Homework Answers
![1. Ideal gas Equation PV = nRT, P2 V2 = nRT2 Ich p= const u. V.T₂ = V2 Ti 2.96LY (35+273)* = 4.57L(T+2 73k 2096 L LT + 273] K](http://img.homeworklib.com/questions/24dae460-09d0-11ea-b82f-015e50a034a8.png?x-oss-process=image/resize,w_560)
Add Answer to:
Part 2: Short Answer Directions: Answer each of the following questions. Be sure to use complete sentences where...
a) A helium-filled weather balloon has a volume of 521 L at 17.9°C and 758 mmHg....
a) A helium-filled weather balloon has a volume of 521 L at 17.9°C and 758 mmHg. It is released and rises to an altitude of 5.22 km, where the pressure is 472 mmHg and the temperature is –14.1°C. The volume of the balloon at this altitude is ______L b) A sample of krypton gas occupies a volume of 6.19 L at 56.0°C and 382 torr. If the volume of the gas sample is decreased to 4.90 L, while its temperature...
I am learning gas laws and I am not sure how to set this up and...
I am learning gas laws and I am not sure how to set
this up and solve.
EXERCISE I Name Section Instructor Date Gas Laws Show all calculation setups, including units, for all problems. 1. A sample of methane gas, CH4, occupies 3.25 L at temperature of 19.0 °C. If the pressure is held constant, what will be the temperature be if the volume expands to 10.00 L?
the following questions please 1. Why is an airplane pressurized? 2. Why does a scuba diver...
the following questions please
1. Why is an airplane pressurized? 2. Why does a scuba diver need increased gas pressure in the air tank? 3. How does temperature affect the kinetic energy of gas molecules? 4. A balloon is filled with 652 mL of helium at a pressure of 1.00 atm. What is the new volume, in milliliters, if the pressure decreases to 738 mmHg, with T and n constant? 5. A sample of neon gas occupies 75.0 mL at...
Directions: Answer each of the following questions. Be sure to use complete sentences where appropriate. For...
Directions: Answer each of the following questions. Be sure to use complete sentences where appropriate. For full credit be sure to show all of your work. Where appropriate answers should be boxed for clarity, written to the correct number of significant figures, and, include the proper units. 1. Which of the following is a chemical reaction (4 points)? a. Solid copper deposits on a piece of aluminum foil when the foil is placed in a blue copper(II) nitrate solution. The...
2. Complete and balance this single replacement reaction (assume Zn goes to Zn) Zn+H2SO4 3. Complete and bal...
2. Complete and balance this single replacement reaction (assume Zn goes to Zn) Zn+H2SO4 3. Complete and balance this decomposition reaction: HgO 4. Name three ways you can verify that a chemical reaction has taken place. 5. Balance the following equation: Fe2O3(s) O2(g) Fe(s)+ 090ewContent40616590/View 1) At 25 C, a sample of gas occupies 2.50 L of volume. What temperature would be required to triple the volume? 2) If a 8.0 L. container of oxygen gas has a pressure of...
25. You’re at the zoo and have a big red 3.20 L helium balloon. The barometric...
25. You’re at the zoo and have a big red 3.20 L helium balloon. The barometric pressure is 790.0 mm Hg. Then you hear the roar of a lion. Startled, you accidently release the balloon. It flies away. By the time it reaches the clouds the atmospheric pressure is only 0.300 atm. What is the new volume of the balloon? a) 6.20 L b) 11.1 L c) 1.06 L d) 8.43 L 26. A gas sample is held at constant...
pls answer all asap pls show all workings DIRECTIONS: The following questions are based on topics...
pls answer all asap pls show all workings
DIRECTIONS: The following questions are based on topics covered in class. Read the problems carefully and CIRCLE THE LETTER that best answers the question and SHOW ALL WORK FOR CREDIT. You will not receive credit by just picking the correct answer for problems involving calculations. 1. Under constant pressure, a sample of nitrogen occupies 117 mL at 373 K. At what temperature would it occupy 234 mL? (a) 373 K (b) 746...
24) Which of the following represent STP (Standard Temperature and Pressure) conditions? A) T -0 K...
24) Which of the following represent STP (Standard Temperature and Pressure) conditions? A) T -0 K and P = 1 atm B) T=0°C and P 760 atm C) T= 273 K and P = 0 atm D) T-273 K and P-1 atm E) T = 1 K and P = 1 atm 25) Which of the following is TRUE for a liquid that is placed in a sealed container? A) Condensation of the evaporated molecules in the jar can only...
Question 3,4, and 5 showing all work used to calculate answer 2. An automobile tire has...
Question 3,4, and 5 showing all work used to calculate
answer
2. An automobile tire has a bursting pressure of 60 psi. The normal pressure inside the tire at 25 °C before running it is 32 psi. When travelling at highway speeds, a tire can get quite hot. Determine whether the tire will burst when the inside temperature gets to 100 °C. Show your calculations. 3. Using the ideal gas law, calculate the following: a) the volume of 0.510 mol...
I am learning gas laws and I am not sure how to set
this up and solve.
EXERCISE I Name Section Instructor Date Gas Laws Show all calculation setups, including units, for all problems. 1. A sample of methane gas, CH4, occupies 3.25 L at temperature of 19.0 °C. If the pressure is held constant, what will be the temperature be if the volume expands to 10.00 L?
the following questions please
1. Why is an airplane pressurized? 2. Why does a scuba diver need increased gas pressure in the air tank? 3. How does temperature affect the kinetic energy of gas molecules? 4. A balloon is filled with 652 mL of helium at a pressure of 1.00 atm. What is the new volume, in milliliters, if the pressure decreases to 738 mmHg, with T and n constant? 5. A sample of neon gas occupies 75.0 mL at...
Directions: Answer each of the following questions. Be sure to use complete sentences where appropriate. For full credit be sure to show all of your work. Where appropriate answers should be boxed for clarity, written to the correct number of significant figures, and, include the proper units. 1. Which of the following is a chemical reaction (4 points)? a. Solid copper deposits on a piece of aluminum foil when the foil is placed in a blue copper(II) nitrate solution. The...
2. Complete and balance this single replacement reaction (assume Zn goes to Zn) Zn+H2SO4 3. Complete and balance this decomposition reaction: HgO 4. Name three ways you can verify that a chemical reaction has taken place. 5. Balance the following equation: Fe2O3(s) O2(g) Fe(s)+ 090ewContent40616590/View 1) At 25 C, a sample of gas occupies 2.50 L of volume. What temperature would be required to triple the volume? 2) If a 8.0 L. container of oxygen gas has a pressure of...
pls answer all asap pls show all workings
DIRECTIONS: The following questions are based on topics covered in class. Read the problems carefully and CIRCLE THE LETTER that best answers the question and SHOW ALL WORK FOR CREDIT. You will not receive credit by just picking the correct answer for problems involving calculations. 1. Under constant pressure, a sample of nitrogen occupies 117 mL at 373 K. At what temperature would it occupy 234 mL? (a) 373 K (b) 746...
24) Which of the following represent STP (Standard Temperature and Pressure) conditions? A) T -0 K and P = 1 atm B) T=0°C and P 760 atm C) T= 273 K and P = 0 atm D) T-273 K and P-1 atm E) T = 1 K and P = 1 atm 25) Which of the following is TRUE for a liquid that is placed in a sealed container? A) Condensation of the evaporated molecules in the jar can only...
Question 3,4, and 5 showing all work used to calculate
answer
2. An automobile tire has a bursting pressure of 60 psi. The normal pressure inside the tire at 25 °C before running it is 32 psi. When travelling at highway speeds, a tire can get quite hot. Determine whether the tire will burst when the inside temperature gets to 100 °C. Show your calculations. 3. Using the ideal gas law, calculate the following: a) the volume of 0.510 mol...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 44 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago