Homework Answers
Add Answer to:
Need help with 11-15 please 11.-15. What is the major product of the following reactions with ? Answers may be repeated....
11.-15. What is the major product of the following reactions with ? Answers may be repeated....
11.-15. What is the major product of the following reactions with ? Answers may be repeated. 11. HiCLi а. 12. H2/Pd 13. NaBH4 С. 14. CH3MgCI 15. LiCu(CH3)2 е.
11-15 please, thank you! 11.-15. What is the major product of the following reactions with ?...
11-15 please, thank you!
11.-15. What is the major product of the following reactions with ? Answers may be repeated. 11. H3CL 12. H2/Pd 13. NaBH 14. CH3MgCI 15. LiCu(CH3)2
11.-15. What is the major product of the following reactions with Answers may be repeated. 11....
11.-15. What is the major product of the following reactions with Answers may be repeated. 11. H.CLi 12. H./Pd b. c. Ya 13. NaBH 14. CH MgCl 15. LiCu(CH)
Need help with 3-7 please! 3.-7. What is the major product of the following reactions? Answers...
Need help with 3-7 please!
3.-7. What is the major product of the following reactions? Answers may be repeated. : I _LDACHI ܚ -78°C_Br- LDA LDA (CH3)2Sici ZnCl2 CH:I. H:0*. o NaOCH CHI NaOHH*/A , excess e. not a.-d.
3.-7. What is the major product of the following reactions? Answers may be repeated. 3. ~...
3.-7. What is the major product of the following reactions? Answers may be repeated. 3. ~ 4. mul al b. H. 5.Lm 6. O H a. re du zh Yang e. not a.-d.
II. Draw the structure for the major organic product of each of the following reactions. 11....
II. Draw the structure for the major organic product of each of the following reactions. 11. Ç(CH3) 30 1) PhČCI, AICI: 2) Et2NH, H2, Raney-Ni, heat 12. ÇO2Me 1) EtMgBr (2 equiv.) 2) H20, H30+ 13. o CNH2 1) Br2, NaOH, H20 O 2) (CH3)2CHČCI, pyridine 14. Br2, H20 CHO HOEH H -OH H-OH HOEH CH2OH
3.-7. What is the major product of the following reactions? Answers may be repeated. LDA CHI...
3.-7. What is the major product of the following reactions? Answers may be repeated. LDA CHI 3. а. -78°C LDA 4. b. (CH) SiC LDA 5. ZnCl CHы. но 6 d. NaOCH, CH, NaOHH"А excess 7. e. not a.-d. un
Please draw the major product or products of each of the following reactions. Organic Chemistry Но,...
Please draw the major product or products of each of the
following reactions.
Organic Chemistry
Но, HNO3 / H2SO4 10 ΑΙΟΙ, CI 11. NO2 CI AICI X- 12. © Brian Lavey 2020 ON Cly/FeCly 13 ON H/Pd on C -OH 14. ON CH, O-Na 1200 . 15 16 Hint: Think Intramolecular Diels-Alder Type here to search O BI 29
3-7 please, thank you! 3.-7. What is the major product of the following reactions? Answers may...
3-7 please, thank you!
3.-7. What is the major product of the following reactions? Answers may be repeated. a. re 3. » w chode 4. 5. Los b. c. d. Li NOCH NA e. not a.-d.
Hello, can you please help me out with these problems. Thanks in advance. What reagents and...
Hello, can you please help me out with these problems. Thanks in
advance.
What reagents and conditions produce this transformation? 58. OH steps (A) 1. H2, Pd/C 3. NaOH, H2CO 4. NaBH4, CH3OH 5. Нзо", (CH3)2CO (B) 1. H2, Pd/C 2. NaBH4, CH OH 3. NaOH, Н.СО 4. pyridine-HCICrOs (PCC) 5. Нзо", (CH3)2CO (C) 1·Hao", (CH3)2CO 2. H Cros, H2S04, H2O 3. CH3MgBr 4. CHsCoH So2Cl (TsCl) 5. H2, Pd/C (D) 1. 1,3-butadiene, heat 2. H2, Pd/C 3. SOC12, pyridine...
11.-15. What is the major product of the following reactions with ? Answers may be repeated. 11. HiCLi а. 12. H2/Pd 13. NaBH4 С. 14. CH3MgCI 15. LiCu(CH3)2 е.
11-15 please, thank you!
11.-15. What is the major product of the following reactions with ? Answers may be repeated. 11. H3CL 12. H2/Pd 13. NaBH 14. CH3MgCI 15. LiCu(CH3)2
11.-15. What is the major product of the following reactions with Answers may be repeated. 11. H.CLi 12. H./Pd b. c. Ya 13. NaBH 14. CH MgCl 15. LiCu(CH)
Need help with 3-7 please!
3.-7. What is the major product of the following reactions? Answers may be repeated. : I _LDACHI ܚ -78°C_Br- LDA LDA (CH3)2Sici ZnCl2 CH:I. H:0*. o NaOCH CHI NaOHH*/A , excess e. not a.-d.
3.-7. What is the major product of the following reactions? Answers may be repeated. 3. ~ 4. mul al b. H. 5.Lm 6. O H a. re du zh Yang e. not a.-d.
II. Draw the structure for the major organic product of each of the following reactions. 11. Ç(CH3) 30 1) PhČCI, AICI: 2) Et2NH, H2, Raney-Ni, heat 12. ÇO2Me 1) EtMgBr (2 equiv.) 2) H20, H30+ 13. o CNH2 1) Br2, NaOH, H20 O 2) (CH3)2CHČCI, pyridine 14. Br2, H20 CHO HOEH H -OH H-OH HOEH CH2OH
3.-7. What is the major product of the following reactions? Answers may be repeated. LDA CHI 3. а. -78°C LDA 4. b. (CH) SiC LDA 5. ZnCl CHы. но 6 d. NaOCH, CH, NaOHH"А excess 7. e. not a.-d. un
Please draw the major product or products of each of the
following reactions.
Organic Chemistry
Но, HNO3 / H2SO4 10 ΑΙΟΙ, CI 11. NO2 CI AICI X- 12. © Brian Lavey 2020 ON Cly/FeCly 13 ON H/Pd on C -OH 14. ON CH, O-Na 1200 . 15 16 Hint: Think Intramolecular Diels-Alder Type here to search O BI 29
3-7 please, thank you!
3.-7. What is the major product of the following reactions? Answers may be repeated. a. re 3. » w chode 4. 5. Los b. c. d. Li NOCH NA e. not a.-d.
Hello, can you please help me out with these problems. Thanks in
advance.
What reagents and conditions produce this transformation? 58. OH steps (A) 1. H2, Pd/C 3. NaOH, H2CO 4. NaBH4, CH3OH 5. Нзо", (CH3)2CO (B) 1. H2, Pd/C 2. NaBH4, CH OH 3. NaOH, Н.СО 4. pyridine-HCICrOs (PCC) 5. Нзо", (CH3)2CO (C) 1·Hao", (CH3)2CO 2. H Cros, H2S04, H2O 3. CH3MgBr 4. CHsCoH So2Cl (TsCl) 5. H2, Pd/C (D) 1. 1,3-butadiene, heat 2. H2, Pd/C 3. SOC12, pyridine...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 24 seconds ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 50 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago