Homework Answers
a)P(waiting at least 5 seconds)=(10/15)*100=66.7%
b)P(waiting no more than 10 seconds)=(10/15)*100=66.7%
c)average expected waiting time=(0+15)/2 =7.5 sec
Add Answer to:
A traffic light on campus remains red for 15 seconds at a time. A car arrives at that light and f...
The graph of the waiting time (in seconds) at a red light is shown below on...
The graph of the waiting time (in seconds) at a red light is shown below on the left with its mean and standard deviation. Assume that a sample size of 100 is drawn from the population Decide which of the graphs labeled (a)-(c) would most closely resemble the sampling distribution of the sample means. Explain your reasoning Ap 004 00 e'doteo 11.4 g11.4 o11.4 1.14 Q 78 -17 8 0- 04 50 re s0 50 Tme on sec) Time (n...
A car is traveling at 20.0 m/s, and the driver sees a traffic light turn red....
A car is traveling at 20.0 m/s, and the driver sees a traffic light turn red. After 0.6 s (the reaction time), the driver applies the brakes, and the car accelerates at -6.1 m/s What is the stopping distance of the car, as measured from the point where the driver first sees the red light? ning: 1 of 1.00 uestion Answer Choose.. Check
"Time headway" in traffic flow is the elapsed time between the time that one car finishes...
"Time headway" in traffic flow is the elapsed time between the time that one car finishes passing a fixed point and the instant that the next car begins to pass that point. Let X = the time headway for two randomly chosen consecutive cars on a freeway during a period of heavy flow (sec). Suppose that in a particular traffic environment, the distribution of time headway has the following form. k. X > 1 f(x) = 6 10 X51 (a)...
You are driving your car, and the traffic light ahead turns red. You apply the brakes...
You are driving your car, and the traffic light ahead turns red. You apply the brakes for 2.45 s, and the velocity of the car decreases to + 4.71 m/s. The car’s deceleration has a magnitude of 3.54 m/s2 during this time. What is the car’s displacement?
You are driving your car, and the traffic light ahead turns red. You apply the brakes...
You are driving your car, and the traffic light ahead turns red. You apply the brakes for 2.75 s, and the velocity of the car decreases to + 5.03 m/s. The car’s deceleration has a magnitude of 3.11 m/s2 during this time. What is the car’s displacement
A car is stopped at a traffic light. It then travels along a straight road so...
A car is stopped at a traffic light. It then travels along a straight road so that its distance from the light is given by x(t)=bt2−ct3, where 2.30 m/s2 and c = 0.120 m/s3. Part A Calculate the average velocity of the car for the time interval t=0 to t=10.0 s. Part B Calculate the instantaneous velocity of the car at t=0. Part C Calculate the instantaneous velocity of the car at t= 5.00 s. Express your answer in meters...
A person driving her car at 49.0 km/hr approaches an intersection just as the traffic light...
A person driving her car at 49.0 km/hr approaches an intersection just as the traffic light turns yellow. She knows that the yellow light lasts only 1.80 s before turning to red, and she is a distance D = 35.0 m away from the near side of the intersection. If she decides to stop, how far from the intersection will she come to a stop? The intersection is W =11.0 m wide. Her car's maximum deceleration is -5.70 m/s2. Ignore...
need help "Time headway" in traffic flow is the elapsed time between the time that one...
need help
"Time headway" in traffic flow is the elapsed time between the time that one car finishes passing a fixed point and the instant that the next car begins to pass that point. Let X- the time headway for two randomly chosen consecutive cars on a freeway during a period of heavy flow. The pdf of X is the following R 0.17 0.17 0.5) x 0.5 3 0 otherwise (a) What is the probability that time headway is at...
please help out, I'll rate Automobile traffic passes a point P on a road of width...
please help out, I'll rate
Automobile traffic passes a point P on a road of width w feet (ft) at an average rate of R vehicles per second. Although the arrival of automobiles is irregular, traffic until there is a gap in traffic of at leastt seconds is approximately T te engineers have found that the average waiting time a speed of 3.5 ft/s requires t = w/3.5 s to cross the road. Therefore, the average time the pedestrian will...
The probability density function of the time a customer arrives at a terminal (in minutes after...
The probability density function of the time a customer arrives at a terminal (in minutes after 8:00 A.M.) is rx) = 0.5 e-x/2 for x > 0, Determine the probability that (a) The customer arrives by 11:00 A.M. (Round your answer to one decimal place (e.g. 98.7) (b) The customer arrives between 8:16 A.M. and 8:31 A.M. (Round your answer to four decimal places (e.g. 98.7654)) (c) Determine the time (in hours A.M. as decimal) at which the probability of...
The graph of the waiting time (in seconds) at a red light is shown below on the left with its mean and standard deviation. Assume that a sample size of 100 is drawn from the population Decide which of the graphs labeled (a)-(c) would most closely resemble the sampling distribution of the sample means. Explain your reasoning Ap 004 00 e'doteo 11.4 g11.4 o11.4 1.14 Q 78 -17 8 0- 04 50 re s0 50 Tme on sec) Time (n...
A car is traveling at 20.0 m/s, and the driver sees a traffic light turn red. After 0.6 s (the reaction time), the driver applies the brakes, and the car accelerates at -6.1 m/s What is the stopping distance of the car, as measured from the point where the driver first sees the red light? ning: 1 of 1.00 uestion Answer Choose.. Check
"Time headway" in traffic flow is the elapsed time between the time that one car finishes passing a fixed point and the instant that the next car begins to pass that point. Let X = the time headway for two randomly chosen consecutive cars on a freeway during a period of heavy flow (sec). Suppose that in a particular traffic environment, the distribution of time headway has the following form. k. X > 1 f(x) = 6 10 X51 (a)...
need help
"Time headway" in traffic flow is the elapsed time between the time that one car finishes passing a fixed point and the instant that the next car begins to pass that point. Let X- the time headway for two randomly chosen consecutive cars on a freeway during a period of heavy flow. The pdf of X is the following R 0.17 0.17 0.5) x 0.5 3 0 otherwise (a) What is the probability that time headway is at...
please help out, I'll rate
Automobile traffic passes a point P on a road of width w feet (ft) at an average rate of R vehicles per second. Although the arrival of automobiles is irregular, traffic until there is a gap in traffic of at leastt seconds is approximately T te engineers have found that the average waiting time a speed of 3.5 ft/s requires t = w/3.5 s to cross the road. Therefore, the average time the pedestrian will...
The probability density function of the time a customer arrives at a terminal (in minutes after 8:00 A.M.) is rx) = 0.5 e-x/2 for x > 0, Determine the probability that (a) The customer arrives by 11:00 A.M. (Round your answer to one decimal place (e.g. 98.7) (b) The customer arrives between 8:16 A.M. and 8:31 A.M. (Round your answer to four decimal places (e.g. 98.7654)) (c) Determine the time (in hours A.M. as decimal) at which the probability of...
Most questions answered within 3 hours.
-
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 8 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 8 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 22 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago