Andrew has a box which contains 4 pink blocks, 5 yellow blocks and 6 green blocks....
Andrew has a box which contains 4 pink blocks, 5 yellow blocks and 6 green blocks. He picks one block, records its color and puts it back in the box. He then draws another block. What is the probability of taking out a yellow block followed by the pink block?
Homework Answers
Solution:-
=> P(Yellow) = 5/(4+5+6) = 5/16
=> P(Pink) = 4/16 = 1/4
=> Probability = (5/16)*(1/4) = 5/64 = 0.0781
Add Answer to:
Andrew has a box which contains 4 pink blocks, 5
yellow blocks and 6 green blocks....
If there are 20 single-colored balls, 6 red, 5 green and 9 yellow. Pick the balls...
If there are 20 single-colored balls, 6 red, 5 green and 9 yellow. Pick the balls one by one and record the color without replacing them back. 1) find the conditional probability that the 7th ball will be yellow, given that we have 2 reds, 2 greens and 2 yellows in the first six draws. 2) calculate the probability that the 10th draw is yellow
Q7 purple, 6 are yellow, 2 are orange, and 6 A box of candy contains 53...
Q7 purple, 6 are yellow, 2 are orange, and 6 A box of candy contains 53 pleces, of which 19 are white, 10 are tan, 7 are pink, 3 are are green. If you select 16 pleces of candy randomly from the box, without replacement, find the probability that 4 of the pleces are white. (Round your answer to 4 significant figures) e Tries 0/5 Send Feedback
A bag contains four red marbles, four green ones, one fluorescent pink one, two yellow ones,...
A bag contains four red marbles, four green ones, one fluorescent pink one, two yellow ones, and two orange ones. Suzan grabs five at random. Find the probability of the indicated event. She gets all the red ones, given that she gets the fluorescent pink one. (answer is NOT 0.00202, nor 6/295)
Michael has a box of colored balls. It contains two red balls, two green balls, two...
Michael has a box of colored balls. It contains two red balls, two green balls, two yellow balls, and five blue balls. Michael draws a ball at random from the box Let R denote the event that the ball he draws is red, and let B denote the event that the ball he draws is blue. What is Pr(R|B)? What is Pr(R|B′)? Enter your answers as whole numbers or fractions in lowest terms. A bag contains four 1-dollar bills, three...
An urn contains 5 red balls, 4 green balls, and 2 yellow balls. Draw 3 balls...
An urn contains 5 red balls, 4 green balls, and 2 yellow balls. Draw 3 balls with replacement (draw a ball, record the color, and put ball back before drwing again). What is the probability that your draw (a) consists of all red balls? (b) consists of all the same color? (c) consists of all different colors? (d) consists of at least one green ball? (e) consists of exactly two green balls and one red ball?
A box contains 6 red balls, 4 yellow balls, and 10 white balls. The experiment consists...
A box contains 6 red balls, 4 yellow balls, and 10 white balls. The experiment consists of taking three balls from the box, without replacement, and seeing how many of each color you took. What is the probability that exactly 1 balls will be white? Calculate your answer rounded to three decimal places.
Suppose that a person plays a game in which he draws a ball from a box of 6 balls numbered 1 through 6. He then puts he...
Suppose that a person plays a game in which he draws a ball from a box of 6 balls numbered 1 through 6. He then puts he ball back and continues to draw a ball (with replacement) until he draws another number which is equal or higher than the first draw. Let X and Y denote the number drawn in the first and last try. respectively. a) Find the probability distribution of X (The first draw) b) Find the probability...
I know that one of the pencil leads turned yellow/green and one was the purple pink...
I know that one of the pencil leads turned yellow/green and
one was the purple pink color but I'm not sure which goes where...
please help
Data table for observations bromothymol blue Initial indicator color of electrolysis solution Changes occurring at the positive electrode Changes occurring at the negative electrode Final indicator color of the mixed electrolysis solution Write the balanced chemical equation for the decomposition of water to its elements. Suggest an explanation for the initial indicator color of...
1. an urn contains 6 marbles of which 2 are blue, 2 are yellow and 2...
1. an urn contains 6 marbles of which 2 are blue, 2 are yellow and 2 are red. Sarah, Sally, and Sandra take their turn drawing two marbles each, one at a time, and without replacement. a. if sarah is the first to draw two marbles, what is the probability she draws two blue marbles? b. if sarah is the last to draw two marbles, what is the probability she draws two blue marbles. c. if sandra is the last...
5. One bag contains twenty candies with the following amounts of each color: 5-red, 6-blue, 3-green,...
5. One bag contains twenty candies with the following amounts of each color: 5-red, 6-blue, 3-green, 2-yellow, and 4-orange. One candy is drawn at random. a. What is the probability of drawing a blue candy? b. What is the probability of drawing a red candy or a green candy? c. You draw one candy and then a second candy without putting back the first. What is the probability of drawing a green candy on the second draw given that you...
Q7 purple, 6 are yellow, 2 are orange, and 6 A box of candy contains 53 pleces, of which 19 are white, 10 are tan, 7 are pink, 3 are are green. If you select 16 pleces of candy randomly from the box, without replacement, find the probability that 4 of the pleces are white. (Round your answer to 4 significant figures) e Tries 0/5 Send Feedback
I know that one of the pencil leads turned yellow/green and
one was the purple pink color but I'm not sure which goes where...
please help
Data table for observations bromothymol blue Initial indicator color of electrolysis solution Changes occurring at the positive electrode Changes occurring at the negative electrode Final indicator color of the mixed electrolysis solution Write the balanced chemical equation for the decomposition of water to its elements. Suggest an explanation for the initial indicator color of...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago