Milk of magnesia is only slightly soluble in water. Kc for the reaction Mg(OHs)(s)>Mg2+(a) + 2OH-1(aq)...
Milk of magnesia is only slightly soluble in water. Kc for the reaction Mg(OHs)(s)>Mg2+(a) + 2OH-1(aq) is 5.6x10^-12. How many moles of Mg2+ and how many moles of OH-1 will exist at equilibrium in 5L saturated solution of Mg(OH)2? Does the answer make sense?
Please help!
Homework Answers
The answer doesn't make any
sense actually as the number of moles of Mg2+ and OH- at equlibrium
is very very small compared to 1 which is the initial number of
moles of milk of magnesia.
Add Answer to:
Milk of magnesia is only slightly soluble in water. Kc for the
reaction Mg(OHs)(s)>Mg2+(a) + 2OH-1(aq)...
Milk of magnesia is a brand name for a commercial antacid. The active ingredient is Mg(OH)2....
Milk of magnesia is a brand name for a commercial antacid. The active ingredient is Mg(OH)2. In water, a small amount of Mg(OH)2 dissolves producing a cloudy solution. The equilibrium reaction is Mg(OH)2(S, white) = Mg²+ (aq) + 2OH(aq) A. What observations would you see, if a small amount of concentrated HCl was added to an equilibrium mixture of Mg(OH)2 in water? B. Write the net ionic equation for the reaction that occurs in part A. C. Explain your observations...
Integrated Problems #13 Milk of magnesia (Mg(OH)2)is often taken to reduce the discomfort associated with acid...
Integrated Problems #13 Milk of magnesia (Mg(OH)2)is often taken to reduce the discomfort associated with acid stomach or heartburn. The recommended dose is 1 teaspoon (5 mL) which contains 4.00 X 10-mg of Mg(OH)2. 1) Magnesium hydroxide is a slightly soluble salt. Write a balanced equilibrium reaction for this process. 2) The Ksp for Magnesium hydroxide is 2.06 X 10-13, what is the pH of the recommended dose of milk of magnesia? 3) If we assume that stomach acid is...
(aq) (1) Mg(OH)2 is partially dissolved in water: Mg(OH), (s) = Mg2+ (aq) + 2OH Write...
(aq) (1) Mg(OH)2 is partially dissolved in water: Mg(OH), (s) = Mg2+ (aq) + 2OH Write the Kop expression for Mg(OH)2 : Kp = (2) Solid AgCl is partially dissolved in water: AgCl 2 Ag+ + CI''. If the molar solubility is known as [Ag +) = [CI''] = 1.3x 10 M, AgCl Kip =- (a) 1.3 x 10 (b) 1.69 x 10-10 (c) 2.6 x 10 (d) none of these (3) At 25 °C, the solubility of solid AgCl...
Consider the following reaction: Mg2+(aq) + Cu(s) Cu2+(aq) + Mg(s). In this reaction, Mg2+(aq) is: Attempts...
Consider the following reaction: Mg2+(aq) + Cu(s) Cu2+(aq) + Mg(s). In this reaction, Mg2+(aq) is: Attempts remaining: 2 How many milliliters of 0.020 M Ca(OH)2 are required to neutralize 75.0 mL of 0.030 M HCI?! Attempts remaining: 2 What volume of solution would be created when 35.00 g of NaOH make a 2.0 M solutions? Attempts remaining: 2
The following chemical reaction occurs in a basic solution. Mg2+(aq) + MnO2(aq) + OH−(aq) → Mg(s)...
The following chemical reaction occurs in a basic solution. Mg2+(aq) + MnO2(aq) + OH−(aq) → Mg(s) + MnO4−(aq) + H2O(l) How many moles of electrons are transferred when the equation is balancedusing the smallest whole-number coefficients?
Consider the reaction: Mg(OH)2 (s) = Mg(aq) + 2 OH- (aq) At equilibrium, a 1.0 L...
Consider the reaction: Mg(OH)2 (s) = Mg(aq) + 2 OH- (aq) At equilibrium, a 1.0 L reaction vessel contains 5.3 moles of Mg(OH)2 and concentrations of 0.0080 M and 0.010 M of Mg and OH respectively. What is Kc for this equilibrium? Consider the reaction: N2 (g) + 3 Br(g) = 2 NBr) (g) At equilibrium, the concentrations of Nz and Bra are 0.34 M and 0.70 M respectively, and the concentration of NBrs is 0.090 M. What is Kc...
1. The ionic compound magnesium hydroxide, which is found in the over-the-counter consumer product Milk of...
1. The ionic compound magnesium hydroxide, which is found in the over-the-counter consumer product Milk of Magnesia has the formula Mg(OH) Magnesium hydroxide dissolves in water according to the following equation: Mg(OH)2(s) 与 Mg2+(aq) + 2011 (aq) Write the solubility product expression for magnesium hydroxide. 2. The K value for magnesium hydroxide is 5.61 × 10-12 at 25 °C. In a saturated solution of magnesium, hydroxide, the magnesium ion concentration was found to be 1.1 × 10 4. Calculate the...
1. How is the molar solubility of a slightly soluble salt affected by the addition of an ion common to the salt equili...
1. How is the molar solubility of a slightly soluble salt affected by the addition of an ion common to the salt equilibrium? 2. A 3.11 mL volume of a standardized 0.0025 M HCl solution titrated 25.0 mL of a saturated Mg(OH)2 solution to the methyl orange endpoint. Calculate the Ksp of Mg(OH)2. 3. If the endpoint in the titration of a saturated Ca(OH)2 solution with a standardized HCI solution is surpassed, will the reported Kap of Ca(OH)2 be reported...
Consider the reaction Mg(s)+Fe2+(aq)→Mg2+(aq)+Fe(s) at 85 ∘C , where [Fe2+]= 3.60 M and [Mg2+]= 0.210 M...
Consider the reaction Mg(s)+Fe2+(aq)→Mg2+(aq)+Fe(s) at 85 ∘C , where [Fe2+]= 3.60 M and [Mg2+]= 0.210 M 1) What is the value for the reaction quotient, Q, for the cell? Express your answer numerically. 2) What is the value for the temperature, T, in kelvins? Express your answer to three significant figures and include the appropriate units. 3) What is the value for n? Express your answer as an integer and include the appropriate units (i.e. enter mol for moles). 4)...
You have the following reaction: Mg(s) + 2 HCl(aq) + Mg2+(aq) + H2(g) + 2Cl(aq). Answer...
You have the following reaction: Mg(s) + 2 HCl(aq) + Mg2+(aq) + H2(g) + 2Cl(aq). Answer the following questions with the data given. The hydrogen gas is collected above the aqueous acid solution in an inverted graduated cylinder. Moles of Mg metal: Temperature of gas Atmospheric pressure: 0.0033mol 28.0°C 1.02 atm. 3. What is the pressure of the hydrogen gas in the graduated cylinder?
Milk of magnesia is a brand name for a commercial antacid. The active ingredient is Mg(OH)2. In water, a small amount of Mg(OH)2 dissolves producing a cloudy solution. The equilibrium reaction is Mg(OH)2(S, white) = Mg²+ (aq) + 2OH(aq) A. What observations would you see, if a small amount of concentrated HCl was added to an equilibrium mixture of Mg(OH)2 in water? B. Write the net ionic equation for the reaction that occurs in part A. C. Explain your observations...
Integrated Problems #13 Milk of magnesia (Mg(OH)2)is often taken to reduce the discomfort associated with acid stomach or heartburn. The recommended dose is 1 teaspoon (5 mL) which contains 4.00 X 10-mg of Mg(OH)2. 1) Magnesium hydroxide is a slightly soluble salt. Write a balanced equilibrium reaction for this process. 2) The Ksp for Magnesium hydroxide is 2.06 X 10-13, what is the pH of the recommended dose of milk of magnesia? 3) If we assume that stomach acid is...
(aq) (1) Mg(OH)2 is partially dissolved in water: Mg(OH), (s) = Mg2+ (aq) + 2OH Write the Kop expression for Mg(OH)2 : Kp = (2) Solid AgCl is partially dissolved in water: AgCl 2 Ag+ + CI''. If the molar solubility is known as [Ag +) = [CI''] = 1.3x 10 M, AgCl Kip =- (a) 1.3 x 10 (b) 1.69 x 10-10 (c) 2.6 x 10 (d) none of these (3) At 25 °C, the solubility of solid AgCl...
Consider the following reaction: Mg2+(aq) + Cu(s) Cu2+(aq) + Mg(s). In this reaction, Mg2+(aq) is: Attempts remaining: 2 How many milliliters of 0.020 M Ca(OH)2 are required to neutralize 75.0 mL of 0.030 M HCI?! Attempts remaining: 2 What volume of solution would be created when 35.00 g of NaOH make a 2.0 M solutions? Attempts remaining: 2
Consider the reaction: Mg(OH)2 (s) = Mg(aq) + 2 OH- (aq) At equilibrium, a 1.0 L reaction vessel contains 5.3 moles of Mg(OH)2 and concentrations of 0.0080 M and 0.010 M of Mg and OH respectively. What is Kc for this equilibrium? Consider the reaction: N2 (g) + 3 Br(g) = 2 NBr) (g) At equilibrium, the concentrations of Nz and Bra are 0.34 M and 0.70 M respectively, and the concentration of NBrs is 0.090 M. What is Kc...
1. The ionic compound magnesium hydroxide, which is found in the over-the-counter consumer product Milk of Magnesia has the formula Mg(OH) Magnesium hydroxide dissolves in water according to the following equation: Mg(OH)2(s) 与 Mg2+(aq) + 2011 (aq) Write the solubility product expression for magnesium hydroxide. 2. The K value for magnesium hydroxide is 5.61 × 10-12 at 25 °C. In a saturated solution of magnesium, hydroxide, the magnesium ion concentration was found to be 1.1 × 10 4. Calculate the...
1. How is the molar solubility of a slightly soluble salt affected by the addition of an ion common to the salt equilibrium? 2. A 3.11 mL volume of a standardized 0.0025 M HCl solution titrated 25.0 mL of a saturated Mg(OH)2 solution to the methyl orange endpoint. Calculate the Ksp of Mg(OH)2. 3. If the endpoint in the titration of a saturated Ca(OH)2 solution with a standardized HCI solution is surpassed, will the reported Kap of Ca(OH)2 be reported...
You have the following reaction: Mg(s) + 2 HCl(aq) + Mg2+(aq) + H2(g) + 2Cl(aq). Answer the following questions with the data given. The hydrogen gas is collected above the aqueous acid solution in an inverted graduated cylinder. Moles of Mg metal: Temperature of gas Atmospheric pressure: 0.0033mol 28.0°C 1.02 atm. 3. What is the pressure of the hydrogen gas in the graduated cylinder?
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 52 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago