Three parts for each of the balanced equations in a) and b): Part 1. Indicate whether...
Three parts for each of the balanced equations in a) and b):
Part 1. Indicate whether the reaction is a precipitation reaction, an acid-base reaction, or an oxidation-reduction reaction.
Part 2. If the reaction is a precipitation reaction, identify the precipitate. If the reaction is an acid-base reaction, identify the acid and the base. If the reaction is an oxidation-reduction reaction, indicate which reactant is oxidized and which reactant is reduced.
Part 3. Write the total ionic equation for each reaction.
a) 2 HCl (aq) + Zn (s) ---> H2 (g) + ZnCl2 (aq)
b) H3PO4 (aq) + 3 NaOH (aq) ---> Na3PO4 (aq) + 3 H2O (l)
Homework Answers
Add Answer to:
Three parts for each of the balanced equations in a) and b):
Part 1. Indicate whether...
4. (1 point) Write balanced equations for the complete combustion of each of the following substances....
4. (1 point) Write balanced equations for the complete combustion of each of the following substances. a. C3H28 (1) + b. C2H,2011 (s) + 5. (2 points) Identify each of the following unbalanced reactions as belonging to one or more of the following categories: precipitation, acid-base, or oxidation-reduction. Type Reaction K2SO4 + Ba(NO3)2 → BaSO4 + KNO3 HCI + Zn → ZnCl2 + H2 HCl + AgNO3 → AgCl + HNO3 HC1+KOH →KCI+H2O Zn + CuSO4 → ZnSO4 + Cu...
For each combination of reagents, write a balanced molecular equation. Indicate whether a reaction occurred in...
For each combination of reagents, write a balanced molecular equation. Indicate whether a reaction occurred in each case. If no reaction occurred, indicate "NR" for 'no reaction.' For reactions that did occur, write the net ionic equation for each. Classify each reaction that occurred as acid/base, redox, or a precipitation reaction. CuSO4 and NaNO3 aq (NR) CuSO4 and NaCl aq (NR) Na3PO4 and Pb(OAc)2 aq (rxn) Na2CO3 and CaCl2 aq (rxn) Na2CO3 and HCl aq (NR) HCl and NaOH (aq)...
HNO3 (aq) + Cu (s) + H2(g) + CuNO3 (aq) •Identify what type of reaction it...
HNO3 (aq) + Cu (s) + H2(g) + CuNO3 (aq) •Identify what type of reaction it is: precipitation, redox or acid-base. •Balance the above equation. •Write the balanced net ionic equation. d. Indicate the element that has been oxidized and the one that has been reduced. You should also identify the oxidation number (ox #) of each before and after the process. Identify the reducing agent and the oxidizing agent. Element Oxidized: Ox # Reactant: Ox # Product: Element Reduced:...
2. For the reactions that were to be completed in Part A of the experiment, prepare a table with ...
Part A:
Part B:
Need help ASAP!!
2. For the reactions that were to be completed in Part A of the experiment, prepare a table with the formulas from Group A as headings of the columns and the formulas of Group B as headings of the ows. Within the table, fill in the formula and systematic name of the predicted precipitates that will form. If no precipitate is expected from the reaction, write 'No Reaction'. For each predicted precipitate, look...
Apps Gamma Healthcare CompliantActivity do Hocator assignment taketakeAssignmentSessionlocator assignment take 7- REACTIONS IN AQUEOUS SOLUTION Previous...
Apps Gamma Healthcare CompliantActivity do Hocator assignment taketakeAssignmentSessionlocator assignment take 7- REACTIONS IN AQUEOUS SOLUTION Previous Page 11 of 14 Next reduction Identity each of the following unbalanced reaction equations as belonging to one or more of the following categories precipitation, acid-base. Orokidan (Select all that apply) a. AICI: (aq) + H3PO,(aq) + AIPO(-) + HCl(aq) precipitation acid-base oxidation-reduction + HCl(aq) + Zn(s) Hy()+ ZnCl2(aq) precipitation e acid-base oxidation-reduction c. HCl(aq) + RbOH(aq) H2O() + RbCl(aq) precipitation acid-base oxidation-reduction De...
please write legible. answer all questions. 1. Identify each of the following reactions as a precipitation...
please write legible. answer all questions.
1. Identify each of the following reactions as a precipitation reaction, an acid-base reaction or as a redox reaction Pb(NO), (aq) + 2 HCl(aq) - PbCl(s) + 2 HNO(aq) b. 2 H2 + Oxel - 2 H2O CHNO, (aq) + KOH(aq) - KNO, (aq) + H2O (1) d. Zn + 2HCl - ZnCl + H e. Ba"(aq) + 2 Br(aq) + 2 Na' (aq) +SO. (aq) BaSO. (s) + 2 Na'(aq) + 2 Br"...
for each reaction- classify as oxidation-reduction,acid-base or precipitation Classify each of the following reactions as oxidation-reduction,...
for each reaction- classify as oxidation-reduction,acid-base
or precipitation
Classify each of the following reactions as oxidation-reduction, acid-base, or Note that in order to be a redox reaction, the oxidation number of an element must be different when it is a reactant than when it is a product. (1 point each) precipitation. Classification Reaction Number 24 Ca (s) +2 H2O ()- Ca(OH)2 (s) + H2 (g) 25 CdCl2 (aq)+ Na2S (aq)CdS (s) +2 NaCl (aq) Zn(OH)2 (s) + H2SO4 (aq)ZnSO4 (aq)...
RODOX EXAMINATION An oxidation-reduction reaction involves the (1) sharing of electrons &n
RODOX EXAMINATION An oxidation-reduction reaction involves the (1) sharing of electrons (3) transfer of electrons (2) sharing of protons (4) transfer of protons In this reaction, CO→ 2 CO + O2 the oxidation number of carbon changes from: (1) 0 to +4 (3) +3 to 0 (2) +2 to +4 (4) +4 to +2 Which balanced equation represents a redox reaction? AgNO3 (aq) +NaCl (aq) →AgCl (s) +NaNO3 (aq) H2CO3 (aq)...
please write legible 1. Identify each of the following reactions as a precipitation reaction, an acid-base...
please write legible
1. Identify each of the following reactions as a precipitation reaction, an acid-base reaction, or as a redox reaction + a. Pb(NO3)2 (aq) + 2 HCl(aq) PbCl (s) + 2 HNO, (aq) b. 2 Hxe + O2 + 2 H2O c. HNO, (aq) + KOH(aq) KNO, (aq) + H20 (1) d. Zna + 2HCl(a) - ZnClaraq) + Halle e. Ba?'(aq) + 2 Br(aq) + 2 Na(aq) + SO/"(aq) BaSO. (s) + 2 Na'(aq) + 2 Br" (aq)...
4) Consider the following balanced conventional equation. (21 pts) Zn(s) + H2SO, (aq) → Znso. (aq)...
4) Consider the following balanced conventional equation. (21 pts) Zn(s) + H2SO, (aq) → Znso. (aq) + H2 (9) Individual oxidation numbers: a. Assign oxidation numbers to each element as indicated by the boxes in H SO, Zn in ZnSOS in Znso. O in ZnSO, and H in H2) (6 pts) b. Write the total ionic equation for the reaction above. (9 pts) ndicated by the boxes above. (i.e. Zn in Zn(s), H c. Write the net ionic equation for...
4. (1 point) Write balanced equations for the complete combustion of each of the following substances. a. C3H28 (1) + b. C2H,2011 (s) + 5. (2 points) Identify each of the following unbalanced reactions as belonging to one or more of the following categories: precipitation, acid-base, or oxidation-reduction. Type Reaction K2SO4 + Ba(NO3)2 → BaSO4 + KNO3 HCI + Zn → ZnCl2 + H2 HCl + AgNO3 → AgCl + HNO3 HC1+KOH →KCI+H2O Zn + CuSO4 → ZnSO4 + Cu...
HNO3 (aq) + Cu (s) + H2(g) + CuNO3 (aq) •Identify what type of reaction it is: precipitation, redox or acid-base. •Balance the above equation. •Write the balanced net ionic equation. d. Indicate the element that has been oxidized and the one that has been reduced. You should also identify the oxidation number (ox #) of each before and after the process. Identify the reducing agent and the oxidizing agent. Element Oxidized: Ox # Reactant: Ox # Product: Element Reduced:...
Part A:
Part B:
Need help ASAP!!
2. For the reactions that were to be completed in Part A of the experiment, prepare a table with the formulas from Group A as headings of the columns and the formulas of Group B as headings of the ows. Within the table, fill in the formula and systematic name of the predicted precipitates that will form. If no precipitate is expected from the reaction, write 'No Reaction'. For each predicted precipitate, look...
Apps Gamma Healthcare CompliantActivity do Hocator assignment taketakeAssignmentSessionlocator assignment take 7- REACTIONS IN AQUEOUS SOLUTION Previous Page 11 of 14 Next reduction Identity each of the following unbalanced reaction equations as belonging to one or more of the following categories precipitation, acid-base. Orokidan (Select all that apply) a. AICI: (aq) + H3PO,(aq) + AIPO(-) + HCl(aq) precipitation acid-base oxidation-reduction + HCl(aq) + Zn(s) Hy()+ ZnCl2(aq) precipitation e acid-base oxidation-reduction c. HCl(aq) + RbOH(aq) H2O() + RbCl(aq) precipitation acid-base oxidation-reduction De...
please write legible. answer all questions.
1. Identify each of the following reactions as a precipitation reaction, an acid-base reaction or as a redox reaction Pb(NO), (aq) + 2 HCl(aq) - PbCl(s) + 2 HNO(aq) b. 2 H2 + Oxel - 2 H2O CHNO, (aq) + KOH(aq) - KNO, (aq) + H2O (1) d. Zn + 2HCl - ZnCl + H e. Ba"(aq) + 2 Br(aq) + 2 Na' (aq) +SO. (aq) BaSO. (s) + 2 Na'(aq) + 2 Br"...
for each reaction- classify as oxidation-reduction,acid-base
or precipitation
Classify each of the following reactions as oxidation-reduction, acid-base, or Note that in order to be a redox reaction, the oxidation number of an element must be different when it is a reactant than when it is a product. (1 point each) precipitation. Classification Reaction Number 24 Ca (s) +2 H2O ()- Ca(OH)2 (s) + H2 (g) 25 CdCl2 (aq)+ Na2S (aq)CdS (s) +2 NaCl (aq) Zn(OH)2 (s) + H2SO4 (aq)ZnSO4 (aq)...
please write legible
1. Identify each of the following reactions as a precipitation reaction, an acid-base reaction, or as a redox reaction + a. Pb(NO3)2 (aq) + 2 HCl(aq) PbCl (s) + 2 HNO, (aq) b. 2 Hxe + O2 + 2 H2O c. HNO, (aq) + KOH(aq) KNO, (aq) + H20 (1) d. Zna + 2HCl(a) - ZnClaraq) + Halle e. Ba?'(aq) + 2 Br(aq) + 2 Na(aq) + SO/"(aq) BaSO. (s) + 2 Na'(aq) + 2 Br" (aq)...
4) Consider the following balanced conventional equation. (21 pts) Zn(s) + H2SO, (aq) → Znso. (aq) + H2 (9) Individual oxidation numbers: a. Assign oxidation numbers to each element as indicated by the boxes in H SO, Zn in ZnSOS in Znso. O in ZnSO, and H in H2) (6 pts) b. Write the total ionic equation for the reaction above. (9 pts) ndicated by the boxes above. (i.e. Zn in Zn(s), H c. Write the net ionic equation for...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 15 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago