Homework Answers
Alkylation of alkyne is an example for sn2.
Lindlars catalyst reduces the alkyne into cis Alkene.
mCPBA is an example for epoxidizing agent
Hydroboration oxidation by Anti-markonikoff rule gives less substitited alcohol.
Hydroboration oxidation of terminal alkyne gives Aldehydes.
Add Answer to:
HH HEH HH only this regioisomer Transform each of the given starting materials into the desired products by provi...
Transform each of the given starting materials into the desired products by providing the reagents. You...
Transform each of the given starting materials into the desired products by providing the reagents. You may use any carbon fragment up to FOUR carbons. If it is a multiple step process, you must indicate separation of steps with numbers (eg. 1. 2. 3. etc). Partial points may be given for correct products of intermediate steps. a) н H- H b) H H Me c) H H Me но d) Me H H H.. Me only this regioisomer
5) Devise a synthesis (series of reactions) to transform each starting material into the desired given product usin...
5) Devise a synthesis (series of reactions) to transform each starting material into the desired given product using the starting aromatic source and any reagents necessary. Show all reaction steps and their resulting intermediate products. он
4) Devise a synthesis (series of reactions) to transform each starting material the given product into...
4) Devise a synthesis (series of reactions) to transform each starting material the given product into desired using the starting any necessaryand aromatic source and reagents Show reaction . all steps their resulting intermediate products. Or Or 18 OH 18 O - OAO /10 131
Problem 3 Propose a synthesis of the following molecule from the given starting material. You may...
Problem 3 Propose a synthesis of the following molecule from the given starting material. You may use any reactions we have learned in this course so far, and any reagents containing the carbon atoms you need. If you make a mixture in any of the steps, place a box around the compound you would separate from the mixture, and carry on with your synthesis assuming you can isolate the desired regioisomer. NH2
Please propose a synthesis of the following compounds from the given starting materials. You may use...
Please propose a synthesis of the following compounds from the
given starting materials. You may use any other reagents and/or
additional carbon containing compounds you wish. Multiple steps may
be required.
OO O I H^CH3 NO2 N
Please explain the mechanisms! 1. Propose a synthesis for each of the following problems starting with reagent shown and using any other organic or inorganic reagents allowed in each problem. Mu...
Please explain the mechanisms!
1. Propose a synthesis for each of the following problems starting with reagent shown and using any other organic or inorganic reagents allowed in each problem. Multiple steps are required. The number of steps you use does not matter. Reactions should give the desired product as a major product. For full credit show the product of each step (reaction). If you make use of organometallic reagents such as Grignard, Wittig, organolithium, organosodium, organocopper, etc. you must...
4. (12 pts) For each of the molecules below, provide a retrosynthetic analysis to starting materials...
4. (12 pts) For each of the molecules below, provide a retrosynthetic analysis to starting materials that satisfy the conditions given. Then give a step-by-step synthetic plan. You may use any reagents you want to accomplish your synthesis. HC НОХ H₃C CH весна from propanal as the only carbon source from starting materials containing three or fewer carbon atoms
Show the steps for synthesis of Dimethylamine, labeling each step with the name of the reaction or reaction type and the reagents used. The only starting carbon sources you can use are alkanes with 3...
Show the steps for synthesis of Dimethylamine, labeling each
step with the name of the reaction or reaction type and the
reagents used. The only starting carbon sources you can use are
alkanes with 3 or fewer carbons, CO2, CN-, and CO. Thanks!
3 NI H 3
3 NI H 3
4. (8 points) Devise multi-step syntheses for the following two targets. You must use the given starting materials as t...
4. (8 points) Devise multi-step syntheses for the following two targets. You must use the given starting materials as the only carbon source. You can use any other organic and inorganic reagents. steps a. V OH - starting material target
1. Provide a complete retrosynthesis and forward synthesis of the target molecule below from the given...
1. Provide a complete retrosynthesis and forward synthesis of the target molecule below from the given starting materials. All carbons of the target must be from the given starting materials. You may use any reagents you find necessary. You may include more than one step over a reaction arrow, but please no more than 3 steps at a time. Please show the key intermediates in your synthesis for partial credit. (10 bonus points) For full credit, include a retrosynthetic analysis,...
Transform each of the given starting materials into the desired products by providing the reagents. You may use any carbon fragment up to FOUR carbons. If it is a multiple step process, you must indicate separation of steps with numbers (eg. 1. 2. 3. etc). Partial points may be given for correct products of intermediate steps. a) н H- H b) H H Me c) H H Me но d) Me H H H.. Me only this regioisomer
5) Devise a synthesis (series of reactions) to transform each starting material into the desired given product using the starting aromatic source and any reagents necessary. Show all reaction steps and their resulting intermediate products. он
4) Devise a synthesis (series of reactions) to transform each starting material the given product into desired using the starting any necessaryand aromatic source and reagents Show reaction . all steps their resulting intermediate products. Or Or 18 OH 18 O - OAO /10 131
Problem 3 Propose a synthesis of the following molecule from the given starting material. You may use any reactions we have learned in this course so far, and any reagents containing the carbon atoms you need. If you make a mixture in any of the steps, place a box around the compound you would separate from the mixture, and carry on with your synthesis assuming you can isolate the desired regioisomer. NH2
Please propose a synthesis of the following compounds from the
given starting materials. You may use any other reagents and/or
additional carbon containing compounds you wish. Multiple steps may
be required.
OO O I H^CH3 NO2 N
Please explain the mechanisms!
1. Propose a synthesis for each of the following problems starting with reagent shown and using any other organic or inorganic reagents allowed in each problem. Multiple steps are required. The number of steps you use does not matter. Reactions should give the desired product as a major product. For full credit show the product of each step (reaction). If you make use of organometallic reagents such as Grignard, Wittig, organolithium, organosodium, organocopper, etc. you must...
4. (12 pts) For each of the molecules below, provide a retrosynthetic analysis to starting materials that satisfy the conditions given. Then give a step-by-step synthetic plan. You may use any reagents you want to accomplish your synthesis. HC НОХ H₃C CH весна from propanal as the only carbon source from starting materials containing three or fewer carbon atoms
Show the steps for synthesis of Dimethylamine, labeling each
step with the name of the reaction or reaction type and the
reagents used. The only starting carbon sources you can use are
alkanes with 3 or fewer carbons, CO2, CN-, and CO. Thanks!
3 NI H 3
3 NI H 3
4. (8 points) Devise multi-step syntheses for the following two targets. You must use the given starting materials as the only carbon source. You can use any other organic and inorganic reagents. steps a. V OH - starting material target
1. Provide a complete retrosynthesis and forward synthesis of the target molecule below from the given starting materials. All carbons of the target must be from the given starting materials. You may use any reagents you find necessary. You may include more than one step over a reaction arrow, but please no more than 3 steps at a time. Please show the key intermediates in your synthesis for partial credit. (10 bonus points) For full credit, include a retrosynthetic analysis,...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 2 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 51 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago