2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3 CH,CH2--C--C...

Question

Question

2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3

CH,CH2--C--CH2CH2CH3 CH3 3. Relating to the figure in question 2, which Carbon atom is the stereogenic carbon atom? a. Carbon

science chemistry

Add a comment Improve this question Transcribed image text

Answer 1

Answer #1

H H3C- H2 C- —C— H2H2 C —C—CH3 СН3 3-methylhexane Groups are H Methyl Ethyl n-propyl Stereogenic carbon is C-3

Add a comment

Answer 2

Similar Homework Help Questions

Which of the following is a tertiary alcohol? CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH CH3CH2-CH-CH3 OH CH2CH2CH3 CH3 CH2-C-CH2CH3 OH...

Which of the following is a tertiary alcohol? CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH CH3CH2-CH-CH3 OH CH2CH2CH3 CH3 CH2-C-CH2CH3 OH LOH CH2CH3 Reset Selection Type here to search
1) Which of the following is a secondary alcohol? A) CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH он - CH₂ CH3...

1) Which of the following is a secondary alcohol? A) CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH он - CH₂ CH3 CH2-CH-CH3 он CH2CH3 CH2CH2CH3 CH3CH2-C-CH2CH3 OH 2) The substance that precipitates in a positive Benedict test is: A) Cuo B) Cu2o C) Ag D) none of these 3) Galactose is called a(n): A) ketohexose B) aldopentose C) aldohexose D) ketopentose 4) Identify all the disaccharides from the following list: i) Lactose ii) Glucose iii) Ribose iv) Maltose A) iii B) iii + iv C)i...
QUESTION 18 Consider the reaction below OH + CH3CH2-C-H CH3CH2-C-H CH3CH2-CH-CH-C-H 48H CHCH CH3 What form...

QUESTION 18 Consider the reaction below OH + CH3CH2-C-H CH3CH2-C-H CH3CH2-CH-CH-C-H 48H CHCH CH3 What form is used to describe the reaction indicated above? TTTT Paragraph Arial 3 (121) TTBUS E.T- Words

Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2

Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2
Write the correct name for each compound below. H3C-CH3: H3C-CH2-CH2-CH2-CH2-CH2-CH2-CH=CH2: H-C≡C-H: H-C-(CH3)3: H3C-CH=CH-CH3:

Write the correct name for each compound below. H3C-CH3: H3C-CH2-CH2-CH2-CH2-CH2-CH2-CH=CH2: H-C≡C-H: H-C-(CH3)3: H3C-CH=CH-CH3:
What is the name of this molecule? CH3 7 CH3 - CH2 - CH - CH2...

What is the name of this molecule? CH3 7 CH3 - CH2 - CH - CH2 - CH3 methylpentane methylhexane O 3-methylpentane O 3-ethylpentane 3,3-dimethylhexane QUESTION 4 What is the name of the functional group on this molecule? CH3 -C=0 / CH3 O alcohol O ether aldehyde O ketone O carboxylic acid O amine

21. Consider the following: CHj CH2 CH-CHCH2 CH CH CH2 CH2 CH2 CH-CH2 CH3 CH-CHCH2 CH2...

21. Consider the following: CHj CH2 CH-CHCH2 CH CH CH2 CH2 CH2 CH-CH2 CH3 CH-CHCH2 CH2 CH3 CH2-CHCH2 CH2 CH2 CH3 IV which two structures represent the same compound? a. I and II b. II and III c. I and III d. II and IV e. None of these 22. In which of these cases, does the central atom have a zero forma.l charge? a. HEH CH3 OCH3 C. F FBF d. H CH3 H CH3 CH CH3 CCH CH3...
-methylhexane C) heptane B) 3-methylhexane D) methylhexane 39. Denaturation of a protein A) changes the primary...

-methylhexane C) heptane B) 3-methylhexane D) methylhexane 39. Denaturation of a protein A) changes the primary structure of a protein. B) disrupts the secondary. tertiary or quaternary structure of a protein. C) is always irreversible. D) hydrolyzes peptide bonds. 40. The carbonyl group consists of A) a carbon-Oxygen-hydrogen structure. B) a carbon-Oxygen single bond. c) a carbon-Oxygen double bond. D) a carbon-oxygen triple bond. 41. The addition of hydrogen to an organic compound or the loss of oxygen is called...
26.) The general formula for a carbohydrate is: A) CnH2n+2 B) Cn(H20)n C) CnH2n D) Cn(H20)...

26.) The general formula for a carbohydrate is: A) CnH2n+2 B) Cn(H20)n C) CnH2n D) Cn(H20) 27.) Which of the following functional groups comprises a carbon atom bonded to a hydroxyl group? A) Alcohol B) Thiol C) Carbonyl D) Ester 28.) A carbohydrate with 4 carbons is called a: A) hexose B) triose C) pentose D) tetrose 29.) A carbohydrate with 6 carbons and an aldehyde functional group is called a(n): A) ketohexose B) aldohexose C) ketopentose D) aldopentose A)...

Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all...

Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all of these choices CH3-CH-C-CHE -8-сон, CH,-8-3-CH, спесне: -он, 10. What type of compound is the second product in the reaction shown below? CH-0-2-CH, OCH & CHOCH, H,CH, +3 NaOH + CH-OH + CH-OH CH -0-C-(CH2)16CH, a, fatty acid salt b. ester CH-OH c. alcohol d. fatty acid

2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3 CH,CH2--C--C...

Homework Answers

Add Answer to:
2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3 CH,CH2--C--C...

Post as a guest

Earn Coins

Which of the following is a tertiary alcohol? CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH CH3CH2-CH-CH3 OH CH2CH2CH3 CH3 CH2-C-CH2CH3 OH...

1) Which of the following is a secondary alcohol? A) CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH он - CH₂ CH3...

QUESTION 18 Consider the reaction below OH + CH3CH2-C-H CH3CH2-C-H CH3CH2-CH-CH-C-H 48H CHCH CH3 What form...

Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2

Write the correct name for each compound below. H3C-CH3: H3C-CH2-CH2-CH2-CH2-CH2-CH2-CH=CH2: H-C≡C-H: H-C-(CH3)3: H3C-CH=CH-CH3:

What is the name of this molecule? CH3 7 CH3 - CH2 - CH - CH2...

21. Consider the following: CHj CH2 CH-CHCH2 CH CH CH2 CH2 CH2 CH-CH2 CH3 CH-CHCH2 CH2...

-methylhexane C) heptane B) 3-methylhexane D) methylhexane 39. Denaturation of a protein A) changes the primary...

26.) The general formula for a carbohydrate is: A) CnH2n+2 B) Cn(H20)n C) CnH2n D) Cn(H20)...

Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all...

2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3 CH,CH2--C--C...

Homework Answers

Add Answer to: 2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3 CH,CH2--C--C...

Post as a guest

Earn Coins

Add Answer to:
2. What four different groups are attached to the C in 3-methylhexane? H CH3CH2---C---CH2CH2CH3 CH3 CH,CH2--C--C...