Under acidic conditions, the iodide ion is oxidized by the iodate ion in the presence of excess chloride to form the compound iodine chloride according to the following unbalanced reaction. IO3−(aq) +...
Under acidic conditions, the iodide ion is oxidized by the iodate ion in the presence of excess chloride to form the compound iodine chloride according to the following unbalanced reaction.
IO3−(aq) + I−(aq) + Cl−(aq)→ICl(aq)
a) Determine the oxidation numbers for each atom.
b) Balance the equation.
Homework Answers
Add Answer to:
Under acidic conditions, the iodide ion is oxidized by the iodate ion in the presence of excess chloride to form the compound iodine chloride according to the following unbalanced reaction. IO3−(aq) +...
Iodine reacts with chlorine to form iodine monochloride according to the following unbalanced reaction: I2 (s)...
Iodine reacts with chlorine to form iodine monochloride according to the following unbalanced reaction: I2 (s) + Cl2 (g) → ICl(g) If we start with 25.4 g of iodine and 37.4 g of chlorine, how many grams of the excess reactant are leftover after the reaction is complete? Answer in 3 significant figures:
4. Consider the following unbalanced net redox equation: HCI + KMnO, (aq) + H,02 (aq) -. MnC12 (a...
PLEASE ANSWER EACH QUESTION OR DO NOT ANSWER AT ALL. THANK
YOU!
4. Consider the following unbalanced net redox equation: HCI + KMnO, (aq) + H,02 (aq) -. MnC12 (aq) + O2 (g) + KCI in an acid solution a. Determine the oxidation state of each atom or ion in the above reaction: b. Which atom is being oxidized? Which atom is being reduced? C. Which species is the reducing agent? Which is the oxidizing agent? d. Write the net...
2. Balance the following reaction under acidic conditions. Cl2(aq) + Br2(1) BrO3-(aq) + Cl-(aq)
2. Balance the following reaction under acidic conditions. Cl2(aq) + Br2(1) BrO3-(aq) + Cl-(aq)
Balance the chemical equation for the following redox reaction under acidic aqueous conditions with the smallest...
Balance the chemical equation for the following redox reaction under acidic aqueous conditions with the smallest whole-number coefficients possible using the half-reaction method. What is the coefficient of Cl? Cl2(g)+S2O3 (aq) Cl(aq)+ SO2(aq)
What is the general class of each test reaction in the introduction? Precipitation? Acid-Base? Oxidation eduction?...
What is the general class of each test reaction in the introduction? Precipitation? Acid-Base? Oxidation eduction? anoina to aizy ona svidstils Reaction Class 1 2 iliw 15 TO15192do art sshommua bns nosgol rond dass 101 12575 gbubnium oY noi de lo enor Som 10 910 w II woy Xd on abian aningstid on naloga uzib 3 OOH 4 5 DHET 6 7 SET adus 00 9 Complex ion formation 10 11 No reaction 12 13 14 Combination 15 16 17...
please help The dehydration of alcohols Under acidic conditions, alcohols will undergo a dehydration reaction, producing...
please help
The dehydration of alcohols Under acidic conditions, alcohols will undergo a dehydration reaction, producing an alkene and water. During the reaction, the hydroxyl group of the alcohol and a hydrogen atom from an adjacent carbon atom are lost. The reaction takes place in three steps, as shown in the diagram. (Figure 1) In the first step, a hydrogen lon bonds to the hydroxyl group of the alcohol. In the second step, the protonated hydroxl group leaves the compound,...
1. Hydrogen gas, H2, reacts with nitrogen gas, N2, to form ammonia gas, NH3, according to...
1. Hydrogen gas, H2, reacts with nitrogen gas, N2, to form ammonia gas, NH3, according to the equation 2 NH3( 3 Нуе) + N, 2(g) 2(g) How many grams of H2 are needed to produce 14.43 g of NH3? 2. When propane (C,H8) burns, it reacts with oxygen gas to produce carbon dioxide and water. The unbalanced equation for this reaction is... С,На (9 + Оzе) CO2(g)H20(g) (g) This type of reaction is referred to as a complete combustion reaction...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of w...
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...
PLEASE ANSWER EACH QUESTION OR DO NOT ANSWER AT ALL. THANK
YOU!
4. Consider the following unbalanced net redox equation: HCI + KMnO, (aq) + H,02 (aq) -. MnC12 (aq) + O2 (g) + KCI in an acid solution a. Determine the oxidation state of each atom or ion in the above reaction: b. Which atom is being oxidized? Which atom is being reduced? C. Which species is the reducing agent? Which is the oxidizing agent? d. Write the net...
2. Balance the following reaction under acidic conditions. Cl2(aq) + Br2(1) BrO3-(aq) + Cl-(aq)
Balance the chemical equation for the following redox reaction under acidic aqueous conditions with the smallest whole-number coefficients possible using the half-reaction method. What is the coefficient of Cl? Cl2(g)+S2O3 (aq) Cl(aq)+ SO2(aq)
What is the general class of each test reaction in the introduction? Precipitation? Acid-Base? Oxidation eduction? anoina to aizy ona svidstils Reaction Class 1 2 iliw 15 TO15192do art sshommua bns nosgol rond dass 101 12575 gbubnium oY noi de lo enor Som 10 910 w II woy Xd on abian aningstid on naloga uzib 3 OOH 4 5 DHET 6 7 SET adus 00 9 Complex ion formation 10 11 No reaction 12 13 14 Combination 15 16 17...
please help
The dehydration of alcohols Under acidic conditions, alcohols will undergo a dehydration reaction, producing an alkene and water. During the reaction, the hydroxyl group of the alcohol and a hydrogen atom from an adjacent carbon atom are lost. The reaction takes place in three steps, as shown in the diagram. (Figure 1) In the first step, a hydrogen lon bonds to the hydroxyl group of the alcohol. In the second step, the protonated hydroxl group leaves the compound,...
1. Hydrogen gas, H2, reacts with nitrogen gas, N2, to form ammonia gas, NH3, according to the equation 2 NH3( 3 Нуе) + N, 2(g) 2(g) How many grams of H2 are needed to produce 14.43 g of NH3? 2. When propane (C,H8) burns, it reacts with oxygen gas to produce carbon dioxide and water. The unbalanced equation for this reaction is... С,На (9 + Оzе) CO2(g)H20(g) (g) This type of reaction is referred to as a complete combustion reaction...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago