Homework Answers
a) energy in 1st state
= -13.6 / 1^2 * 1.6*10^-19 = 2.176*10^-18 J
E = hf
f = E/h = 6.626*10^-34 / (2.176*10^-18)
= 3*10^-16 Hz
b) if the frequency id doubled
it will move to higher state
Add Answer to:
7. The energy levels of the hydrogen atom in the absence of external magnetic field are given by ...
The diagram below shows the first four energy levels in a hydrogen atom.
The diagram below shows the first four energy levels in a hydrogen atom. Illustrate the allowed transition from the excited state to the ground state with an arrow that releases the shortest wavelength radiation. Explain. Then answer questions a & b.
11. Calculate the energy of the first 3 energy levels in the hydrogen atom in Joules,...
11. Calculate the energy of the first 3 energy levels in the hydrogen atom in Joules, dium kJ/mol. En = -2.18 x 10-18 ) E, (k/mol) 12. Calculate the wavelength of light, (in nm), needed to promote an electron in the ground state of the H atom to the 2 state 13. Calculate the wavelength of light, (in nm), needed to promote an electron in the ground state of the Hatom to the n=3 state
Problem 2. (30 points) (a) (3 points) The Stark effect (shift of energy levels by a constant external electric field) i...
Problem 2. (30 points) (a) (3 points) The Stark effect (shift of energy levels by a constant external electric field) in atom is usually observed to be quadratic in the field strength. Explain why. (b) (3 points) But for some states of the hydrogen atom, the Stark effect is observed to be linear in the field strength. Explain why. (c) Ilustrate by making a perturbation calculation of the Stark effect of an electric field E Ez to lowest non-vanishing order...
4. When a hydrogen atom is bombarded, the atom may be raised into a higher energy state. As the excited electron f...
4. When a hydrogen atom is bombarded, the atom may be raised into a higher energy state. As the excited electron falls back to the lower energy levels, light is emitted. What are the three longest-wavelength spectral lines emitted by the hydrogen atom as it returns to the n = 1 state from higher energy states? Give your answers to three significant figures. The lowest possible state, n = 1, corresponds to the electron in its smallest possible orbit; it...
Sketch the n = 1, and n = 2 energy levels for a hydrogen atom in...
Sketch the n = 1, and n = 2 energy levels for a hydrogen atom in a magnetic field. Indicate three possible transitions with solid lines. Indicate three forbidden (or at least highly suppressed) transitions with dotted lines, and state why they are forbidden. (Ignore fine and hyperfine structure.)
e) Sketch the n = 1, and n = 2 energy levels for a hydrogen atom...
e) Sketch the n = 1, and n = 2 energy levels for a hydrogen atom in a magnetic field. Indicate three possible transitions with solid lines. Indicate three forbidden (or at least highly suppressed) transitions with dotted lines, and state why they are forbidden. (Ignore fine and hyperfine structure.)
An electron in the Hydrogen atom is in the excited state with energy E2. a) According...
An electron in the Hydrogen atom is in the excited state with energy E2. a) According to the Bohr model, what is the radius of the atom in this state, in Angstroms? b) What is the wavelength le of the electron, in Angstroms? c) What is the momentum of the electron, in kg-m/s ? d) This atom decays from the excited state with energy E2 to the ground state with energy E1 . What is the energy of the emitted photon?...
Answers for questions 1-12 please The energy level diagram for a hydrogen atom is shown. The...
Answers for questions 1-12 please
The energy level diagram for a hydrogen atom is shown. The following 000 ev questions are about the energy levels of the hydrogen atom. An0544 ev -1.51 ev 0.850 ev electron jumps from the n 5 level to the n 1 level. 1. Will this result in an emission line, or an absorption line in then-3 n 4 spectrum of this atom? 2. Which excited state did the electron start at? n-2 3.40 ev 2....
Compare the following patters for a hydrogen atom which placed in a magnetic field which is very strong compared to its internal field, its orbital and spin magnetic moments precess independently ab...
Compare the following patters for a hydrogen atom which placed in a magnetic field which is very strong compared to its internal field, its orbital and spin magnetic moments precess independently about the external field, and its energy depends on the quantum numbers mi and m, which specify their components along the external field direction the pattern of split levels originating from the level, enumerating the quantum numbers of each component of the pattern is me = 0, m, =-1/2...
1) photon dropped Eph1 with frequency vph1 on unexcited hydrogen atom on ground state then the...
1) photon dropped Eph1 with frequency vph1 on unexcited hydrogen atom on ground state then the atom ionized anf an electron comes out with kinetic energy Te , if this electron Unite with another ionic hydrogen then a third hydrogen atom in first excited level on comes out because of this unite with -3.4eV , and a new photon comes out with 466 λ. calculate the energy of first photon Eph1 and its frequency vph1 . 2) calculate the velocity...
The diagram below shows the first four energy levels in a hydrogen atom. Illustrate the allowed transition from the excited state to the ground state with an arrow that releases the shortest wavelength radiation. Explain. Then answer questions a & b.
11. Calculate the energy of the first 3 energy levels in the hydrogen atom in Joules, dium kJ/mol. En = -2.18 x 10-18 ) E, (k/mol) 12. Calculate the wavelength of light, (in nm), needed to promote an electron in the ground state of the H atom to the 2 state 13. Calculate the wavelength of light, (in nm), needed to promote an electron in the ground state of the Hatom to the n=3 state
Problem 2. (30 points) (a) (3 points) The Stark effect (shift of energy levels by a constant external electric field) in atom is usually observed to be quadratic in the field strength. Explain why. (b) (3 points) But for some states of the hydrogen atom, the Stark effect is observed to be linear in the field strength. Explain why. (c) Ilustrate by making a perturbation calculation of the Stark effect of an electric field E Ez to lowest non-vanishing order...
4. When a hydrogen atom is bombarded, the atom may be raised into a higher energy state. As the excited electron falls back to the lower energy levels, light is emitted. What are the three longest-wavelength spectral lines emitted by the hydrogen atom as it returns to the n = 1 state from higher energy states? Give your answers to three significant figures. The lowest possible state, n = 1, corresponds to the electron in its smallest possible orbit; it...
Sketch the n = 1, and n = 2 energy levels for a hydrogen atom in a magnetic field. Indicate three possible transitions with solid lines. Indicate three forbidden (or at least highly suppressed) transitions with dotted lines, and state why they are forbidden. (Ignore fine and hyperfine structure.)
e) Sketch the n = 1, and n = 2 energy levels for a hydrogen atom in a magnetic field. Indicate three possible transitions with solid lines. Indicate three forbidden (or at least highly suppressed) transitions with dotted lines, and state why they are forbidden. (Ignore fine and hyperfine structure.)
Answers for questions 1-12 please
The energy level diagram for a hydrogen atom is shown. The following 000 ev questions are about the energy levels of the hydrogen atom. An0544 ev -1.51 ev 0.850 ev electron jumps from the n 5 level to the n 1 level. 1. Will this result in an emission line, or an absorption line in then-3 n 4 spectrum of this atom? 2. Which excited state did the electron start at? n-2 3.40 ev 2....
Compare the following patters for a hydrogen atom which placed in a magnetic field which is very strong compared to its internal field, its orbital and spin magnetic moments precess independently about the external field, and its energy depends on the quantum numbers mi and m, which specify their components along the external field direction the pattern of split levels originating from the level, enumerating the quantum numbers of each component of the pattern is me = 0, m, =-1/2...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 41 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago