When synthesizing the target compound 1,1-diethoxy-cyclohexane using the materials Cyclohexane, H...
When synthesizing the target compound 1,1-diethoxy-cyclohexane using the materials Cyclohexane, H2SO4 (sulfuric acid) and EtOH what is the mechanism of the reaction?
Homework Answers
Add Answer to:
When synthesizing the target compound 1,1-diethoxy-cyclohexane using the materials Cyclohexane, H...
Write a mechanism for the reaction between Cyclohexanone, Diethyl ether, and H2SO4 to form 1,1-Diethoxy-cyclohexane.
Write a mechanism for the reaction between Cyclohexanone, Diethyl ether, and H2SO4 to form 1,1-Diethoxy-cyclohexane.
1. An unknown compound was known to be toluene, cyclohexane or cyclohexene. It burned with a...
1. An unknown compound was known to be toluene, cyclohexane or cyclohexene. It burned with a very sooty flame and when bromine in dichloromethane was added to the sample, the brown color remained. What was the unknown? Explain why you made the choice you did. 2.Paul has test results of a sooty flame when burned and a positive reaction to sulfuric acid. He states that his unknown is cyclohexane. What was wrong about his conclusion?
Provide methods for synthesizing the following compounds using only a Grignard reaction, plus any necessary workup....
Provide methods for synthesizing the following compounds using only a Grignard reaction, plus any necessary workup. In each case the Grignard reagent, cyclohexylmagnesium bromide, must be used in the synthesis. Express these syntheses in the form of balanced equations, using structural formulae showing all reagents and any specific conditions required. a) Cyclohexylmethanoic acid b) 1,1-dicyclohexyl-1-ethanol c) cyclohexane
A) Draw /Write down the mechanism of dehydration of cyclohexanol to cyclohexane using sulfuric acid and...
A) Draw /Write down the mechanism of dehydration of cyclohexanol to cyclohexane using sulfuric acid and phosphoric acid.identify the leaving groups and the steps of OH depronated. B) Note the presence of water C/ Can we note the presence of water in a IR spectrum?
CHa H H3C iv) IV Show the polymerization reaction mechanism of molecule iv shown above when using a) Benzoyl peroxi...
CHa H H3C iv) IV Show the polymerization reaction mechanism of molecule iv shown above when using a) Benzoyl peroxide as the catalyst b) Sulfuric acid as the catalyst. 6.
CHa H H3C iv) IV
Show the polymerization reaction mechanism of molecule iv shown above when using a) Benzoyl peroxide as the catalyst b) Sulfuric acid as the catalyst. 6.
Mass of salicylic acid recovered= 11.495g Used 1.410g of salicylic acid when synthesizing aspirin. Mass of...
Mass of salicylic acid recovered= 11.495g Used 1.410g of salicylic acid when synthesizing aspirin. Mass of acetylsalicylic acid(aspirin) recovered= 2.365g Discuss your yields, % yield of salicylic acid and aspirin. The reaction is the synthesis of salicylic acid from oil wintergreen, and then using the salicylic acid to synthesize aspirin. THANK YOU IN ADVANCE
In this lab you are synthesizing acetylsalicylic acid (ASA) from salicylic acid using acetic anhydride, with...
In this lab you are synthesizing acetylsalicylic acid (ASA) from salicylic acid using acetic anhydride, with phosphoric acid as a catalyst. If the amount of salicylic acid at the start of the reaction was 1.05 g, what is the theoretical yield of ASA in g? Assume acetic anhydride is in excess.
4. (22 points) "Fun in acid" question: Draw a reasonable mechanism using the curved-arrow formalism (include...
4. (22 points) "Fun in acid" question: Draw a reasonable mechanism using the curved-arrow formalism (include lone pair electrons) for the following rearrangement reaction of an arene oxide in the presence of dilute aqueous sulfuric acid to give the corresponding phenol. What is the thermodynamic driving force for the conversion of the arene oxide into the phenol? Hint: 4-steps H2SO4 HO in excess: used as solvent) "Fun in acid" question: Draw a reasonable mechanism using the curved-arrow formalism (include lone...
What reaction occurs when sodium hydroxide is added to the stearic acid in cyclohexane and water?...
What reaction occurs when sodium hydroxide is added to the stearic acid in cyclohexane and water? How does this change the solubility of cyclohexane in water? Does HCl reverse this reaction when it is added? If so why? Does sodium chloride have the same type of behavior as stearic acid or is it different? Explain why these two solutes are the same or different. (Please answer in your own words.)
In this lab you are synthesizing acetylsalicylic acid (ASA) from salicylic acid using acetic anhydride, with...
In this lab you are synthesizing acetylsalicylic acid (ASA) from salicylic acid using acetic anhydride, with phosphoric acid as a catalyst. If the amount of salicylic acid at the start of the reaction was 1.05 g, what is the theoretical yield of ASA in g? Assume acetic anhydride is in excess. HINT: The structures of all the compounds you need are in the lab manual.
CHa H H3C iv) IV Show the polymerization reaction mechanism of molecule iv shown above when using a) Benzoyl peroxide as the catalyst b) Sulfuric acid as the catalyst. 6.
CHa H H3C iv) IV
Show the polymerization reaction mechanism of molecule iv shown above when using a) Benzoyl peroxide as the catalyst b) Sulfuric acid as the catalyst. 6.
4. (22 points) "Fun in acid" question: Draw a reasonable mechanism using the curved-arrow formalism (include lone pair electrons) for the following rearrangement reaction of an arene oxide in the presence of dilute aqueous sulfuric acid to give the corresponding phenol. What is the thermodynamic driving force for the conversion of the arene oxide into the phenol? Hint: 4-steps H2SO4 HO in excess: used as solvent) "Fun in acid" question: Draw a reasonable mechanism using the curved-arrow formalism (include lone...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 45 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago