Homework Answers
Add Answer to:
im confused on molecular, total ionic, and net ionic 3. Ba(OH)2(aq) Ba(OH)2 + H,CO, Iglows bright...
need help on molecular, total ionic, and net ionic 3. BalOH)(aq) grows bright Ba(OH)2 + H2CO,...
need help on molecular, total ionic, and net ionic
3. BalOH)(aq) grows bright Ba(OH)2 + H2CO, Llows bright molecular: Ba(OH)2 (aq) + H, CO3(aq) → BaCO3(s) +2H2O() total ionic: H2CO3(99) + Ba2+ (aq) +20H(aq) → BaCO3(5) + 2 H20 le net ionic: Na, CO3(aq) 4. KNO3(aq) Na,Co, + KNO, 910ws bright I grows bright grows bright Na, CO3(aq) + KNO3(aq) - K, CO3(aq) + NaNO3(aq) molecular: total ionic: net ionic:
still confused on how to do molecular, total ionic, and net ionic. B. Conductivity Testing --Evidence...
still confused on how to do molecular, total ionic, and net
ionic.
B. Conductivity Testing --Evidence of Reaction Substance Observation Conclusion 1. HC,H,O3(aq) doesn't glow NH, H2O(aq) → NHOH dull glow HC, H,02 + NH, H,0 bright glow. molecular: HC,H,O2 (aq) + NH, H20 (aq) →NHC,H,O2 (aq) + H2O(e) total ionic: net ionic: H2SO4 (aq) Ba(OH)2 (aq) H, SO4 + Ba(OH)2 Iglows bright Iglows bright glows bright H2SO4 (aq) + Ba(OH)2 (aq) → BaSO4(s) + H2O() molecular: total ionic: net...
Find the balanced molecular equation, complete ionic equation, and net ionic equation a) Al(NO3)3(aq) + Ba(OH)2(aq)...
Find the balanced molecular equation, complete ionic equation, and net ionic equation a) Al(NO3)3(aq) + Ba(OH)2(aq) b) FeSO4(aq) + KCl(aq)
Write a net ionic equation for the neutralization reaction of H3PO4(aą) with Ba(OH)2(aq). A) 2 H3PO4(aq)...
Write a net ionic equation for the neutralization reaction of H3PO4(aą) with Ba(OH)2(aq). A) 2 H3PO4(aq) + 3 Ba(OH)2(a )--Ba3 (PO4)2(s) + 6 H2O() B) 6H+a)+2 PO43-(aq) +3 Ba2+(ag) + 6 OH-(ag) -+ Ba3(PO4)2)6 H20(1) C) H+(aq) + OH-(aq) → H2O(1) D) 2 H3PO4a)+3 Ba2+a) +6 OH-(a) Ba3(PO42(s)+6H20(0)
16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag)...
16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag) + SO42-(a)- BaSO4) B) 2 H+(aq) SO42-(a) Ba2 (ag) +2 OH-(a)-BaSO4(0 2 H20) C) H2SO4(a) + Ba(OH)2(e) - BaSO40) 2 H20() D) H (ag) OH(ag)--H2O) 16) 17) Write a balanced net ionic equation for the reaction of Pb(NO3)2(ag) with Nal(ag). A) Pb2 (ag)+2 NO3-(4g) +2 Na+ (ag) +2 1-(a4)-- Pb2+(ag)+ 2 1-(a4)+ 2 Na (a) +2 NO3-(a) B) Pb2+(ag) 2 NO3-(a) + 2 Na...
d. CH 206 to (complete combustion) e. C6H12O6 to — (incomplete combustion) Net Ionic equations can be written...
d. CH 206 to (complete combustion) e. C6H12O6 to — (incomplete combustion) Net Ionic equations can be written for double displacement and single displacement reactions. All elements, precipitates, liquids, and lons not appearing on both sides of the equation are shown in a net ionic equation. 14. Write net ionic equations for the following unbalanced equations. a. Na3PO4 (aq) + SrCl2 (aq) → Sr3(PO4)2 (s) + NaCl (aq) b. Bi(NO3)2 (aq) + Na, SO4(aq) → Bi2(SO4)3 (s) + NaNO, (aq)...
aent 6: L B. Testing the conductivity of reactions a OIM KNO, and O. IM Na,CO Species Present Strong, weak or nonel...
aent 6: L B. Testing the conductivity of reactions a OIM KNO, and O. IM Na,CO Species Present Strong, weak or nonelectrolyte Observation No, few, or many lons? Substance ncture is ac on. From can deter has boilir strong hany bright KNO It No Narcos Strong Na CO briont strong MA KNO, +Na:CO; pright Lewis st The valer which at west e resto xcept f Balanced equation: K2CO3 + NA NO Total ionic equation: Net ionic equation: b. 0.1M HC2H2O2...
What is the net ionic equation for the given chemical reaction? 2CH, COOH(aq) + Ba(OH)2(aq) Ba(CH,...
What is the net ionic equation for the given chemical reaction? 2CH, COOH(aq) + Ba(OH)2(aq) Ba(CH, COO),(aq) + 2 H, 0(1) O 2 CH,COO-(aq) + H+ (aq) + Ba2+ (aq) + 2OH(aq) — Ba+ (aq) + 2 CH, COO (aq) + 2 H2O(1) 2H+ (aq) + 2OH(aq) + 2H2O(1) O Ba2+ (aq) + 2OH(aq) Ba²+ (aq) + 2 H2O(1) O 2CH,COOH(aq) + 2OH(aq) 2 CH, COO (aq) + 2H 0(1) O2CH,COO-(aq) + H+ (aq) + 2OH(aq) 2 CH, COO (aq)...
Molecular Total ionic Net ionic: Name of precipitate: Molecular: Total ionic: Net ionic: Name of precipitate:...
Molecular Total ionic Net ionic: Name of precipitate: Molecular: Total ionic: Net ionic: Name of precipitate: Molecular: (NHadroda) + Ba(NO,)2 (aq) → Total ionic Net ionic: Name of precipitate Page 136
For the chemical reaction 2HBr(aq)+Ba(OH)2(aq)⟶2H2O(l)+BaBr2(aq)2HBr(aq)+Ba(OH)2(aq)⟶2H2O(l)+BaBr2(aq) write the net ionic equation, including the phases. net ionic equation:
For the chemical reaction 2HBr(aq)+Ba(OH)2(aq)⟶2H2O(l)+BaBr2(aq)2HBr(aq)+Ba(OH)2(aq)⟶2H2O(l)+BaBr2(aq) write the net ionic equation, including the phases. net ionic equation:
need help on molecular, total ionic, and net ionic
3. BalOH)(aq) grows bright Ba(OH)2 + H2CO, Llows bright molecular: Ba(OH)2 (aq) + H, CO3(aq) → BaCO3(s) +2H2O() total ionic: H2CO3(99) + Ba2+ (aq) +20H(aq) → BaCO3(5) + 2 H20 le net ionic: Na, CO3(aq) 4. KNO3(aq) Na,Co, + KNO, 910ws bright I grows bright grows bright Na, CO3(aq) + KNO3(aq) - K, CO3(aq) + NaNO3(aq) molecular: total ionic: net ionic:
still confused on how to do molecular, total ionic, and net
ionic.
B. Conductivity Testing --Evidence of Reaction Substance Observation Conclusion 1. HC,H,O3(aq) doesn't glow NH, H2O(aq) → NHOH dull glow HC, H,02 + NH, H,0 bright glow. molecular: HC,H,O2 (aq) + NH, H20 (aq) →NHC,H,O2 (aq) + H2O(e) total ionic: net ionic: H2SO4 (aq) Ba(OH)2 (aq) H, SO4 + Ba(OH)2 Iglows bright Iglows bright glows bright H2SO4 (aq) + Ba(OH)2 (aq) → BaSO4(s) + H2O() molecular: total ionic: net...
Write a net ionic equation for the neutralization reaction of H3PO4(aą) with Ba(OH)2(aq). A) 2 H3PO4(aq) + 3 Ba(OH)2(a )--Ba3 (PO4)2(s) + 6 H2O() B) 6H+a)+2 PO43-(aq) +3 Ba2+(ag) + 6 OH-(ag) -+ Ba3(PO4)2)6 H20(1) C) H+(aq) + OH-(aq) → H2O(1) D) 2 H3PO4a)+3 Ba2+a) +6 OH-(a) Ba3(PO42(s)+6H20(0)
16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag) + SO42-(a)- BaSO4) B) 2 H+(aq) SO42-(a) Ba2 (ag) +2 OH-(a)-BaSO4(0 2 H20) C) H2SO4(a) + Ba(OH)2(e) - BaSO40) 2 H20() D) H (ag) OH(ag)--H2O) 16) 17) Write a balanced net ionic equation for the reaction of Pb(NO3)2(ag) with Nal(ag). A) Pb2 (ag)+2 NO3-(4g) +2 Na+ (ag) +2 1-(a4)-- Pb2+(ag)+ 2 1-(a4)+ 2 Na (a) +2 NO3-(a) B) Pb2+(ag) 2 NO3-(a) + 2 Na...
d. CH 206 to (complete combustion) e. C6H12O6 to — (incomplete combustion) Net Ionic equations can be written for double displacement and single displacement reactions. All elements, precipitates, liquids, and lons not appearing on both sides of the equation are shown in a net ionic equation. 14. Write net ionic equations for the following unbalanced equations. a. Na3PO4 (aq) + SrCl2 (aq) → Sr3(PO4)2 (s) + NaCl (aq) b. Bi(NO3)2 (aq) + Na, SO4(aq) → Bi2(SO4)3 (s) + NaNO, (aq)...
aent 6: L B. Testing the conductivity of reactions a OIM KNO, and O. IM Na,CO Species Present Strong, weak or nonelectrolyte Observation No, few, or many lons? Substance ncture is ac on. From can deter has boilir strong hany bright KNO It No Narcos Strong Na CO briont strong MA KNO, +Na:CO; pright Lewis st The valer which at west e resto xcept f Balanced equation: K2CO3 + NA NO Total ionic equation: Net ionic equation: b. 0.1M HC2H2O2...
What is the net ionic equation for the given chemical reaction? 2CH, COOH(aq) + Ba(OH)2(aq) Ba(CH, COO),(aq) + 2 H, 0(1) O 2 CH,COO-(aq) + H+ (aq) + Ba2+ (aq) + 2OH(aq) — Ba+ (aq) + 2 CH, COO (aq) + 2 H2O(1) 2H+ (aq) + 2OH(aq) + 2H2O(1) O Ba2+ (aq) + 2OH(aq) Ba²+ (aq) + 2 H2O(1) O 2CH,COOH(aq) + 2OH(aq) 2 CH, COO (aq) + 2H 0(1) O2CH,COO-(aq) + H+ (aq) + 2OH(aq) 2 CH, COO (aq)...
Molecular Total ionic Net ionic: Name of precipitate: Molecular: Total ionic: Net ionic: Name of precipitate: Molecular: (NHadroda) + Ba(NO,)2 (aq) → Total ionic Net ionic: Name of precipitate Page 136
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 minutes ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 25 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago