1)The barometric pressure is reported to be 695.1 torr and the temperature of the water bath is 22.0 °C. What is the pre...
1)The barometric pressure is reported to be 695.1 torr and the temperature of the water bath is 22.0 °C. What is the pressure (in torr) of dry hydrogen gas in the eudiometer?
2)Calculate the experimental value of the ideal gas constant, R, if 0.00148mol of hydrogen had a volume of 45.5mL at 22.8°C and 0.7771atm.
Hint: remember to convert mL to L and °C to K
Hint: Answer includes 3 significant figures.
Homework Answers
Add Answer to:
1)The barometric pressure is reported to be 695.1 torr and the temperature of the water bath is 22.0 °C. What is the pre...
Calculate the experimental value of the ideal gas constant, R, if 0.00148mol of hydrogen had a...
Calculate the experimental value of the ideal gas constant, R, if 0.00148mol of hydrogen had a volume of 44.9mL at 23.0°C and 0.7714atm. Hint: remember to convert mL to L and °C to K Hint: Answer includes 3 significant figures.
QUESTION 3 A student collected a sample of hydrogen gas in a eudiometer over a water...
QUESTION 3 A student collected a sample of hydrogen gas in a eudiometer over a water bath to experimentally determine the value of the gas constant, R. Calculate the experimental value of Rif the pressure of the gas was 0.991 atm, the volume was 36.3 mL the temperature was 292 K and the sample contained 1.54 x 103 moles of gas. QUESTION 4 A student collected a sample of hydrogen gas in a eudiometer over a water bath. The atmospheric...
DATA Trial 1 Trial 2 Mass of Mg ribbon (g) TO SU 0.07839 (Proom) Barometric pressure...
DATA Trial 1 Trial 2 Mass of Mg ribbon (g) TO SU 0.07839 (Proom) Barometric pressure (mmHg) 756 matte 756rrotta | 22.4°C Temperature of water inside beaker (C) 23.0°C 22.8°C Temperature of the room (°C) (T2) Pwater (mm Hg) Vapor pressure of water found in table at the end of the experiment, based on the temperature of water inside the beaker. 5 mm Hg Volume from graduated cylinder (mL) (V2) 60.2mL 82.4mL CALCULATIONS . Write the balanced chemical equation for...
connes 1. Given the following laboratory conditions: barometric pressure = 650 mmHg, temperature of the water...
connes 1. Given the following laboratory conditions: barometric pressure = 650 mmHg, temperature of the water bath = 97.00 °C and the volume of the Erlenmeyer flask = 145.40 ml. O a) Determine the volume of the vapour at STP.
0.0401 2. What is the mass (g) of a piece of magnesium wire that produces 41.4...
0.0401 2. What is the mass (g) of a piece of magnesium wire that produces 41.4 mL of hydrogen gas collected over water at 26.0 °C and at a pressure of 752 torr? NG 2 3. How many moles of hydrogen are present in a 37.5-ml sample at 22.0°C and 714 torr? Assume the hydrogen is dry. |NG| 2 4. You collect a sample of hydrogen gas in an inverted buret by displacement of water at 27.0 °C. The buret...
3. Nitrogen gas was collected in a eudiometer during a chemistry experiment by displacement of water....
3. Nitrogen gas was collected in a eudiometer during a chemistry experiment by displacement of water. When the levels of water inside and outside the eudiometer were adjusted to be the same, the volume of the collected gas was found to be 85.2 mL. The water temperature was 24°C and the barometric (atmospheric) pressure was found to be 764.0 mm Hg. What would be the volume of dry nitrogen gas at STP?
DETERMINATION OF THE MASS OF MAGNESIUM METAL IN A SAMPLE EXPERIMENT 12 PRE-LAB QUESTIONS Fully answer these questio...
DETERMINATION OF THE MASS OF MAGNESIUM METAL IN A SAMPLE EXPERIMENT 12 PRE-LAB QUESTIONS Fully answer these questions in your laboratory notebook before coming to lab. Show all work for numerical calculations. 1. How many moles of hydrogen are present in a 43.50 mL sample at 25.5 °C and 772.8 torr? (assume the hydrogen is dry) 2. What is the mass of a piece of magnesium wire which produces 38.25 mL of hydrogen gas collected over water at 22.0 °C...
A gaseous hydrocarbon collected over water at a temperature of 21 degree C and a barometric...
A gaseous hydrocarbon collected over water at a temperature of 21 degree C and a barometric pressure of 753 torr occupied a volume of 48.1 mL. The hydrocarbon in this volume weighs 0.1133 g. Calculate the molecular mass of the hydrocarbon.
PRE- LAB QUESTIONS NAME: 1. Write a balanced chemical equation for the reaction of aluminum metal...
PRE- LAB QUESTIONS NAME: 1. Write a balanced chemical equation for the reaction of aluminum metal with hydrochloric acid. UAL TI3 3H2 ZAltaHCI od bw 2. Use the equation above to calculate the mass of aluminum that is needed to prepare between mL of hydrogen gas. The laboratory temperature is 22.0°C and the barometric pressure is 760.0 tor. 966 04m570 =0.0227 Pu K AT D.032 24S K 3. Calculate the minimum volume of 6.0 M HCI that you will need...
Barometric Pressure 0.992 atm Mass of Flask + Foil 56 g Mass of Flask + Foil...
Barometric Pressure 0.992 atm Mass of Flask + Foil 56 g Mass of Flask + Foil + Condensed Liquid 59 g Mass of Condensed Liquid 3 g Volume of Flask 300 ml Temperature of Water Bath when Vaporization Begins 333 K Temperature of Water Bath when Water Begins to Boil 363 K Molar Mass 46 g mol Ideal gas law PV=nRT P=pressure V=volume of gas n=number of moles R=gas constant T=temperature Molar volume V=RT/P Density of gas D=PM x RT Molar mass M=(mRT)/(PV) I...
QUESTION 3 A student collected a sample of hydrogen gas in a eudiometer over a water bath to experimentally determine the value of the gas constant, R. Calculate the experimental value of Rif the pressure of the gas was 0.991 atm, the volume was 36.3 mL the temperature was 292 K and the sample contained 1.54 x 103 moles of gas. QUESTION 4 A student collected a sample of hydrogen gas in a eudiometer over a water bath. The atmospheric...
DATA Trial 1 Trial 2 Mass of Mg ribbon (g) TO SU 0.07839 (Proom) Barometric pressure (mmHg) 756 matte 756rrotta | 22.4°C Temperature of water inside beaker (C) 23.0°C 22.8°C Temperature of the room (°C) (T2) Pwater (mm Hg) Vapor pressure of water found in table at the end of the experiment, based on the temperature of water inside the beaker. 5 mm Hg Volume from graduated cylinder (mL) (V2) 60.2mL 82.4mL CALCULATIONS . Write the balanced chemical equation for...
connes 1. Given the following laboratory conditions: barometric pressure = 650 mmHg, temperature of the water bath = 97.00 °C and the volume of the Erlenmeyer flask = 145.40 ml. O a) Determine the volume of the vapour at STP.
0.0401 2. What is the mass (g) of a piece of magnesium wire that produces 41.4 mL of hydrogen gas collected over water at 26.0 °C and at a pressure of 752 torr? NG 2 3. How many moles of hydrogen are present in a 37.5-ml sample at 22.0°C and 714 torr? Assume the hydrogen is dry. |NG| 2 4. You collect a sample of hydrogen gas in an inverted buret by displacement of water at 27.0 °C. The buret...
3. Nitrogen gas was collected in a eudiometer during a chemistry experiment by displacement of water. When the levels of water inside and outside the eudiometer were adjusted to be the same, the volume of the collected gas was found to be 85.2 mL. The water temperature was 24°C and the barometric (atmospheric) pressure was found to be 764.0 mm Hg. What would be the volume of dry nitrogen gas at STP?
DETERMINATION OF THE MASS OF MAGNESIUM METAL IN A SAMPLE EXPERIMENT 12 PRE-LAB QUESTIONS Fully answer these questions in your laboratory notebook before coming to lab. Show all work for numerical calculations. 1. How many moles of hydrogen are present in a 43.50 mL sample at 25.5 °C and 772.8 torr? (assume the hydrogen is dry) 2. What is the mass of a piece of magnesium wire which produces 38.25 mL of hydrogen gas collected over water at 22.0 °C...
A gaseous hydrocarbon collected over water at a temperature of 21 degree C and a barometric pressure of 753 torr occupied a volume of 48.1 mL. The hydrocarbon in this volume weighs 0.1133 g. Calculate the molecular mass of the hydrocarbon.
PRE- LAB QUESTIONS NAME: 1. Write a balanced chemical equation for the reaction of aluminum metal with hydrochloric acid. UAL TI3 3H2 ZAltaHCI od bw 2. Use the equation above to calculate the mass of aluminum that is needed to prepare between mL of hydrogen gas. The laboratory temperature is 22.0°C and the barometric pressure is 760.0 tor. 966 04m570 =0.0227 Pu K AT D.032 24S K 3. Calculate the minimum volume of 6.0 M HCI that you will need...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 40 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago