Given the following equilibrium reaction: HI (aq) + H20 <- -> I- (aq) + H3O+ (aq)...
Given the following equilibrium reaction: HI (aq) + H20 <- -> I- (aq) + H3O+ (aq)
Indicate which of the following statements are true?
a. water is not acting as an acid or base
b. water is acting as a acid and its conjusgate base is I-
c. water is acting as a base and its conjugate is I-
d. HI is acting as a acid and its conjugare baseis I-
e. HI is acting as a base and its conjugate acid is I-
f. Water is acting as a base and its conjugate acid is H3O+
Homework Answers
answers :
d. HI is acting as a acid and its conjugare baseis I-
f. Water is acting as a base and its conjugate acid is H3O+
explanation:
HI (aq) + H20 <- --------------------------> I- (aq) + H3O+ (aq)
( acid ) ( base ) ( conjugate base) (conjugate acid)
an acid is a proton donar where as base is the proton acceptor.
here HI donating proton to H2O so it can act as an acid.
H2O accepting proton from HI so it is base
every acid has conjugate base
every base has conjugate acid
Add Answer to:
Given the following equilibrium reaction: HI (aq) + H20 <-
-> I- (aq) + H3O+ (aq)...
please show all work neatly 5. (2 pts) Consider the following acids and their dissociation constants HPO4-2(aq) + H2O.. H3O"(aq) + PO4-3(aq) Ka-2.2x 10.13 HCOOH(aq) H20 H3O (a) HCOO (aq) Ka =...
please show all work neatly
5. (2 pts) Consider the following acids and their dissociation constants HPO4-2(aq) + H2O.. H3O"(aq) + PO4-3(aq) Ka-2.2x 10.13 HCOOH(aq) H20 H3O (a) HCOO (aq) Ka = 1.8x10-4 a. Which is the weaker acid, HPO42 or HCOOH? b. What is the conjugate base of, HPO42 or c. Which acid has the weaker conjugate base? d. Which acid produces more ions? 6. (2 pts) Write a balanced equation for the neutralization of H3PO4(aq) and NaOH(aq) (3...
1. 2. If I have the reaction HF (aq) + H20 (1) = H3O+ (aq) +...
1.
2.
If I have the reaction HF (aq) + H20 (1) = H3O+ (aq) + F (aq), the expression K = (Select] / [Select] (Select] [H20] * [F-] [HF] * [F-] [H3O+]*[F] [HE] [HF] * [H20] [Select] [HE] [HF] * [H20] [H20] [F-) [H3O+] * [HF]
1) For the following reaction, which of the following is a conjugate acid-base pair? HC20(aq)+ H20)...
1) For the following reaction, which of the following is a conjugate acid-base pair? HC20(aq)+ H20) H:0 (aq) C0,(aq) a. HC20 and H20 b. H20 and C202 c. HC20 and H30 d. HCzOr and C20 2) The pH of a solution of hydrochloric acid is 1.5. What is the concentration of the acid? a. 0.22 mol/dm b. 0.32 mol/dm3 c. 3.2x 102 mol/dm d. 2.2x 10-3 mol/dm 3) Which of the following diagrams represents the acid with the highest pH?...
Question 9 5 pts Consider the following chemical reaction between HSO4 (aq) and H2O(). HSO4 (aq)...
Question 9 5 pts Consider the following chemical reaction between HSO4 (aq) and H2O(). HSO4 (aq) + H2O(1=5042-(aq) + H3O+ (aq) Select ALL statements that are true regarding the reaction above. SO42-(aq) is the conjugate base of HSO4 (aq). HSO4"(aq) is a base in this reaction. H30*(aq) is the conjugate acid of H20(1). 5 pts Question 10 ... in haated from 200 K to 400K, (see the
2. Label conjugate acid-base pairs: HNO2(aq) + H2O → H3O+ + NO2 (aq) 3. What will...
2. Label conjugate acid-base pairs: HNO2(aq) + H2O → H3O+ + NO2 (aq) 3. What will happen to the reaction equilibrium if we increase the pressure in the reaction vessel? H2(g) + 12(e) > 2 HI(g)
23) Consider the following generalized buffer solution equilibrium: BH+(aq) + H2O(1) H3O+(aq) + B(aq) 24) Select...
23) Consider the following generalized buffer solution equilibrium: BH+(aq) + H2O(1) H3O+(aq) + B(aq) 24) Select the ionic compound that is insoluble in water. A) Fe(NO3)3 B) MgS C) KBr D) NaCO3 E) NH_Br Consider the following generalized buffer solution equilibrium: BH+(aq) + H2O(1) H3O+(aq) + B(aq) When a small amount of a strong base such as sodium hydroxide is added to ti solution, which of the four species shown would experience an increase in concentration? (Hint: Use LeChatelier's principle.)...
Concerning the equation, NH3 + H20 <-> NH4+ + OH", (<-> consider as an equilibrium arrow) which of the...
Concerning the equation, NH3 + H20 <-> NH4+ + OH", (<-> consider as an equilibrium arrow) which of the following statements are TRUE? (i) NH3 and OH are weak bases. (ii) NH3 is a Bronsted base and NH4+ is its conjugate acid. (iii) H20 is a Bronsted acid and OH is its conjugate base. (iv) NH4+ is a weaker acid than H20. Oi, ii, iii Oi, i Oii, iv O ii, iii o all statements are true
1. For each reaction below Classify each acid, base, conjugate acid, and conjugate base as a...
1. For each reaction below Classify each acid, base, conjugate acid, and conjugate base as a strong acid, weak acid, strong base, or a weak base. Calculate the value of the equilibrium constant II. I. Determine if these reactions need to be treated as an equilibrium (needing an ICE table) or a stoichiometry problem (assuming the reaction goes essentially to completion) a. F-(aq) H2O() HF(aq) + H3O*(aq) + H2O(1) NH3(aq) + b. NH4 (aq) OH (aq) + H3O*(aq) NH3(aq) +...
Q(7) The reaction system POBr3(g) - POBr(g) + Brz(g) is at equilibrium. Which of the following statements describes...
Q(7) The reaction system POBr3(g) - POBr(g) + Brz(g) is at equilibrium. Which of the following statements describes the behavior of the system if POBr is added to the container? A) The reverse reaction will proceed to establish equilibrium. B) The partial pressures of POBra and POBr will remain steady while the partial pressure of bromine increases. C) The partial pressure of chlorine will increase while the partial pressure of POB decreases. D) The partial pressure of chlorine remains steady...
HI(aq) + H2O(1) HIO (aq) + I- (aq) Match the words in the left column to...
HI(aq) + H2O(1) HIO (aq) + I- (aq) Match the words in the left column to the appropriate blanks in the sentences on the right. Reset Help The Bronsted-Lowry acid is 1- (aq) HO () HI(aq) H2O(1) The Bronsted-Lowry base is The conjugate acid is The conjugato base is Submit Request Answer Part B CH,NH,(aq) + H2O(l) CH,NH,'(aq) +OH(aq) Match the words in the left column to the appropriate blanks in the sentences on the right Exercise 14.32 - Enhanced...
please show all work neatly
5. (2 pts) Consider the following acids and their dissociation constants HPO4-2(aq) + H2O.. H3O"(aq) + PO4-3(aq) Ka-2.2x 10.13 HCOOH(aq) H20 H3O (a) HCOO (aq) Ka = 1.8x10-4 a. Which is the weaker acid, HPO42 or HCOOH? b. What is the conjugate base of, HPO42 or c. Which acid has the weaker conjugate base? d. Which acid produces more ions? 6. (2 pts) Write a balanced equation for the neutralization of H3PO4(aq) and NaOH(aq) (3...
1.
2.
