What is the product of the reaction sequence: ii. DIBAL-H,-78c iv. H2O NaOEt (-Н-0) -CN сно сно Сно п ш -сно CHO IV V
What is the product of the reaction sequence: H NaOEt 2 (-H,0) CN CN CN CN - II III CN
What would be the final organic product of the following reaction? i. DIBAL-H, -78°C ii. H,0 ? он ОН ОН ОН III п ОН V IV
2) What is the product of the following reaction? 1) DIBAL-H, hexane, -78°C v e bore me te ?????? ?????? 2) H2O OH a) b) II c) III d) IV Ime Ingo 2) What is the product of the following reaction? 1) DIBAL-H, hexane, -78°C v e bore me te ?????? ?????? 2) H2O OH a) b) II c) III d) IV Ime Ingo U 3) What is the product of the following reaction? 1) CH3CH2CH, CH2MgBr, Etzo - CN...
What would be the major product of the following reaction sequence? i. LDA i. C2HsI I п II IV V
The principal product of this reaction is: I, II, III or
IV?
CHO НО- -Н I -ОН 1. NaBH4 H -ОН 2. H,0* НО- -Н CH2OH СОН ÇOCH СН,ОН ÇO2H -Н НО. НО- -Н НО- -Н НО- -Н Н- -ОН H -ОН Н. -ОН -ОН H— Н- -ОН -ОН H Н- -ОН -ОН H— НО -Н НО- -Н НО- -Н НО- -Н CH OH CH,OH СОН СОН III IV -
Name: 1 What is the major product of the following reaction? (CHдЬсo (CHЊ,сон Br IV A) I B) II C) III D) IV 2. What is the major elimination product obtained from the following reaction? NaOMe MeOH Br IV A) I B) II C) III D) IV 3. Which of the following is the most reactive substrate in an E2 reaction? CHiCH(Br)CH2CHs (CHs)sCBr CH3Br CH3CH2CH2CH2Br п ш IV I B) II С) ш D) IV A) I 4 Which of...
Question 39 What is the major product of the following reaction sequence? HCN HCI Н,0 heat он он он -CN NH CN он II III IV І он соон V СА. ІІ СВ. Т C. IV D. II СЕ. V Question 40 What is the final product, Z, of the following synthesis? SOC12 1. LiAlH(O-t-Bu)3 ether, -78 °C 2. H20 1. KMnO4, OH, heat 2. H307 -CH3 Y Z O Lovebula o locha a odoli odor Ι II III IV...
Testbank Question 21 What is the product of the reaction sequence: NaOEt (-H20) oss o Testbank Question 50 What would be the major product of the following reaction? ОН- heat | HO H | O= orator N OH III но на (Z and E) IV Testbank Question 72 What would be the product of the following reaction? CN ELOH OH 0 OH .CN HOT CN
9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the following methods would be expected to efficiently produce cis-2-butene as the major organic product? a. CH3C CCH3 + H2, Pt b. CH3CHBrCH2CH3+(CHs)3COK/(CH3); COH c. CH3C CCH +H2, Ni2B (P-2) d. CH3C CCH +Na, NH3() 11. Which of the following is the structure for (2E,4E)-octa-2,4-dien-6-yne? IV ш п
What is the product of the following E2 elimination reaction?
What is the product of the following E2 elimination reaction? Нас Oон H -н E2 CH2CH РE он Нас Нас Нс Нс Нс -н H H сH-сHь CH2CH3 CH2CH сH-CH CH2CHs V IV Ш II I. II. IV. V.