the equilibrium constant for the dissociation of iodine molecules to iodine atoms I2 (g) arrow 2I(g)...
Homework Answers
Add Answer to:
the
equilibrium constant for the dissociation of iodine molecules to
iodine atoms
I2 (g) arrow 2I(g)...
The dissociation of molecular iodine into iodine atoms is represented as I2(g) ⇌ 2I(g) At 1000...
The dissociation of molecular iodine into iodine atoms is represented as I2(g) ⇌ 2I(g) At 1000 K, the equilibrium constant Kc for the reaction is 3.80 × 10−5. Suppose you start with 0.0458 mol of I2 in a 2.32−L flask at 1000 K. What are the concentrations of the gases at equilibrium? What is the equilibrium concentration of I2? __M What is the equilibrium concentration of I? __M
21.Be sure to answer all parts. The dissociation of molecular iodine into iodine atoms is represented...
21.Be sure to answer all parts. The dissociation of molecular iodine into iodine atoms is represented as I2(g) ⇌ 2I(g) At 1000 K, the equilibrium constant Kc for the reaction is 3.80 ×10−5. Suppose you start with 0.0461 mol of I2 in a 2.27−L flask at 1000 K. What are the concentrations of the gases at equilibrium? What is the equilibrium concentration of I2? What is the equilibrium concentration of I?
9. The equilibrium constant(K.) for the gaseous dissociation of Iodine molecules to lodine atoms (shown below) 12(8...
9. The equilibrium constant(K.) for the gaseous dissociation of Iodine molecules to lodine atoms (shown below) 12(8) 21(8) is 3.76 x 10-3 at 1000K. If 0.15 mole of 12(g) is placed in a 12.3-L flask at 1000 K, what are the concentrations of 12(g) and I(g) when the reaction comes to equilibrium?
Carbonyl bromide decomposes to carbon monoxide and bromine. COBr2(g) = CO(g) + Br2(g) Kc is 0.190 at 73 °C. If you plac...
Carbonyl bromide decomposes to carbon monoxide and bromine. COBr2(g) = CO(g) + Br2(g) Kc is 0.190 at 73 °C. If you place 0.514 mol of COBr2 in a 1.00-L flask and heat it to 73 °C, what are the equilibrium concentrations of COBr2, CO, and Br? [COBr2] = mol/L [CO] = mol/L [Bry] = mol/L The equilibrium constant for the dissociation of iodine molecules to iodine atoms 12(g) = 2 (g) is 3.76 x 10-3 at 1000 K. Suppose 0.338...
1)Consider the following equilibrium at 972 K for the dissociation of molecular iodine into atoms of...
1)Consider the following equilibrium at 972 K for the dissociation of molecular iodine into atoms of iodine. I2(g) ----> 2 I(g); Kc = 1.40 ? 10?3 Suppose this reaction is initiated in a 3.4 L container with 0.067 mol I2 at 972 K. Calculate the concentrations of I2 and I at equilibrium. * I got I2= 0.0135M and I= 0.0124 is this right?* 2)Consider the following equilibrium. NH3(aq) + H2O(l) -----> NH4+(aq) + OH ?(aq) What will happen to the...
Please help me with this question and help me understand that. Be sure to answer all...
Please help me with this question and help me understand
that.
Be sure to answer all parts. The dissociation of molecular iodine into iodine atoms is represented as I2(g) - 21g) At 1000 K, the equilibrium constant Kc for the reaction is 3.80 × 10-5. Suppose you start with 0.0458 mol of I2 in a 2.33-L flask at 1000 K. What are the concentrations of the gases at equilibrium? What is the equilibrium concentration of I2? What is the equilibrium...
Diatomic iodine [I2] decomposes at high temperature to form I atoms according to the reaction: I2(g)⇌2I(g),...
Diatomic iodine [I2] decomposes at high temperature to form I atoms according to the reaction: I2(g)⇌2I(g), Kc=0.011 at 1200∘C In an equilibrium mixture, the concentration of I2 is 0.10 M. What is the equilibrium concentration of I?
3 attempts left Check my work Be sure to answer all parts. The dissociation of molecular...
3 attempts left Check my work Be sure to answer all parts. The dissociation of molecular iodine into iodine atoms is represented as 126) = 2(g) At 1000 K, the equilibrium constant K for the reaction is 3.80 x 10 . Suppose you start with 0.0451 mol of I, in a 2.33-L flask at 1000 K. What are the concentrations of the gases at equilibrium? What is the equilibrium concentration of IZ? M What is the equilibrium concentration of I?...
Diatomic iodine (I2) decomposes at high temperature to form I atoms according to the reaction: I2(g)⇌2I(g),Kc=0.011...
Diatomic iodine (I2) decomposes at high temperature to form I atoms according to the reaction: I2(g)⇌2I(g),Kc=0.011 at 1200∘C In an equilibrium mixture, the concentration of I2 is 0.25 M. What is the equilibrium concentration of I?
The equilibrium constant K for the reaction H2(g) + I2(g) 2HI(g) is 51 at 300oC. A...
The equilibrium constant K for the reaction H2(g) + I2(g) 2HI(g) is 51 at 300oC. A 2 L flask was filled with 1 mol H2 and 1 mol I2 at 300oC and the reaction was allowed to come to equilibrium. (i) Calculate the equilibrium concentrations of all three species. If this reaction was performed with the same quantities but at a higher pressure what would be the effect on the position of equilibrium? (ii) If an equilibrium reaction as drawn...
9. The equilibrium constant(K.) for the gaseous dissociation of Iodine molecules to lodine atoms (shown below) 12(8) 21(8) is 3.76 x 10-3 at 1000K. If 0.15 mole of 12(g) is placed in a 12.3-L flask at 1000 K, what are the concentrations of 12(g) and I(g) when the reaction comes to equilibrium?
Carbonyl bromide decomposes to carbon monoxide and bromine. COBr2(g) = CO(g) + Br2(g) Kc is 0.190 at 73 °C. If you place 0.514 mol of COBr2 in a 1.00-L flask and heat it to 73 °C, what are the equilibrium concentrations of COBr2, CO, and Br? [COBr2] = mol/L [CO] = mol/L [Bry] = mol/L The equilibrium constant for the dissociation of iodine molecules to iodine atoms 12(g) = 2 (g) is 3.76 x 10-3 at 1000 K. Suppose 0.338...
Please help me with this question and help me understand
that.
Be sure to answer all parts. The dissociation of molecular iodine into iodine atoms is represented as I2(g) - 21g) At 1000 K, the equilibrium constant Kc for the reaction is 3.80 × 10-5. Suppose you start with 0.0458 mol of I2 in a 2.33-L flask at 1000 K. What are the concentrations of the gases at equilibrium? What is the equilibrium concentration of I2? What is the equilibrium...
3 attempts left Check my work Be sure to answer all parts. The dissociation of molecular iodine into iodine atoms is represented as 126) = 2(g) At 1000 K, the equilibrium constant K for the reaction is 3.80 x 10 . Suppose you start with 0.0451 mol of I, in a 2.33-L flask at 1000 K. What are the concentrations of the gases at equilibrium? What is the equilibrium concentration of IZ? M What is the equilibrium concentration of I?...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 10 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 11 hours ago