Homework Answers
Add Answer to:
06 Question (3 points) At a given temperature, K 8.6x10 for the following forward reaction: 2NO(g)+02(8) 2NO2(g) W...
At a given temperature, K = 3.5×104 for the following forward reaction: 2NO(g) + O2(g) =...
At a given temperature, K = 3.5×104 for the following forward reaction: 2NO(g) + O2(g) = 2NO2(g) [Note: equal sign is equilibrium arrows] a) Write the reverse reaction. Be sure to include all states of matter. b) What is the K value for the reaction above written in the reverse direction?
2NO(g)02(g)2NO2(g) AH° =-114.2 kJ and AS° =-146.5 J/K The equilibrium constant for this reaction at 321.0...
2NO(g)02(g)2NO2(g) AH° =-114.2 kJ and AS° =-146.5 J/K The equilibrium constant for this reaction at 321.0 K is Assume that AH° and AS° are independent of temperature
(a) For the reaction 2NO2 (g) 2NO (g) + 02 (g) K # 0.50. Predict the...
(a) For the reaction 2NO2 (g) 2NO (g) + 02 (g) K # 0.50. Predict the direction in which the system will move to reach equilibrium if the initial gas pressures are NO: 0.20 atm . NO2: 0.20 atm (answer: to the right because Q< K) .NO2: 0.0961 atm 02: 0.0589 atm NO: 0.280 atm (answer: the system is already at equilibrium because Q -K) O2: 0.20 atm NO: 0.56 atm NO2: 0.20 atm (answer: to the left because Q>...
Consider the following reactions at some temperature: 2NOCI(g) � 2NO(g) + Cl2 (g) K = 1.6...
Consider the following reactions at some temperature: 2NOCI(g) � 2NO(g) + Cl2 (g) K = 1.6 X 10-5 2NO(g) � N2 (g) + 02 (g) K = 1 X 1031 For each reaction, assume some quantities of the reactants were placed in separate containers and allowed to come to equilibrium. Describe the relative amounts of reactants and products that would be present at equilibrium. At equilibrium, which is faster, the forward or reverse reaction in each case?
Given the following reactions Question 1 Given the following reactions AH 66.4 k N2 (g)+202 (g)2NO2...
Given the following reactions
Question 1 Given the following reactions AH 66.4 k N2 (g)+202 (g)2NO2 (g) 2NO (g)+02 (g) 2NO2 (g) AH=-114.2 k the enthalpy of the reaction of the nitrogen to produce nitric oxide 2NO (g) N2 (g)+02 (g) KJ. is 90.3 180.6 -180.6 47.8 47.8
Consider the following reaction where K. = 154 at 298 K. 2NO(g) + Br2(g) + 2NOBr(8) A reaction mixture was found to...
Consider the following reaction where K. = 154 at 298 K. 2NO(g) + Br2(g) + 2NOBr(8) A reaction mixture was found to contain 4.66x10-2 moles of NO(g), 4.26x102 moles of Br2(g) and 9.65x102 moles of NOBr(g), in a 1.00 liter container. Is the reaction at equilibrium? If not, what direction must it run in order to reach equilibrium? The reaction quotient, Qc, equals The reaction A. must run in the forward direction to reach equilibrium. B. must run in the...
Be sure to answer all parts. At 430°C, the equilibrium constant (Kp) for the reaction 2NO(g)+O2()s 2NO2(g) is 1.5 x...
Be sure to answer all parts. At 430°C, the equilibrium constant (Kp) for the reaction 2NO(g)+O2()s 2NO2(g) is 1.5 x 105. In one experiment, the initial pressures of NO, O2, and NO are 6.3 x 103 atm, 1.9 x 10-2 atm, and 0.18 atm, respectively. Calculate Op and predict the direction that the net reaction will shift to reach equilibrium. What is Qp for the experiment? 4.29 In which direction will the system proceed to reach equilibrium? The reaction will...
3. Consider the chemical equilibrium for the following chemical reaction AH -+114 kJ 2NO2(g) 2NO(g) +...
3. Consider the chemical equilibrium for the following chemical reaction AH -+114 kJ 2NO2(g) 2NO(g) + 02(s) Assume that the chemical reaction is at equilibrium. How will each of the follow- Kp)? Fill in the blanks by PNO ing changes affect the indicated quantities (PNo2 Po answering: increase, decrease, or no change. Poa PO К, PNO2 Pos PNO2 PM No hange (a) temperature is lowered (b) remove NO gas from the reaction flask (a) double the volume of the reaction...
Consider the following reaction where Kc = 154 at 298 K. 2NO(g) + Br2(g) 2NOBr(g) A...
Consider the following reaction where Kc = 154 at 298 K. 2NO(g) + Br2(g) 2NOBr(g) A reaction mixture was found to contain 4.44×10-2 moles of NO(g), 3.68×10-2 moles of Br2(g) and 7.92×10-2 moles of NOBr(g), in a 1.00 liter container. Is the reaction at equilibrium? If not, what direction must it run in order to reach equilibrium? The reaction quotient, Qc, equals . The reaction A. must run in the forward direction to reach equilibrium. B. must run in the...
Question number 8 The following reaction is carried out at 25o C: 2NO(g) + O2 (g)...
Question number 8 The following reaction is carried out at 25o C: 2NO(g) + O2 (g) → 2NO2 (g) These are the thermodynamic values associated with this reaction: ΔSoreaction = -147 J K-1 ΔHoreaction = -114 kJ ΔGoreaction = -70 kJ What is the effect of changing the reaction temperature to 500 K? Question 8 options: all of the answers are correct none of the answers are correct the reaction is less spontaneous at 500 K the spontaneity of the...
2NO(g)02(g)2NO2(g) AH° =-114.2 kJ and AS° =-146.5 J/K The equilibrium constant for this reaction at 321.0 K is Assume that AH° and AS° are independent of temperature
(a) For the reaction 2NO2 (g) 2NO (g) + 02 (g) K # 0.50. Predict the direction in which the system will move to reach equilibrium if the initial gas pressures are NO: 0.20 atm . NO2: 0.20 atm (answer: to the right because Q< K) .NO2: 0.0961 atm 02: 0.0589 atm NO: 0.280 atm (answer: the system is already at equilibrium because Q -K) O2: 0.20 atm NO: 0.56 atm NO2: 0.20 atm (answer: to the left because Q>...
Given the following reactions
Question 1 Given the following reactions AH 66.4 k N2 (g)+202 (g)2NO2 (g) 2NO (g)+02 (g) 2NO2 (g) AH=-114.2 k the enthalpy of the reaction of the nitrogen to produce nitric oxide 2NO (g) N2 (g)+02 (g) KJ. is 90.3 180.6 -180.6 47.8 47.8
Consider the following reaction where K. = 154 at 298 K. 2NO(g) + Br2(g) + 2NOBr(8) A reaction mixture was found to contain 4.66x10-2 moles of NO(g), 4.26x102 moles of Br2(g) and 9.65x102 moles of NOBr(g), in a 1.00 liter container. Is the reaction at equilibrium? If not, what direction must it run in order to reach equilibrium? The reaction quotient, Qc, equals The reaction A. must run in the forward direction to reach equilibrium. B. must run in the...
Be sure to answer all parts. At 430°C, the equilibrium constant (Kp) for the reaction 2NO(g)+O2()s 2NO2(g) is 1.5 x 105. In one experiment, the initial pressures of NO, O2, and NO are 6.3 x 103 atm, 1.9 x 10-2 atm, and 0.18 atm, respectively. Calculate Op and predict the direction that the net reaction will shift to reach equilibrium. What is Qp for the experiment? 4.29 In which direction will the system proceed to reach equilibrium? The reaction will...
3. Consider the chemical equilibrium for the following chemical reaction AH -+114 kJ 2NO2(g) 2NO(g) + 02(s) Assume that the chemical reaction is at equilibrium. How will each of the follow- Kp)? Fill in the blanks by PNO ing changes affect the indicated quantities (PNo2 Po answering: increase, decrease, or no change. Poa PO К, PNO2 Pos PNO2 PM No hange (a) temperature is lowered (b) remove NO gas from the reaction flask (a) double the volume of the reaction...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 53 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago