Homework Answers
Add Answer to:
1. Precipitation reaction given two reactants containing appropriate cations and anions, predict the product solid...
given equation Mg + 2 HCl —> MgCl2 + H2 If a chemist uses 20g Mg...
given equation Mg + 2 HCl —> MgCl2 + H2 If a chemist uses 20g Mg and excess HCl, what mass of MgCl2 product would form?
Mg + 2 HCl -> MgCl2 + H2. If a chemist uses 20 g Mg and...
Mg + 2 HCl -> MgCl2 + H2. If a chemist uses 20 g Mg and 20 g HCl, what is the limiting reactant? What mass of the excess reactant is leftover when the reaction is complete?
Limiting Reactants, Excess Reactant, and % Yield Name H2+Cl2HCI A gaseous mixture containing 7.5 g of H; gas and 9....
Limiting Reactants, Excess Reactant, and % Yield Name H2+Cl2HCI A gaseous mixture containing 7.5 g of H; gas and 9.00 g of Cl2 gas react to form hydrogen chloride gas. а) Which is the limiting reactant? If all the limiting reactant is consumed, how many grams of HCl are produced? How many grams of excess reactant remain un-reacted? b) c) Cl2+3F22CIF Chlorine reacts with fluorine to form gaseous chlorine trifluoride. You start with 50.0g of chlorine and 95.0g of fluorine....
1. Hydrochloric acid can dissolve solid magnesium according to the reaection below. What minimum magnesium in...
1. Hydrochloric acid can dissolve solid magnesium according to the reaection below. What minimum magnesium in grams can be dissolved by 8.52 g of HCI? (3 pts) Mg(s) + 2 HCl(aq) + MgCl2(aq) + H2(g) 2. Consider the reaction between NiS2 and O2 below. If 24.3 g of NiS2 reacts with 22.6 g of O2, what is the limiting reactant and theoretical yield of NiO? (5 pts) 2 NiSz(s) + 5 O2(g) 2 NiO(s) + 4 SO2(g) 3. The equation...
an experiment only formed 14 g of product (actual yield), thus the percent yield of product for that experiment is...
an experiment only formed 14 g of product (actual yield), thus the percent yield of product for that experiment is 1.4/2.0x100 - 70% % yield actual yield theoretical Wald X 100 You can rearrange this equation to calculate the actual yield if given the % and theoretical yields, or the theoretical yield if given the % and actual yields. Let's Practice: 1. Answer the following questions based on the reaction below (5pts) 2 NaCl + Mg0 Na2O + MgCl2 What...
help with # 7 Data Table: Reactant 1 Identity_NaCO,H,O 124.00 g/mol Mass 1.02 g Reactant 2...
help with # 7
Data Table: Reactant 1 Identity_NaCO,H,O 124.00 g/mol Mass 1.02 g Reactant 2 Identity_MnS0, H,0 169.02 g/mol Mass_1.04 g Observation of chemical reaction. Include observations about color of precipitate! Immediately after adding the two aqueous solutions together a pale pink precipitate formed. 1.49 g Mass of filter paper + precipitate Mass of filter paper Mass of precipitate (actual yield) 0.83 g 0.66 g Analysis: 1. Write the balanced chemical equation for this reaction. 2. Use a solubility...
please solve and show work Equivalent Weight of an Unknown Metal Experimental Set Up DISCUSSION: Consider the balanc...
please solve and show work
Equivalent Weight of an Unknown Metal Experimental Set Up DISCUSSION: Consider the balanced equations for the following reactions of metals with HCl, each written for the production of į mole of H2 (one equivalent of H2) Na + HCI --> NaCl + H2 Ź Mg + HCI -> į MgCl2 + H2 į Al + HCI -> AlCl3 + H2 a. What additional datum would be needed in order to find the atomic mass of...
Predict the product for the following aldol condensation: Use the following reaction equation to answer the...
Predict the product for the following aldol condensation: Use the following reaction equation to answer the questions below; The actual yield for the above experiment was 550 mg. Calculate the theoretical and percent yield. What is the name for this reaction? For full credit, you must show the details of your answer.
Need some help - PCl5 can be produced by the reaction of phosphorus trichloride with excess...
Need some help - PCl5 can be produced by the reaction of phosphorus trichloride with excess chlorine as follows: PCl3 + Cl2 → PCl5 If the actual yield is 127 g of PCl5 and the percent yield is 84.8%, what mass of PCl3 must be used? Hint: Use actual yield and percent yield to find theoretical yield and proceed from there. a. 150 g b. 98.8 g c.108 g d.83.8 g e.71.1 g 2. If the reaction N2 + 3...
Limiting Reactants, Excess Reactant, and % Yield Name H2+Cl2HCI A gaseous mixture containing 7.5 g of H; gas and 9.00 g of Cl2 gas react to form hydrogen chloride gas. а) Which is the limiting reactant? If all the limiting reactant is consumed, how many grams of HCl are produced? How many grams of excess reactant remain un-reacted? b) c) Cl2+3F22CIF Chlorine reacts with fluorine to form gaseous chlorine trifluoride. You start with 50.0g of chlorine and 95.0g of fluorine....
1. Hydrochloric acid can dissolve solid magnesium according to the reaection below. What minimum magnesium in grams can be dissolved by 8.52 g of HCI? (3 pts) Mg(s) + 2 HCl(aq) + MgCl2(aq) + H2(g) 2. Consider the reaction between NiS2 and O2 below. If 24.3 g of NiS2 reacts with 22.6 g of O2, what is the limiting reactant and theoretical yield of NiO? (5 pts) 2 NiSz(s) + 5 O2(g) 2 NiO(s) + 4 SO2(g) 3. The equation...
an experiment only formed 14 g of product (actual yield), thus the percent yield of product for that experiment is 1.4/2.0x100 - 70% % yield actual yield theoretical Wald X 100 You can rearrange this equation to calculate the actual yield if given the % and theoretical yields, or the theoretical yield if given the % and actual yields. Let's Practice: 1. Answer the following questions based on the reaction below (5pts) 2 NaCl + Mg0 Na2O + MgCl2 What...
help with # 7
Data Table: Reactant 1 Identity_NaCO,H,O 124.00 g/mol Mass 1.02 g Reactant 2 Identity_MnS0, H,0 169.02 g/mol Mass_1.04 g Observation of chemical reaction. Include observations about color of precipitate! Immediately after adding the two aqueous solutions together a pale pink precipitate formed. 1.49 g Mass of filter paper + precipitate Mass of filter paper Mass of precipitate (actual yield) 0.83 g 0.66 g Analysis: 1. Write the balanced chemical equation for this reaction. 2. Use a solubility...
please solve and show work
Equivalent Weight of an Unknown Metal Experimental Set Up DISCUSSION: Consider the balanced equations for the following reactions of metals with HCl, each written for the production of į mole of H2 (one equivalent of H2) Na + HCI --> NaCl + H2 Ź Mg + HCI -> į MgCl2 + H2 į Al + HCI -> AlCl3 + H2 a. What additional datum would be needed in order to find the atomic mass of...
Predict the product for the following aldol condensation: Use the following reaction equation to answer the questions below; The actual yield for the above experiment was 550 mg. Calculate the theoretical and percent yield. What is the name for this reaction? For full credit, you must show the details of your answer.
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago