Homework Answers
Add Answer to:
WH83 SU 7. Recognizing functional groups: Circle each functional group and then label each group with...
1. Identify all the functional groups in the following compounds. Circle each functional group and label...
1. Identify all the functional groups in the following
compounds. Circle each functional group and label each group.
Thank you!
1. Identify all the functional groups in the following compounds. Circle each functional group and label each group. Hiç O CH CH CH-C-0-CHCH, -0-CH, CH CH(CH), a. acid group СОН) -CH-CHNHA 0-C-CH Amphetamine (a central nervous system stimulant and abused drug) O Aspirin ( 13 H1802 . . HC=CHCHACHACHCH CHO CHE e. HCCHI (CH OH CHE Citronellal alcohol group ~...
1) Label the acidic functional groups 2) For each acidic site, indicate if it has been...
1) Label the acidic functional groups
2) For each acidic site, indicate if it has been drawn in the
protonated form or not
9/1/16 Name: Worksheet 2 Below is a partial structure of Humic Acid, Circle AND name SEVEN different functional groups on the molecule НООС HOOC сно нс-он COOH --0 он НО. но-сн НО он ( ОН нс-он COOH о HC-OH с=0 o- НО но оноо ОН HN NH
Circle and label all functional groups in Aldosterone and Oxandrolone. Be sure to label any alcohols...
Circle and label all functional groups in Aldosterone and Oxandrolone. Be sure to label any alcohols as primary, secondary, or tertiary. Additionally, label one quaternary carbon in each molecule. OH OH HO Oxandrolone Aldosterone
7. Label all functional groups present within the following molecules. If a higher priority functional group...
7. Label all functional groups present within the following molecules. If a higher priority functional group is comprised of two or more other functional groups, label the higher priority group only. (2 pts each) OH penicillin G 8. Which of the following compounds is/are optically active? Circle your answer. (2 pts each) meso-tartaric acid L-cysteine 1,4-butanediol (R)-2-iodohexane 9. Rank the following in order of increasing acidity. (5 pts) HF CH3NH2 CH3OH HBr CH3CH2CH2CH2CH3
Circle and label the functional groups in the molecules below: Circle and label the functional groups...
Circle and label the functional groups in the molecules below:
Circle and label the functional groups in the molecules below:
Q1. Circle all functional groups (if any) and name them. Put the functional group of the...
Q1. Circle all functional groups (if any) and name them. Put the functional group of the highest priority in the box. That group will determine the name of a compound 02. Name the compounds from above Q3. Practice the amines and amide nomenclature (not discussed in class for the following compounds: Amines NH NH2 Amides: H2N
7. Label all functional groups present within the following molecules. If a higher priority functional group...
7. Label all functional groups present within the following molecules. If a higher priority functional group is comprised of two or more other functional groups, label the higher priority group only. (2 pts each) он penicillin G 8. Which of the following compounds is/are optically active? Circle your answer. (2 pts each) meso-tartaric acid L-cysteine 1,4-butanediol (R)-2-iodohexane 9. Rank the following in order of increasing acidity. (5 pts) СH3NH2 снзон HBr СHЗCH2CH2CH2СH3 HF
answer (3 pts) 4 of 6 7. Label all functional groups present within the following molecules....
answer (3 pts) 4 of 6 7. Label all functional groups present within the following molecules. Ifa higher priority functional group is comprised of two or more other functional groups, label the higher priority group only. (2 pts each) OH penicillin 8. Which of the following compounds is/are optically active? Circle your answer. (2 pts each) meso-tartaric acid L-cysteine 1.4-butanediol (R)-2-iodohexane 9. Rank the following in order of increasing acidity. (5 pts) HF CH3NH2 CH3OH HB CH3CH2CH2CH2CH3
1. For the molecule below a) Circle and label all functional groups. b) Name all intermolecular...
1. For the molecule below a) Circle and label all functional groups. b) Name all intermolecular forces present in the molecule: Amane Aromates hetone lendon dspervon Dipale -Dipole Amine Aromatr 2. For the molecule below a) Box in all atoms that can hydrogen bond with water but not with acetone (CH3OCHS) b) Label all electrophilic carbons (use 6*) NH c) Label the least basic nitrogen. НО d) Label the most acidic hydrogen
1. In each molecule A-F below, circle and name two functional groups/moieties present in the molecule....
1. In each molecule A-F below, circle and name two functional groups/moieties present in the molecule. Select from the list provided. [alcohol, ether, aldehyde, carboxylic acid, ester, amine, amide, propyl, alkyne, alkene - label as cis or trans when applicable, arene (for aromatic group)]. H2N- CH-OH CH2 HO H2CO | 0 NHA H2N IZ HO I- 0 m
1. Identify all the functional groups in the following
compounds. Circle each functional group and label each group.
Thank you!
1. Identify all the functional groups in the following compounds. Circle each functional group and label each group. Hiç O CH CH CH-C-0-CHCH, -0-CH, CH CH(CH), a. acid group СОН) -CH-CHNHA 0-C-CH Amphetamine (a central nervous system stimulant and abused drug) O Aspirin ( 13 H1802 . . HC=CHCHACHACHCH CHO CHE e. HCCHI (CH OH CHE Citronellal alcohol group ~...
1) Label the acidic functional groups
2) For each acidic site, indicate if it has been drawn in the
protonated form or not
9/1/16 Name: Worksheet 2 Below is a partial structure of Humic Acid, Circle AND name SEVEN different functional groups on the molecule НООС HOOC сно нс-он COOH --0 он НО. но-сн НО он ( ОН нс-он COOH о HC-OH с=0 o- НО но оноо ОН HN NH
Circle and label all functional groups in Aldosterone and Oxandrolone. Be sure to label any alcohols as primary, secondary, or tertiary. Additionally, label one quaternary carbon in each molecule. OH OH HO Oxandrolone Aldosterone
7. Label all functional groups present within the following molecules. If a higher priority functional group is comprised of two or more other functional groups, label the higher priority group only. (2 pts each) OH penicillin G 8. Which of the following compounds is/are optically active? Circle your answer. (2 pts each) meso-tartaric acid L-cysteine 1,4-butanediol (R)-2-iodohexane 9. Rank the following in order of increasing acidity. (5 pts) HF CH3NH2 CH3OH HBr CH3CH2CH2CH2CH3
Circle and label the functional groups in the molecules below:
Circle and label the functional groups in the molecules below:
Q1. Circle all functional groups (if any) and name them. Put the functional group of the highest priority in the box. That group will determine the name of a compound 02. Name the compounds from above Q3. Practice the amines and amide nomenclature (not discussed in class for the following compounds: Amines NH NH2 Amides: H2N
7. Label all functional groups present within the following molecules. If a higher priority functional group is comprised of two or more other functional groups, label the higher priority group only. (2 pts each) он penicillin G 8. Which of the following compounds is/are optically active? Circle your answer. (2 pts each) meso-tartaric acid L-cysteine 1,4-butanediol (R)-2-iodohexane 9. Rank the following in order of increasing acidity. (5 pts) СH3NH2 снзон HBr СHЗCH2CH2CH2СH3 HF
answer (3 pts) 4 of 6 7. Label all functional groups present within the following molecules. Ifa higher priority functional group is comprised of two or more other functional groups, label the higher priority group only. (2 pts each) OH penicillin 8. Which of the following compounds is/are optically active? Circle your answer. (2 pts each) meso-tartaric acid L-cysteine 1.4-butanediol (R)-2-iodohexane 9. Rank the following in order of increasing acidity. (5 pts) HF CH3NH2 CH3OH HB CH3CH2CH2CH2CH3
1. For the molecule below a) Circle and label all functional groups. b) Name all intermolecular forces present in the molecule: Amane Aromates hetone lendon dspervon Dipale -Dipole Amine Aromatr 2. For the molecule below a) Box in all atoms that can hydrogen bond with water but not with acetone (CH3OCHS) b) Label all electrophilic carbons (use 6*) NH c) Label the least basic nitrogen. НО d) Label the most acidic hydrogen
1. In each molecule A-F below, circle and name two functional groups/moieties present in the molecule. Select from the list provided. [alcohol, ether, aldehyde, carboxylic acid, ester, amine, amide, propyl, alkyne, alkene - label as cis or trans when applicable, arene (for aromatic group)]. H2N- CH-OH CH2 HO H2CO | 0 NHA H2N IZ HO I- 0 m
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 19 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 50 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago