name of this reaction? R-C = C-Rt BRC (leg) > R-C=C-R BR BR Bring R-¢-C-R 4 BR BR
Name 03.101 example of a reaction having an Eact = 0 would Br• + Br-Br - > Br-Br + Br. F. + CH - > H-F + CH3. . CH. + CH, CH2 - CH + CH3 CH2 • .. Br + H-Br - > H-Br + Br. -. CH. + CH3 - > CH3-CH3 Which of the following is true of any (S)-enantiomer? 4. It rotates plane-polarized light to the right. b. It rotates plane-polarized light to the left....
name of this reaction?
-peca(-CH3 -> R-C-R =C-CH3 R له ل-5 ¢-CE C-CH₃
Name: 13. Provide a rational arrow pushing mechanism for the following reaction: H Br Br Br Br 14. Name the following compounds: Cl OH CH) SH CH CI' Br Br Br
Name: 13. Provide a rational arrow pushing mechanism for the following reaction: H Br Br Br Br 14. Name the following compounds: Cl OH CH) SH CH CI' Br Br Br
2014 Reaction Quiz 2 (4 pages) Name: 1. Draw an expected product. 2. Assign R or S to anv stereocenter created in the product you show. A Product Starting Material Reagents or Reaction OsO, Н.с Br Br н.с Br -Br H -OH (NOT the same product as previous above) (water) н,с H, H20 Н,с H, H20 FAssign R or S! MCPBA IDENTICAL
3. Draw the products of the following Sn1 reaction: H₃C Br + CH3OH-02 tot (R)-3-Bromo-3-methylhexane 4. Draw the products and the mechanism for the following SN2 reaction: Br + Wollonica Na SH O WS
signment Score: 150/1800 Resources OH Question 7 of 18 > Consider the reaction described by the equation C,H, Br, (aq) + 31 (aq) -C,H,(8) + 2 Br" (aq) + 1; (aq) The rate law is rate = k[C,H, Br,1"] where k = 0.00508 M-.5-1 What are the missing entries in the table? Run 0.173 Initial rate of formation of 0.000608 0.000304 0.173 0.173 0.173 SO E U | R T Y D F G H J K. C V B...
What is the condensed formula notation for 1,4-dibromo-2-methylpentane? Select the correct answer below: O Br-CH-CH, -C(Br)(CH,) -CH, CH, -CH-CH(Br)-CH(Br) -CH(CHA)-CH, O Br-CH-CH(CH)-CH-CH(Br)-CH, OCH, -CH(Br)-CH-CH(CH,)-CH-CH, --Br Fill in the blanks (in order!) to balance the reaction. Use a "1" if necessary - don't leave any boxes blank. KOH + H3PO4 -> H2O + K3PO4 Blank # 1 A Blank # 2 AV Blank # 3 Blank # 4 AM What is the name of the compound CoF2?
Question 2 (4 points) a) Give the major products of the following reaction. Br Nal ethanol, RT b) How many products are formed and what is their ratio? c) What is the relationship between your products? They are
U > Question 4 US Name the following compound. Br H CH H H CH,CH, 1-bromo-1-methylbutane 1-bromo-2-methylbutane 3-bromo-2,4-dimethylhexane BO 4-bromo-2.2.3-trimethylhexane
name of this reaction?
- Back C - K ZH-C – H C=C-R OH +®, CH-CEC-R