If I have the reaction HF (aq) + H20 (1) = H3O+ (aq) + F (aq), the expression K = (Select] / [Select] (Select] [H20] * [F-] [HF] * [F-] [H3O+]*[F] [HE] [HF] * [H20] [Select] [HE] [HF] * [H20] [H20] [F-) [H3O+] * [HF]
1) For the following reaction, which of the following is a conjugate acid-base pair? HC20(aq)+ H20) H:0 (aq) C0,(aq) a. HC20 and H20 b. H20 and C202 c. HC20 and H30 d. HCzOr and C20 2) The pH of a solution of hydrochloric acid is 1.5. What is the concentration of the acid? a. 0.22 mol/dm b. 0.32 mol/dm3 c. 3.2x 102 mol/dm d. 2.2x 10-3 mol/dm 3) Which of the following diagrams represents the acid with the highest pH?...
Question 9 5 pts Consider the following chemical reaction between HSO4 (aq) and H2O(). HSO4 (aq) + H2O(1=5042-(aq) + H3O+ (aq) Select ALL statements that are true regarding the reaction above. SO42-(aq) is the conjugate base of HSO4 (aq). HSO4"(aq) is a base in this reaction. H30*(aq) is the conjugate acid of H20(1). 5 pts Question 10 ... in haated from 200 K to 400K, (see the
2. Label conjugate acid-base pairs: HNO2(aq) + H2O → H3O+ + NO2 (aq) 3. What will happen to the reaction equilibrium if we increase the pressure in the reaction vessel? H2(g) + 12(e) > 2 HI(g)
23) Consider the following generalized buffer solution equilibrium: BH+(aq) + H2O(1) H3O+(aq) + B(aq) 24) Select the ionic compound that is insoluble in water. A) Fe(NO3)3 B) MgS C) KBr D) NaCO3 E) NH_Br Consider the following generalized buffer solution equilibrium: BH+(aq) + H2O(1) H3O+(aq) + B(aq) When a small amount of a strong base such as sodium hydroxide is added to ti solution, which of the four species shown would experience an increase in concentration? (Hint: Use LeChatelier's principle.)...
Concerning the equation, NH3 + H20 <-> NH4+ + OH", (<-> consider as an equilibrium arrow) which of the following statements are TRUE? (i) NH3 and OH are weak bases. (ii) NH3 is a Bronsted base and NH4+ is its conjugate acid. (iii) H20 is a Bronsted acid and OH is its conjugate base. (iv) NH4+ is a weaker acid than H20. Oi, ii, iii Oi, i Oii, iv O ii, iii o all statements are true
1. For each reaction below Classify each acid, base, conjugate acid, and conjugate base as a strong acid, weak acid, strong base, or a weak base. Calculate the value of the equilibrium constant II. I. Determine if these reactions need to be treated as an equilibrium (needing an ICE table) or a stoichiometry problem (assuming the reaction goes essentially to completion) a. F-(aq) H2O() HF(aq) + H3O*(aq) + H2O(1) NH3(aq) + b. NH4 (aq) OH (aq) + H3O*(aq) NH3(aq) +...
Q(7) The reaction system POBr3(g) - POBr(g) + Brz(g) is at equilibrium. Which of the following statements describes the behavior of the system if POBr is added to the container? A) The reverse reaction will proceed to establish equilibrium. B) The partial pressures of POBra and POBr will remain steady while the partial pressure of bromine increases. C) The partial pressure of chlorine will increase while the partial pressure of POB decreases. D) The partial pressure of chlorine remains steady...
HI(aq) + H2O(1) HIO (aq) + I- (aq) Match the words in the left column to the appropriate blanks in the sentences on the right. Reset Help The Bronsted-Lowry acid is 1- (aq) HO () HI(aq) H2O(1) The Bronsted-Lowry base is The conjugate acid is The conjugato base is Submit Request Answer Part B CH,NH,(aq) + H2O(l) CH,NH,'(aq) +OH(aq) Match the words in the left column to the appropriate blanks in the sentences on the right Exercise 14.32 - Enhanced...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 48 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago