Homework Answers
Add Answer to:
(A) Cl 1,Mglir / then HO' (11) NIIS (C) Hi (D) Nalilh 121. Which of the following compound with g...
multiple choise 5 questions answer all please 1.Which of the following compounds is the least reactive...
multiple choise 5 questions answer all please 1.Which of the following compounds is the least reactive in the nucleophilic substitution with NaOH? 2,4-dinitrochlorobenzene m-nitrochlorobenzene o-nitrochlorobenzene 3,5-dinitrochlorobenzene 2.which of the following is the correct ascending order, for boiling points? a. n-butane <1-butane <diethyl ether <2-butanone b. n-butane <2-butanone <diethyl ether <1-butane c. n-butane <diethyl ether <1-butane <2-butanone d. n-butane <diethyl ether <2-butanone <1-butane 3.What is the main product of the reaction between 1-cyclobutyl-1-ethanol and H2SO4 + heat? a. 1-methyl cyclopentene b....
13. What is M for 2-butanone? a) b ) 85 d) 58 O c) 72 Grignard...
13. What is M for 2-butanone? a) b ) 85 d) 58 O c) 72 Grignard reagent added to a aldehyde and H30* 14. What is the product of a Grignard reagent added to a al a) amine b) imine c) alcohol d) ketone 15. A ketal is formed from a a) amine b) imine c) alcohol d) ketone and aldehyde 16. p-Nitrobenzoic acid contains how many NO, groups? a) O b)1 c)2 d) 3 17. The carboxylic acid pentanoic...
d) Chlorine in chloroacetic acid will destabilize its conjugate acid by pulling electrons. 13. What is...
d) Chlorine in chloroacetic acid will destabilize its conjugate acid by pulling electrons. 13. What is M for 2-butanone in the mass spectrum? a) 0 b) 85 c) 72 d) 58 14. What is the product of a Grignard reagent added to a aldehyde and H,O b) imine c) alcohol a) amine d) ketone 15. The product of hydroboration oxidation is ? a) amine b) imine c) alcohol d) ketone 16. p-Nitrobenzoic acid contains how many NO, groups? a) 0...
13) In the compound below, the hydroxyl group not contained in the carboxyl group is in...
13) In the compound below, the hydroxyl group not contained in the carboxyl group is in which position? 13) LD CH3-CH2-CH-C-OH ОН A) 1 B) 2 C) 3 H D)4 DIE E) 5 14) What is the IUPAC name for this compound? DEDI OH in A) 24-dimethylpentanoic acid B) 3-methylhexanoic acid C) heptanoic acid D) pentanoic acid E) 3,4-dimethylpentanoic acid 15) A carboxylic acid is prepared from an aldehyde by A) reduction B) oxidation C) hydrolysis. D) neutralization, E) hydrogenation....
1.The main product of the reaction between p-cresol and Br2 / FeBr3 is: 3-Bromo-4-methyl phenol 2-Bromo-4-methyl...
1.The main product of the reaction between p-cresol and Br2 / FeBr3 is: 3-Bromo-4-methyl phenol 2-Bromo-4-methyl phenol 2-methyl-4-bromine phenol 3-methyl-4-bromine phenol 2.Which of the following compounds is the least reactive in the nucleophilic substitution with NaOH? 2,4-dinitrochlorobenzene m-nitrochlorobenzene o-nitrochlorobenzene 3,5-dinitrochlorobenzene 3.What is the mechanism (s) for the reaction of 4-bromo-1-nitrobenzene with sodium hydroxide to form 4-nitrophenol? bimolecular nucleophilic substitution (Sn2) aromatic nucleophilic substitution by addition-elimination aromatic nucleophilic substitution by elimination-addition aromatic electrophilic substitution 4.which of the following is the correct...
NAME! Select the best answer and bubble it in on your blue scantron. 1. Where would...
NAME! Select the best answer and bubble it in on your blue scantron. 1. Where would be the absorption peak of a carbonyl, C-0, stretching in IR? a) around 3300 cm b) around 2980 cm" c) around 1700 cm d) around 1200 cm 2. What is the Grignard reagent in nucleophilic addition reaction considered? a) b) 0 c) H d) all the above 3. What a cynaohydrin contains? a) CN and NH. b) N, and OH. c) CN and OH....
5) Which of the following compounds is hydrolyzed the slowest in aqueous NaOH? І п ш...
5) Which of the following compounds is hydrolyzed the slowest in aqueous NaOH? І п ш IV у E) II A) III B) I C) IV 6) 6) What is the major product when (CH3)2CHCH2CH2Br undergoes the following reaction sequence: (Step 1) Mg, ether (Step 2) CO2 (Step 3) H30+ A) 4-methyl-1-pentanol B) 2-methyl-2-butanol C) 4-methylpentanoic acid D) 3-methylbutanoic acid 7) Diisobutylaluminum hydride can be used to carry out which of the following conversions? A) aldehyde to carboxylic acid B)...
12. Which compound is the strongest acid? 11. Which compound is the strongest base? (A) benzoic a...
12. Which compound is the strongest acid? 11. Which compound is the strongest base? (A) benzoic acid (B) 4-amino-2-methylbenzoic acid ©p-nitrobenzoic acid (A) m-nitroaniline (B) aniline 4-methylaniline 3-bromo-5-nitroaniline 24-dimethylaniline po 13. Which of the following compounds E)3.S-dinitrobenzoic acid is has the 4.ow many Ha atoms are in the compound: 14 cyclohexane-1,3-dione? (A) 2 (B) 4 (C)5 highest number of alpha hydrogen? (A) 2,4-dimethyl-3-hexanone (B) cyclohexanone C) benzaldehyde D) 2-heptanone (E) propanone IS. Which of the following compounds has the16. Which...
Pre-Lab Study Questions 1. Give the IUPAC name for each of the following: 1. CH-CH2-CH2-C-OH DUHOInoic...
Pre-Lab Study Questions 1. Give the IUPAC name for each of the following: 1. CH-CH2-CH2-C-OH DUHOInoic acid b. CH3 -CH2-C-0-CH-CH, einyl propionic acid C. CH-CH:CH-ch-c-o pentanoic acid 2. Write the condensed structural formula of the organic product for propanoic acid reacting with each of the following: a. NaOH b. CH, --OH c. HO 3. Write the condensed structural formula of the organic products for ethyl ethanoate when it reacts with each of the following: a. NaOH b. H20 and HCI
1. Which of the following is NOT a correct IUPAC name? a. cyclopentanone b. 1-pentanone c....
1. Which of the following is NOT a correct IUPAC name? a. cyclopentanone b. 1-pentanone c. 2-pentanone d. 3-pentanone e. no correct response 2. Which of the following is a water-soluble, organic solvent? a. vanilloids b. hemiacetals c. acetone d. diethyl ester 3. Which of the following compounds would have the lowest boiling point of the group? a. heptanoic acid b. ethanoic acid c. butanoic acid d. decanoic acid e. cannot be determined from the information given
13. What is M for 2-butanone? a) b ) 85 d) 58 O c) 72 Grignard reagent added to a aldehyde and H30* 14. What is the product of a Grignard reagent added to a al a) amine b) imine c) alcohol d) ketone 15. A ketal is formed from a a) amine b) imine c) alcohol d) ketone and aldehyde 16. p-Nitrobenzoic acid contains how many NO, groups? a) O b)1 c)2 d) 3 17. The carboxylic acid pentanoic...
d) Chlorine in chloroacetic acid will destabilize its conjugate acid by pulling electrons. 13. What is M for 2-butanone in the mass spectrum? a) 0 b) 85 c) 72 d) 58 14. What is the product of a Grignard reagent added to a aldehyde and H,O b) imine c) alcohol a) amine d) ketone 15. The product of hydroboration oxidation is ? a) amine b) imine c) alcohol d) ketone 16. p-Nitrobenzoic acid contains how many NO, groups? a) 0...
13) In the compound below, the hydroxyl group not contained in the carboxyl group is in which position? 13) LD CH3-CH2-CH-C-OH ОН A) 1 B) 2 C) 3 H D)4 DIE E) 5 14) What is the IUPAC name for this compound? DEDI OH in A) 24-dimethylpentanoic acid B) 3-methylhexanoic acid C) heptanoic acid D) pentanoic acid E) 3,4-dimethylpentanoic acid 15) A carboxylic acid is prepared from an aldehyde by A) reduction B) oxidation C) hydrolysis. D) neutralization, E) hydrogenation....
NAME! Select the best answer and bubble it in on your blue scantron. 1. Where would be the absorption peak of a carbonyl, C-0, stretching in IR? a) around 3300 cm b) around 2980 cm" c) around 1700 cm d) around 1200 cm 2. What is the Grignard reagent in nucleophilic addition reaction considered? a) b) 0 c) H d) all the above 3. What a cynaohydrin contains? a) CN and NH. b) N, and OH. c) CN and OH....
5) Which of the following compounds is hydrolyzed the slowest in aqueous NaOH? І п ш IV у E) II A) III B) I C) IV 6) 6) What is the major product when (CH3)2CHCH2CH2Br undergoes the following reaction sequence: (Step 1) Mg, ether (Step 2) CO2 (Step 3) H30+ A) 4-methyl-1-pentanol B) 2-methyl-2-butanol C) 4-methylpentanoic acid D) 3-methylbutanoic acid 7) Diisobutylaluminum hydride can be used to carry out which of the following conversions? A) aldehyde to carboxylic acid B)...
12. Which compound is the strongest acid? 11. Which compound is the strongest base? (A) benzoic acid (B) 4-amino-2-methylbenzoic acid ©p-nitrobenzoic acid (A) m-nitroaniline (B) aniline 4-methylaniline 3-bromo-5-nitroaniline 24-dimethylaniline po 13. Which of the following compounds E)3.S-dinitrobenzoic acid is has the 4.ow many Ha atoms are in the compound: 14 cyclohexane-1,3-dione? (A) 2 (B) 4 (C)5 highest number of alpha hydrogen? (A) 2,4-dimethyl-3-hexanone (B) cyclohexanone C) benzaldehyde D) 2-heptanone (E) propanone IS. Which of the following compounds has the16. Which...
Pre-Lab Study Questions 1. Give the IUPAC name for each of the following: 1. CH-CH2-CH2-C-OH DUHOInoic acid b. CH3 -CH2-C-0-CH-CH, einyl propionic acid C. CH-CH:CH-ch-c-o pentanoic acid 2. Write the condensed structural formula of the organic product for propanoic acid reacting with each of the following: a. NaOH b. CH, --OH c. HO 3. Write the condensed structural formula of the organic products for ethyl ethanoate when it reacts with each of the following: a. NaOH b. H20 and HCI
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 21 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago