An ionic compound forms when calcium (Z = 20) reacts with iodine (Z = 53). If...
An ionic compound forms when calcium (Z = 20) reacts with iodine (Z = 53). If a sample of the compound contains 9.49 × 1023 calcium ions, how many iodide ions does it contain? (Enter your answer in scientific notation.)
Homework Answers
The reaction between calcium and iodine reacts, the product is
calcium iodide i.e. CaI2. Now the number of calcium ions
are given here, so the moles of calcium ions present in the sample
, (since 1 mol of calcium ion means 
calcium ions) = 1.5756. Thus moles of iodide ions present in the
sample will be = 1.5756*2 = 3.15125 moles, since per sample has
calcium to iodide ions ratio = 1:2.
Thus, number of iodide ions 
.
Add Answer to:
An ionic compound forms when calcium (Z = 20) reacts with iodine
(Z = 53). If...
7. What is the formula of the ionic compound that forms when calcium hydroxide reacts with...
7. What is the formula of the ionic compound that forms when calcium hydroxide reacts with nitrous acid?
when potassium reacts with bromine it forms the ionic compound KBr. How many valence electrons does...
when potassium reacts with bromine it forms the ionic compound KBr. How many valence electrons does K have?
If a sample of this compound contains 5.1×1023 magnesium ions, how many nitride ions does it...
If a sample of this compound contains 5.1×1023 magnesium ions, how many nitride ions does it contain? Express your answer using two significant figures.
6. Calcium oxide reacts with nitric acid to produce calcium nitrate and water. How many grams...
6. Calcium oxide reacts with nitric acid to produce calcium nitrate and water. How many grams of calcium oxide are required for complete reaction with 30.0 mL of 0.587 M nitric acid? The molar mass of calcium oxide is 56.077 g/mol. (Hint: start by writing the balanced equation for the reaction.) 7. A sample contains an unknown amount of succinic acid, H2CHO. If 0.3540 g of the sample requires 42.70 mL of 0.1000 M NaOH to neutralize the H2C,H404 completely,...
QUESTION 40 You are experimentally determining the enthalpy of solution for an ionic compound using a...
QUESTION 40 You are experimentally determining the enthalpy of solution for an ionic compound using a coffee cup calorimeter. When you dissolve 32.14 g of the ionic compound (molar mass - 138 g/mol) in 409 g water in a coffee cup calorimeter, the temperature changes from 21.74°C to 15.89 °C. Calculate the enthalpy of solution (the enthalpy change when dissolving the ionic compound in water) in /mol. Use 4,184 18°C) for the specific heat capacity of the solution. Give your...
6. The molecular formula of the ionic compound calcium nitrate is Ca(NO3)2 a. Based on the...
6. The molecular formula of the ionic compound calcium nitrate is Ca(NO3)2 a. Based on the formula given for calcium nitrate, what is the charge (sign and size) on the polyatomic nitrate ion NO3? In other words, what is "x" in the formula NO3? How do you know? b. Calculate the molar mass of calcium nitrate to 2 decimal places. Show how you arrived at your answer. Determine the number of moles in a 65-ng sample of calcium nitrate. c.
How many total moles of ions are released when the following sample dissolves completely in water?...
How many total moles of ions are released when the following sample dissolves completely in water? Enter your answer in scientific notation. 1.93 × 1020 formula units of Sr(HCO3)2
How many total moles of ions are released when the following sample dissolves completely in water?...
How many total moles of ions are released when the following sample dissolves completely in water? Enter your answer in scientific notation. 7.21 × 10−1 g of NiBr2 · 3H2O = _____× 10^_ mol
Be sure to answer all parts. How many total moles of ions are released when the...
Be sure to answer all parts. How many total moles of ions are released when the following sample dissolves completely in wate Enter your answer in scientific notation. 1.00 x 104g of NiBr2 3H0x 10 mol
Be sure to answer all parts. A compound of copper and sulfur contains 86.61 g of...
Be sure to answer all parts. A compound of copper and sulfur contains 86.61 g of metal and 43.24 g of nonmetal. How many grams of copper are in 5406 kg of the compound? How many grams of sulfur? *10 gCu * 10 gs Enter your answer in scientific notation.
7. What is the formula of the ionic compound that forms when calcium hydroxide reacts with nitrous acid?
6. Calcium oxide reacts with nitric acid to produce calcium nitrate and water. How many grams of calcium oxide are required for complete reaction with 30.0 mL of 0.587 M nitric acid? The molar mass of calcium oxide is 56.077 g/mol. (Hint: start by writing the balanced equation for the reaction.) 7. A sample contains an unknown amount of succinic acid, H2CHO. If 0.3540 g of the sample requires 42.70 mL of 0.1000 M NaOH to neutralize the H2C,H404 completely,...
QUESTION 40 You are experimentally determining the enthalpy of solution for an ionic compound using a coffee cup calorimeter. When you dissolve 32.14 g of the ionic compound (molar mass - 138 g/mol) in 409 g water in a coffee cup calorimeter, the temperature changes from 21.74°C to 15.89 °C. Calculate the enthalpy of solution (the enthalpy change when dissolving the ionic compound in water) in /mol. Use 4,184 18°C) for the specific heat capacity of the solution. Give your...
6. The molecular formula of the ionic compound calcium nitrate is Ca(NO3)2 a. Based on the formula given for calcium nitrate, what is the charge (sign and size) on the polyatomic nitrate ion NO3? In other words, what is "x" in the formula NO3? How do you know? b. Calculate the molar mass of calcium nitrate to 2 decimal places. Show how you arrived at your answer. Determine the number of moles in a 65-ng sample of calcium nitrate. c.
Be sure to answer all parts. How many total moles of ions are released when the following sample dissolves completely in wate Enter your answer in scientific notation. 1.00 x 104g of NiBr2 3H0x 10 mol
Be sure to answer all parts. A compound of copper and sulfur contains 86.61 g of metal and 43.24 g of nonmetal. How many grams of copper are in 5406 kg of the compound? How many grams of sulfur? *10 gCu * 10 gs Enter your answer in scientific notation.
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 56 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago