the end? mol 1 23 6 9 0 4 5 7 8 x10
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 58 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago