What does the law of demand predict will happen to the number of abortions when abortion is made legal? How would you r...
What does the law of demand predict will happen to the number of abortions when abortion is made legal? How would you respond to the comment: “the law of demand doesn’t apply to desperate women seeking an abortion.”?
Homework Answers
Law of demand says that price and quantity demanded have inverse
relationship with each other but I must say abortion have the
inelastic demand which says that quantity consumed in the market
would remain the same at any prices. When abortion was illegal,
consumers were paying higher prices to for it and those who need
it, were getting it. Now after it has been made legal, its prices
would fall while the quantity remains the same. So it can be said
that law of demand do not apply to desperate women because legal or
not, it did not create any difference for them. 
Add Answer to:
What does the law of demand predict will happen to the number of abortions when abortion is made legal? How would you r...
Predict what would happen if you treated cells with Cytocholasin D when the concentration of G-actin...
Predict what would happen if you treated cells with Cytocholasin D when the concentration of G-actin is lower than the critical concentration for either end.
You run a small business and would like to predict what will happen to the quantity...
You run a small business and would like to predict what will happen to the quantity demanded for your product if you raise your price. While you do not know the exact demand curve for your product, you do know that in the first year you charged $45 and sold 1200 units and that in the second year you charged $30 and sold 1800 units. a. If you plan to raise your price by 10%, what would be a reasonable...
What is meant by “respondeat superior” and how and when does it apply in the law...
What is meant by “respondeat superior” and how and when does it apply in the law of agency? Under what circumstances can the principal be held liable for the torts of his or her agent? Give at least two hypothetical fact situations to illustrate when “respondeat superior” will apply.
Exergonic and Endergonic Reactions What would happen if you rapidly shake a bottle of sand? How...
Exergonic and Endergonic Reactions What would happen if you rapidly shake a bottle of sand? How does this demonstrate the first law of thermodynamics? Free energy Energy released to surroundings Reactants (marble at top) Products (marble at bottom of hill)
How does International Law differ from Domestic Laws? What barriers do you think could prevent a...
How does International Law differ from Domestic Laws? What barriers do you think could prevent a universal legal system?
How does fertility affect labor supply? That is, how much does a woman's labor supply fall when she has an additional child? We would like to estimate this effect using data for married women fro...
How does fertility affect labor supply? That is, how much does a woman's labor supply fall when she has an additional child? We would like to estimate this effect using data for married women from the 1980 U.S. Census. The data set contains information on n = 254654 married women aged 21-35 with two or more children. In particular, the variable weeksworked is equal to the number of weeks a mother has worked in 1979; morekids is a dummy variable...
What are the World Health Organization’s (WHO) 10 uses of Healthcare Law? Explain how you would...
What are the World Health Organization’s (WHO) 10 uses of Healthcare Law? Explain how you would apply one of the uses as a health care manager or provider.
1.What does it mean to have a commitment to diversity? How would you develop and apply your commitment to diversity at u...
1.What does it mean to have a commitment to diversity? How would you develop and apply your commitment to diversity at university. 2.The mission of the College of Nursing is to transform health, healthcare, and policy through knowledge generation and translation, and education of future leaders from diverse backgrounds. Our vision is to be a preeminent leader in advancing global health and nursing. Please comment on how you can contribute to this mission and vision as a student and alumni.
1. What effect does consentration have on the reaction rate? 2. what would you predict for...
1. What effect does consentration have on the reaction rate? 2. what would you predict for the rate if 2.5 ml of water were mixed with 2.5 ml of the potassium iodate solution then 2 ml of the sodium meta-bisulfite/starch solution were added? pleas explain how you arrived at your nswear?
1. How does true motility differ from Brownian movement? 2. What could happen if you would...
1. How does true motility differ from Brownian movement? 2. What could happen if you would touch the bottom of the motility agar with your needle during inoculation? 3 Explain why the following steps are essential during subculturing: a) Flaming the loop or needle prior to and after each inoculation. b) Cooling the loop or needle prior to obtaining the microorganism c) Holding the test tube caps in the hand as opposed placing them on the bench top. d) Flaming...
You run a small business and would like to predict what will happen to the quantity demanded for your product if you raise your price. While you do not know the exact demand curve for your product, you do know that in the first year you charged $45 and sold 1200 units and that in the second year you charged $30 and sold 1800 units. a. If you plan to raise your price by 10%, what would be a reasonable...
Exergonic and Endergonic Reactions What would happen if you rapidly shake a bottle of sand? How does this demonstrate the first law of thermodynamics? Free energy Energy released to surroundings Reactants (marble at top) Products (marble at bottom of hill)
How does fertility affect labor supply? That is, how much does a woman's labor supply fall when she has an additional child? We would like to estimate this effect using data for married women from the 1980 U.S. Census. The data set contains information on n = 254654 married women aged 21-35 with two or more children. In particular, the variable weeksworked is equal to the number of weeks a mother has worked in 1979; morekids is a dummy variable...
1. How does true motility differ from Brownian movement? 2. What could happen if you would touch the bottom of the motility agar with your needle during inoculation? 3 Explain why the following steps are essential during subculturing: a) Flaming the loop or needle prior to and after each inoculation. b) Cooling the loop or needle prior to obtaining the microorganism c) Holding the test tube caps in the hand as opposed placing them on the bench top. d) Flaming...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 18 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago