Consider the elementary reaction equation K(g)+HCl(g)⟶KCl(g)+H(g) What is the order with respect to K? order: What...
Consider the elementary reaction equation K(g)+HCl(g)⟶KCl(g)+H(g) What is the order with respect to K?
order:
What is the overall order of the reaction?
overall order:
Classify the reaction as unimolecular, bimolecular, or termolecular.
termolecular unimolecular bimolecular
Homework Answers
Add Answer to:
Consider the elementary reaction equation
K(g)+HCl(g)⟶KCl(g)+H(g) What is the order with respect to K?
order:
What...
Consider the following mechanism for the reaction of hydrogen and iodine monochloride: Step1.H2(g)+ICl(g)?HI(g)+HCl(g)Step2.HI(g)+ICl(g)?I2(g)+HCl(g) Part A Write...
Consider the following mechanism for the reaction of hydrogen and iodine monochloride: Step1.H2(g)+ICl(g)?HI(g)+HCl(g)Step2.HI(g)+ICl(g)?I2(g)+HCl(g) Part A Write the equation for the overall reaction. Write the equation for the overall reaction. H2(g)+2ICl(g)?I2(g)+2HCl(g) H2(g)+ICl(g)?I2(g)+HCl(g) H2(g)+2ICl(g)?I2(g)+HCl(g) H2(g)+ICl(g)?I2(g)+2HCl(g) SubmitMy AnswersGive Up Part B Identify any reaction intermediates. Identify any reaction intermediates. HCl HI ICl H2 SubmitMy AnswersGive Up Part C What is the molecularity of the first elementary step? What is the molecularity of the first elementary step? unimolecular bimolecular termolecular SubmitMy AnswersGive Up Part...
What is the molecularity of the elementary reaction? NO(g) + Cl2(g) --> NOCl(g) + Cl(g) A....
What is the molecularity of the elementary reaction? NO(g) + Cl2(g) --> NOCl(g) + Cl(g) A. unimolecular B. bimolecular C. termolecular D. No reaction will take place.
reaction. The elementary reaction representing the formation of ozone: O2(g)+O(g) + Mig)--03()+M*() is an example of...
reaction. The elementary reaction representing the formation of ozone: O2(g)+O(g) + Mig)--03()+M*() is an example of a bimolecular termolecular unimolecular tetramolecular
reaction. The elementary reaction representing the formation of ozone: 026)+O(g) + M()O3(e)+M" () is an example...
reaction. The elementary reaction representing the formation of ozone: 026)+O(g) + M()O3(e)+M" () is an example of a bimolecular termolecular unimolecular tetramolecular
reaction. The elementary reaction representing the formation of ozone: 026)+O(g) + M()O3(e)+M" () is an example...
reaction. The elementary reaction representing the formation of ozone: 026)+O(g) + M()O3(e)+M" () is an example of a bimolecular termolecular unimolecular tetramolecular
Question 51 What is the molecularity of the following elementary reaction? NHCl(aq) + OH(aq) - NC12...
Question 51 What is the molecularity of the following elementary reaction? NHCl(aq) + OH(aq) - NC12 (aq) +H2O(l) O Bimolecular Termolecular O Unimolecular Tetramolecular The reaction order is needed before the molecularity can be determined.
A three-step mechanism has been suggested for the formation of carbonyl chloride: Step 1: Cl2 ===> 2 Cl (fast equlibrium) Step 2: Cl + CO ===> COCl (fast equilibrium) Step 3: COCl + Cl2 ===> COCl2 + Cl (slow) What is the molecularit
1. A three-step mechanism has been suggested for the formation of carbonyl chloride: Step 1: Cl2 ===> 2 Cl (fast equlibrium) Step 2: Cl + CO ===> COCl (fast equilibrium) Step 3: COCl + Cl2 ===> COCl2 + Cl (slow) What is the molecularity of the rate-determining step? unimolecular bimolecular termolelcular none of these 2. The elementary reaction representing the formation of ozone, O2(g) + O(g) + M(g) ===> O3(g) + M*(g) is an example of a _________ reaction. unimolecular...
Question 7 1 pts The following two-step mechanism has been proposed for the gas phase decomposition...
Question 7 1 pts The following two-step mechanism has been proposed for the gas phase decomposition of nitrous oxide: N20 (g) → N2 (g) + O (g) step 1 N20 (g) + O (g) - N2(g) + O2(g) step 2 Overall Reaction: 2 N20 (g) → 2N2 (g) + O2 (g) What is the molecularity of the first and second elementary steps of the mechanism? The first step is termolecular, and the second step is bimolecular, Both steps are bimolecular,...
To understand how elementary steps make up a mechanism and how the rate law for an...
To understand how elementary steps make up a mechanism and how the rate law for an elementary step can be determined. Very often, a reaction does not tell us the whole story. For instance, the reaction NO2(g)+CO(g)→NO(g)+CO2(g)NO2(g)+CO(g)→NO(g)+CO2(g) does not involve a collision between an NO2NO2 molecule and a COCO molecule. Based on experimental data at moderate temperatures, this reaction is thought to occur in the following two steps: NO2(g)+NO2(g)→NO3(g)+NO(g)NO2(g)+NO2(g)→NO3(g)+NO(g) NO3(g)+CO(g)→CO2(g)+NO2(g)NO3(g)+CO(g)→CO2(g)+NO2(g) Each individual step is called an elementary step. Together, these...
Consider the mechanism proposed for the decomposition of ozone in the stratosphere: Step 1: &n
Consider the mechanism proposed for the decomposition of ozone in the stratosphere: Step 1: O3 (g) → O2 (g) + O (g) Step 2: O3 (g) + O (g) → 2 O2 (g) Overall reaction: 2 O3 (g) → 3 O2 (g) What is molecularity of the first step? Unimolecular Bimolecular Termolecular Unable to predict
reaction. The elementary reaction representing the formation of ozone: O2(g)+O(g) + Mig)--03()+M*() is an example of a bimolecular termolecular unimolecular tetramolecular
reaction. The elementary reaction representing the formation of ozone: 026)+O(g) + M()O3(e)+M" () is an example of a bimolecular termolecular unimolecular tetramolecular
reaction. The elementary reaction representing the formation of ozone: 026)+O(g) + M()O3(e)+M" () is an example of a bimolecular termolecular unimolecular tetramolecular
Question 51 What is the molecularity of the following elementary reaction? NHCl(aq) + OH(aq) - NC12 (aq) +H2O(l) O Bimolecular Termolecular O Unimolecular Tetramolecular The reaction order is needed before the molecularity can be determined.
Question 7 1 pts The following two-step mechanism has been proposed for the gas phase decomposition of nitrous oxide: N20 (g) → N2 (g) + O (g) step 1 N20 (g) + O (g) - N2(g) + O2(g) step 2 Overall Reaction: 2 N20 (g) → 2N2 (g) + O2 (g) What is the molecularity of the first and second elementary steps of the mechanism? The first step is termolecular, and the second step is bimolecular, Both steps are bimolecular,...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 55 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago