How does the dielectric constant of deuterated DMSO, Chloroform, and Acetone affect the formation of a dimedone (diketon...
How does the dielectric constant of deuterated DMSO, Chloroform, and Acetone affect the formation of a dimedone (diketone) enol? Why?
DMSO: 100% enol
CDCl3: 34% enol, 66% ketone
Acetone: 74% enol, 26% ketone
Homework Answers
Add Answer to:
How does the dielectric constant of deuterated DMSO, Chloroform, and Acetone affect the formation of a dimedone (diketon...
Below is the HNMR spectrum for dimedone in deuterated DMSO. I need to find the equilibrium constant for the enol/ketone equilibrium. Not sure how to do this since I dont see a prominent signal for the...
Below is the HNMR spectrum for dimedone in deuterated DMSO. I
need to find the equilibrium constant for the enol/ketone
equilibrium. Not sure how to do this since I dont see a prominent
signal for the ketone methylene protons? Also the enol should be
more prominent in this solvent because of its polarity, but there
is no significant OH peak. I am really confused, would appreciate
any help. Thanks.
7.69 5.15 2.25 10 12 6 2 2 PPM Nolumes/Lexar/Dimedone/HNMR dimedone...
Below is the HNMR for dimedone in deuterated acetone. I need to calculate the %enol and %ketone content given this data. How can I do this? 9.65 5.99 4.65 57 1.19 1.46 1.00 12 14 10 4 PPM Molumes/Cor...
Below is the HNMR for dimedone in deuterated acetone. I need to
calculate the %enol and %ketone content given this data. How can I
do this?
9.65 5.99 4.65 57 1.19 1.46 1.00 12 14 10 4 PPM Molumes/Cory/HNMR dimedone in acetone04121/17 (09:48)
9.65 5.99 4.65 57 1.19 1.46 1.00 12 14 10 4 PPM Molumes/Cory/HNMR dimedone in acetone04121/17 (09:48)
Synthesis of dimedone This lab exercise will give you practical experience with the generation of...
Synthesis of dimedone This lab exercise will give you practical experience with the generation of a malonic ester enolate and subsequent reaction with an a,p-unsaturated carbonyl compound. This sequence is known as the Michael reaction. In the presence of sodium methoxide, dimethyl propanedioate (malonic ester/dimethyl malonate) is converted to the corresponding enolate anion and reaction with 4-methylpent-3-en-2-one (mesityl oxide) affords the Michael adduct 1, as shown in the reaction sequence below. Under the basic reaction conditions, the Michael adduct 1...
Synthesis of dimedone This lab exercise will give you practical experience with the generation of...
Synthesis of dimedone This lab exercise will give you practical experience with the generation of a malonic ester enolate and subsequent reaction with an a,p-unsaturated carbonyl compound. This sequence is known as the Michael reaction. In the presence of sodium methoxide, dimethyl propanedioate (malonic ester/dimethyl malonate) is converted to the corresponding enolate anion and reaction with 4-methylpent-3-en-2-one (mesityl oxide) affords the Michael adduct 1, as shown in the reaction sequence below. Under the basic reaction conditions, the Michael adduct 1...
1. How does Lexy’s age affect her decision to get an MBA? A...
1. How does Lexy’s age affect her decision to get an
MBA?
A Aceto, Frank BUS 622 Week 3 Case Study Template F19- Excel AutoSave Off Share Review File Home Insert Page Layout Formulas Data View Help Tell me what you want to do AutoSum As 12A A Wrap Text Calibri General Fill Paste в I U Conditional Format as Insert Delete Format Sort & Find & - A 0 00 00 0 | Merge & Center...
Please determine the IDENTITY of the unknown compound and explain how each peak / data point...
Please determine the IDENTITY of the unknown
compound and explain how each peak / data point from the following
instruments led to that identification. What does the gcms
indicate. Thank you very much! (The GCMS data is just a long set of
numbers which is why the question appears so long).
IR of unknown:
NMR unknown Proton Graphs (first is overall graph,
others that follow are zoomed in sections):
NMR unknown Carbon Graphs (first is overall graph,
others that follow...
e. 18 Test Your Knowledge MULTIPLE CHOICE: Choose the one best answer. 1. Each element has...
e. 18 Test Your Knowledge MULTIPLE CHOICE: Choose the one best answer. 1. Each element has its own characteristic atom in which a. the atomic mass is constant. b. the atomic number is constant. c. the mass number is constant. d. Two of the above are correct. e. All of the above are correct. 2. Which of the following is not a trace element in the human body? a. iodine b. zinc c. iron d. calcium e. fluorine 3. A...
1. According to the paper, what does lactate dehydrogenase (LDH) do and what does it allow...
1. According to the paper, what does lactate dehydrogenase
(LDH) do and what does it allow to happen within the myofiber? (5
points)
2. According to the paper, what is the major disadvantage of
relying on glycolysis during high-intensity exercise? (5
points)
3. Using Figure 1 in the paper, briefly describe the different
sources of ATP production at 50% versus 90% AND explain whether you
believe this depiction of ATP production applies to a Type IIX
myofiber in a human....
Below is the HNMR spectrum for dimedone in deuterated DMSO. I
need to find the equilibrium constant for the enol/ketone
equilibrium. Not sure how to do this since I dont see a prominent
signal for the ketone methylene protons? Also the enol should be
more prominent in this solvent because of its polarity, but there
is no significant OH peak. I am really confused, would appreciate
any help. Thanks.
7.69 5.15 2.25 10 12 6 2 2 PPM Nolumes/Lexar/Dimedone/HNMR dimedone...
Below is the HNMR for dimedone in deuterated acetone. I need to
calculate the %enol and %ketone content given this data. How can I
do this?
9.65 5.99 4.65 57 1.19 1.46 1.00 12 14 10 4 PPM Molumes/Cory/HNMR dimedone in acetone04121/17 (09:48)
9.65 5.99 4.65 57 1.19 1.46 1.00 12 14 10 4 PPM Molumes/Cory/HNMR dimedone in acetone04121/17 (09:48)
Synthesis of dimedone This lab exercise will give you practical experience with the generation of a malonic ester enolate and subsequent reaction with an a,p-unsaturated carbonyl compound. This sequence is known as the Michael reaction. In the presence of sodium methoxide, dimethyl propanedioate (malonic ester/dimethyl malonate) is converted to the corresponding enolate anion and reaction with 4-methylpent-3-en-2-one (mesityl oxide) affords the Michael adduct 1, as shown in the reaction sequence below. Under the basic reaction conditions, the Michael adduct 1...
Synthesis of dimedone This lab exercise will give you practical experience with the generation of a malonic ester enolate and subsequent reaction with an a,p-unsaturated carbonyl compound. This sequence is known as the Michael reaction. In the presence of sodium methoxide, dimethyl propanedioate (malonic ester/dimethyl malonate) is converted to the corresponding enolate anion and reaction with 4-methylpent-3-en-2-one (mesityl oxide) affords the Michael adduct 1, as shown in the reaction sequence below. Under the basic reaction conditions, the Michael adduct 1...
1. How does Lexy’s age affect her decision to get an
MBA?
A Aceto, Frank BUS 622 Week 3 Case Study Template F19- Excel AutoSave Off Share Review File Home Insert Page Layout Formulas Data View Help Tell me what you want to do AutoSum As 12A A Wrap Text Calibri General Fill Paste в I U Conditional Format as Insert Delete Format Sort & Find & - A 0 00 00 0 | Merge & Center...
Please determine the IDENTITY of the unknown
compound and explain how each peak / data point from the following
instruments led to that identification. What does the gcms
indicate. Thank you very much! (The GCMS data is just a long set of
numbers which is why the question appears so long).
IR of unknown:
NMR unknown Proton Graphs (first is overall graph,
others that follow are zoomed in sections):
NMR unknown Carbon Graphs (first is overall graph,
others that follow...
e. 18 Test Your Knowledge MULTIPLE CHOICE: Choose the one best answer. 1. Each element has its own characteristic atom in which a. the atomic mass is constant. b. the atomic number is constant. c. the mass number is constant. d. Two of the above are correct. e. All of the above are correct. 2. Which of the following is not a trace element in the human body? a. iodine b. zinc c. iron d. calcium e. fluorine 3. A...
1. According to the paper, what does lactate dehydrogenase
(LDH) do and what does it allow to happen within the myofiber? (5
points)
2. According to the paper, what is the major disadvantage of
relying on glycolysis during high-intensity exercise? (5
points)
3. Using Figure 1 in the paper, briefly describe the different
sources of ATP production at 50% versus 90% AND explain whether you
believe this depiction of ATP production applies to a Type IIX
myofiber in a human....
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago