A
scientist measures the standard enthaply change for
the following reaction to be 80.4kJ
NH4Cl(aq)=NH3(g)+HCl(aq)
Based on this value and the standard enthalpies of formation for
the other substances, the standard enthaply of formation of HCl
(aq)
Homework Answers
Add Answer to:
A scientist measures the standard enthaply change for the following reaction to be 80.4kJ NH4Cl(aq)=NH3(g)+HCl(aq) B...
1. A scientist measures the standard enthalpy change for the following reaction to be -2913.0 kJ:...
1. A scientist measures the standard enthalpy change for the following reaction to be -2913.0 kJ: 2C2H6(g) + 7 O2(g)->4CO2(g) + 6 H2O(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of H2O(g) is kJ/mol. 2. A scientist measures the standard enthalpy change for the following reaction to be -138.6 kJ : H2(g) + C2H4(g)->C2H6(g) Based on this value and the standard enthalpies of formation for the other substances, the...
A scientist measures the standard enthalpy change for the following reaction to be -2847.0 kJ: 2C2H6(g)...
A scientist measures the standard enthalpy change for the following reaction to be -2847.0 kJ: 2C2H6(g) + 7 02(g) —4CO2(g) + 6H2O(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of CzH6(g) is kJ/mol. A scientist measures the standard enthalpy change for the following reaction to be -15.0 kJ : Ca(OH)2(aq) + 2 HCl(aq) +CaCl(s) + 2 H20(1) Based on this value and the standard enthalpies of formation for...
A scientist measures the standard enthalpy change for this reaction to be - 172.0 kJ/mol: HCl(g)...
A scientist measures the standard enthalpy change for this reaction to be - 172.0 kJ/mol: HCl(g) + NH3(g) →NH CH(s) Based on this value and the standard formation enthalpies for the other substances, the standard formation enthalpy of HC (g) is kJ/mol Submit Answer Retry Entire Group 2 more group attempts remaining
A scientist measure the standard enthaply change for the following reaction to be -230.2kJ 2SO2(g) +O2(g)=2SO3(g) Ba...
A scientist measure the standard enthaply change for
the following reaction to be -230.2kJ
2SO2(g) +O2(g)=2SO3(g)
Based on this value and the standard enthalpies of formation for
the other substances, the standard enthaply of formation of SO3(g)
is
A scientist measures the standard enthalpy change for the following reaction to be -230.2 kJ : 250,(9) +0,() >2503(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of SO2(g) is kJ/mol.
A scientist measures the standard enthalpy change for the following reaction to be - 87.7 kJ : 2HBr(g) + Cl...
A scientist measures the standard enthalpy change for the following reaction to be - 87.7 kJ : 2HBr(g) + Cl2(g)— 2HCl(g) + Bra(s) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of HCl(g) is kJ/mol CH4() + H2O(g)_3H2(g) + CO(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of H2O() is kJ/mol Given the standard enthalpy changes for...
A scientist measures the standard enthalpy change for the following reaction to be -87.5 kJ :...
A scientist measures the standard enthalpy change for the following reaction to be -87.5 kJ : 2HBr(g) + Cl2(g)2HCl(g) + Br2(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of HCl(g) is kJ/mol.
Use the References to access important values if needed for this question. A scientist measures the...
Use the References to access important values if needed for this question. A scientist measures the standard enthalpy change for the following reaction to be - 174,0 kJ HC (9) + NH3(g)—NH CH(s) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of NH() is mol deedele Submit Answer Retry Entire Group 2 more group attempts remaining
A scientist measures the standard enthalpy change for the following reaction to be -56.2 kJ :...
A scientist measures the standard enthalpy change for the
following reaction to be -56.2 kJ :
Ca(OH)2(aq) + 2
HCl(aq)CaCl2(s)
+ 2 H2O(l)
Based on this value and the standard enthalpies of formation for
the other substances, the standard enthalpy of formation of
CaCl2(s)
is kJ/mol.
Answer in kJ/mol
A.A scientist measures the standard enthalpy change for the following reaction to be -2932.6 kJ :...
A.A scientist measures the standard enthalpy change for the
following reaction to be -2932.6 kJ :
2C2H6(g)
+ 7 O2(g)4CO2(g)
+ 6 H2O(g)
Based on this value and the standard enthalpies of formation for
the other substances, the standard enthalpy of formation of
CO2(g) is kJ/mol.
B.A scientist measures the standard enthalpy change for the
following reaction to be -138.9 kJ :
H2(g) +
C2H4(g)C2H6(g)
Based on this value and the standard enthalpies of formation for
the other substances, the standard...
References Use the References to access important values if needed for this question. A scientist measures...
References Use the References to access important values if needed for this question. A scientist measures the standard enthalpy change for the following reaction to be -87.1 kJ : 2HBr(g) + Cl2(g)—>2HCl(g) + Br2(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of HCl(g) is kJ/mol. Submit Answer
A scientist measures the standard enthalpy change for the following reaction to be -2847.0 kJ: 2C2H6(g) + 7 02(g) —4CO2(g) + 6H2O(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of CzH6(g) is kJ/mol. A scientist measures the standard enthalpy change for the following reaction to be -15.0 kJ : Ca(OH)2(aq) + 2 HCl(aq) +CaCl(s) + 2 H20(1) Based on this value and the standard enthalpies of formation for...
A scientist measures the standard enthalpy change for this reaction to be - 172.0 kJ/mol: HCl(g) + NH3(g) →NH CH(s) Based on this value and the standard formation enthalpies for the other substances, the standard formation enthalpy of HC (g) is kJ/mol Submit Answer Retry Entire Group 2 more group attempts remaining
A scientist measure the standard enthaply change for
the following reaction to be -230.2kJ
2SO2(g) +O2(g)=2SO3(g)
Based on this value and the standard enthalpies of formation for
the other substances, the standard enthaply of formation of SO3(g)
is
A scientist measures the standard enthalpy change for the following reaction to be -230.2 kJ : 250,(9) +0,() >2503(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of SO2(g) is kJ/mol.
A scientist measures the standard enthalpy change for the following reaction to be - 87.7 kJ : 2HBr(g) + Cl2(g)— 2HCl(g) + Bra(s) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of HCl(g) is kJ/mol CH4() + H2O(g)_3H2(g) + CO(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of H2O() is kJ/mol Given the standard enthalpy changes for...
Use the References to access important values if needed for this question. A scientist measures the standard enthalpy change for the following reaction to be - 174,0 kJ HC (9) + NH3(g)—NH CH(s) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of NH() is mol deedele Submit Answer Retry Entire Group 2 more group attempts remaining
A scientist measures the standard enthalpy change for the
following reaction to be -56.2 kJ :
Ca(OH)2(aq) + 2
HCl(aq)CaCl2(s)
+ 2 H2O(l)
Based on this value and the standard enthalpies of formation for
the other substances, the standard enthalpy of formation of
CaCl2(s)
is kJ/mol.
Answer in kJ/mol
References Use the References to access important values if needed for this question. A scientist measures the standard enthalpy change for the following reaction to be -87.1 kJ : 2HBr(g) + Cl2(g)—>2HCl(g) + Br2(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of HCl(g) is kJ/mol. Submit Answer
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 57 seconds from now -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 48 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago