Two particles each have a rest mass energy of 30 MeV and are traveling with a...
Two particles each have a rest mass energy of 30 MeV and are traveling with a total of 10 MeV of kinetic energy. When they collide, they fuse into a new particle with a rest mass energy of 50 MeV. How much kinetic energy does the final particle possess?
Homework Answers
Initial rest mass energy of two particles = 2*30 Mev = 60 Mev
Final rest mass energy of new particle = 50 Mev
Initial kinetic energy of two particles = 10 Mev
Let final kinetic energy of new particle = k Mev
Total energy before collision = total energy after collision.
60 + 10 = 50 +k
k = 20 Mev
Add Answer to:
Two particles each have a rest mass energy of 30 MeV and are
traveling with a...
-31 1 Electrons have a rest mass of 9.1095x103"kg(0.511 MeV/c2) and an energy of 0.511 MeV million electron volts)...
-31 1 Electrons have a rest mass of 9.1095x103"kg(0.511 MeV/c2) and an energy of 0.511 MeV million electron volts) when at rest. In a colliding beam experiment, a beam of electrons accelerated to a high speed is sent toward a beam of antielectrons (same mass as electrons) moving in the opposite direction at the same speed. a.) Experimenters hope to create the J/y particle that has a rest mass energy of 3097 MeV through one of these collisions. The J/y...
3. (10 pts) High energy particle accelerators convert part of the energy of colliding particles into...
3. (10 pts) High energy particle accelerators convert part of the energy of colliding particles into the masses of particles produced in the collisions. Consider a collision of two protons that produces two charged kaons. The mass of the proton is mp- 938.3 MeV/c2, and the mass of each kaon is mK 493.7 MeV/c2. The reaction is a) The total energy (kinetic energy and rest energy) and total momentum is conserved. Suppose one of the protons is at rest in...
Two protons (rest mass M = 1.67 * 10^-27 kg) move at same speed in opposite...
Two protons (rest mass M = 1.67 * 10^-27 kg) move at same speed in opposite directions. After bumping into each other the protons remain, but as a consequence of the bump a new particle is created, which has a rest mass m = 1.75 * 10^-28 kg. a) Calculate the protons' speed at the beginning by assuming that all particles are in rest after the bump. Give your answer in the unit light speed c. b) Calculate the proton's...
Particles A through D have the following rest energies and total energies: Particle Rest Energy Total...
Particles A through D have the following rest energies and total energies: Particle Rest Energy Total Energy A 6E 6E B 2E 4E C 4E 6E D 3E 4E A. Rank these particles in order of decreasing rest mass. B.Rank these particles in order of decreasing kinetic energy. C. Rank these particles in order of decreasing speed.
Each ? particle in a beam of ? particles has a kinetic energy of 5.0 MeV....
Each ? particle in a beam of ? particles has a kinetic energy of 5.0 MeV. Through what potential difference would you have to accelerate these a particles in order that they would have enough energy so that if one is fired head-on at a gold nucleus it could reach a point 1.0x10^-14 m from the center of the nucleus?
Two particles of mass m and 2m head directly at each-other, collide, and become a new...
Two particles of mass m and 2m head directly at each-other, collide, and become a new particle. The heavier particle is moving at .8c. Is it possible for the new particle to be at rest at it's creation? If not, why? If so, what is the mass of the final particle in terms of m? (c = speed of light) In both cases, derive equations and show how you would figure out your chosen answer.
Each α particle in a beam of α particles has a kinetic energy of 7.1 MeV....
Each α particle in a beam of α particles has a kinetic energy of 7.1 MeV. Through what potential difference would you have to accelerate these α particles in order that they would have enough energy so that if one is fired head-on at a gold nucleus it could reach a point 1.5 10-14 m from the center of the nucleus?
Each a particle in a beam of a particles has a kinetic energy of 3.8 Mev. Throug so that if one i...
Each a particle in a beam of a particles has a kinetic energy of 3.8 Mev. Throug so that if one is fired head-o h what potential di fference would you have to accelerate these a particles in order that they would have enough energy on at a gold nucleus it cou uld reach a point 1.5 x 1014 m from the center of the nucleus?
Each a particle in a beam of a particles has a kinetic energy of...
A particle of rest energy 140 MeV moves at a sufficiently high speed that its total...
A particle of rest energy 140 MeV moves at a sufficiently high speed that its total relativistic energy is 301 MeV. How fast is it traveling? (Enter your answer as a multiple of c. (All answers posted so far have been wrong)
If the alpha particles have an initial kinetic energy of 7.7 MeV, then assuming a head-collision...
If the alpha particles have an initial kinetic energy of 7.7 MeV, then assuming a head-collision between an alpha particle (helium nucleus with +2e charge) and a gold nucleus (79 protons, so +79e charge), and using conservation of energy at the point of closest approach when all of the alpha particle's kinetic energy is converted to electric potential energy, calculate the approximate distance of closest approach (and thus coarsely estimate the size of the nucleus)
-31 1 Electrons have a rest mass of 9.1095x103"kg(0.511 MeV/c2) and an energy of 0.511 MeV million electron volts) when at rest. In a colliding beam experiment, a beam of electrons accelerated to a high speed is sent toward a beam of antielectrons (same mass as electrons) moving in the opposite direction at the same speed. a.) Experimenters hope to create the J/y particle that has a rest mass energy of 3097 MeV through one of these collisions. The J/y...
3. (10 pts) High energy particle accelerators convert part of the energy of colliding particles into the masses of particles produced in the collisions. Consider a collision of two protons that produces two charged kaons. The mass of the proton is mp- 938.3 MeV/c2, and the mass of each kaon is mK 493.7 MeV/c2. The reaction is a) The total energy (kinetic energy and rest energy) and total momentum is conserved. Suppose one of the protons is at rest in...
Each a particle in a beam of a particles has a kinetic energy of 3.8 Mev. Throug so that if one is fired head-o h what potential di fference would you have to accelerate these a particles in order that they would have enough energy on at a gold nucleus it cou uld reach a point 1.5 x 1014 m from the center of the nucleus?
Each a particle in a beam of a particles has a kinetic energy of...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago