Homework Answers
Add Answer to:
1. a) Draw the structure of an enol of this compound. If no enol is possible,...
Question 19 2.5 pts Order the following compounds from most acidic to least acidic. دهد تا...
Question 19 2.5 pts Order the following compounds from most acidic to least acidic. دهد تا با 2 >1 >4 > 3 @ 1 > 4>2 > 3 1 >2>4> 2 > 3 * Previous Next → Question 20 2.5 pts What is required to complete the synthesis? H30+ Reactant 1. NaOE 2. bromoethane 1. NaOE 2. 1-brom malonic ester acetoacetic ester 2 ethyl methyl ketone pentane-2,4-dione Question 22 2.5 pts Which compound below has the most acidic proton(s)? H2CO...
1. Predict the products of the following reactions (18 points, 3 each) Catalytic KOH methanol/water solvent...
1. Predict the products of the following reactions (18 points, 3 each) Catalytic KOH methanol/water solvent Catalytic KOH methanol/water solvent Catalytic KOH methanol water solvent Catalye KOH. 1 equivalent NaOCH.CH ethanol solvent I equivalent NaOCH.CH ethanol solvent 2. Write the product of the following reaction and the full mechanism by which it is formed. Clearly show which steps are reversible and which one step is irreversible. (8 points). 1 equivalent NaOCH CH3 cthanol solvent + excess 3. Circle the most...
show stepwise how you would prepare the following compounds from the provided starting material and any...
show stepwise how you would prepare the following compounds
from the provided starting material and any other organic or
inorganic compound.
in order to have full credit you mush show all the reactions
conditions and the structure of your oroducts in each
transformation
(30 points) Show stepwise how would you prepare the following compounds from the provided starting material and any other organic or inorganic compound. In order to have full credit you must show all the reaction conditions and...
HW 22: Enolates 1. Provide a detailed, stepwise mechanism for the base-catalyzed enolization (keto enol tautomerism) of acetaldehyde. 2. Provide the major organic product of the folowing reactio...
HW 22: Enolates 1. Provide a detailed, stepwise mechanism for the base-catalyzed enolization (keto enol tautomerism) of acetaldehyde. 2. Provide the major organic product of the folowing reaction. 3. Provide the major organic product of the following reaction LDA 4. Which of the following ketones will give a positive iodoform test? A) 4-heptanone D) cyclohexanone B) 3-hexanone C)2-hexanone 5. Provide the major organic product of the following reaction. 6. Provide the structure of the major organic product which results when...
1. Write the structural formula of each of the following co (1) m-chlorobenzoyl chloride; (b) p-ethylbenzamide:...
1. Write the structural formula of each of the following co (1) m-chlorobenzoyl chloride; (b) p-ethylbenzamide: (©) (e) 2-ethyl-1-butanamine; (f) dibenzylamine; (g) a B-lacta the following compounds: (28 pts) Pethylben (s) acetoacetic ester; (d) diethyl malonate: of each of the following reactions: (30 pts) 2. Identify the principal organic product of each of the (a) acetic anhydride and 2-pentanol (b) 4-methyl-3-penten-2-one and ammonia in water solut er solution (c) acetophenone (methyl phenyi ketone) and benzalder (d) methyl butanoate and LDA...
Carboxylic Acids and Esters EXPERIMENT 22 OBSERVATIONS AND RESULTS Synthesis and Identification of an Ester: Esterification...
Carboxylic Acids and Esters EXPERIMENT 22 OBSERVATIONS AND RESULTS Synthesis and Identification of an Ester: Esterification 1. Give the name and structure of the ester which you synthesized. What fruit did you associate with the odor of the ester? to noldsoinogs w to esar bnn eaman sd vio stolpi Look up the ester and its fruit sburce in your textbook. (If it is not in your textbook, ask your instructor.) Did you associate the ester with the right fruit? If...
COLLOQUIUM Nel I. Define in the structure of alanine (2-aminopropanoic acid) a. the hybridization type of...
COLLOQUIUM Nel I. Define in the structure of alanine (2-aminopropanoic acid) a. the hybridization type of carbon atoms and hetero b. the type of conjugation and show the electronic structure of the conjugated systems by atoms (pyridine and pyrrole type) overlapping of non hybrid p-orbitals. Designate electron's movement with curved arrowS 2. Write two chair conformations for trans-cyclohexanediol-1,3. Indicate the most stable 3. Classification of organic reactions according to the result and the mechanism. The types of 4. Compare reactivity...
**(left structure)****(right structure)** The two structures for the assignment are above and the task is: 1....
**(left structure)****(right
structure)**
The two structures for the assignment are above and
the task is:
1. Perform a retrosynthetic analysis on the two target
molecules assigned to you. In each case the organic
starting material (what you have to work backwards toward) depends
upon the target. For the structure given above (structure on left),
the starting material is either malonic ester or acetoacetic ester
and any halide. For the structure given above (structure on right),
the starting material is any...
Post-Lab Questions 1. Formic acid (methanoic acid) is completely soluble in water, Draw the struct acid...
Post-Lab Questions 1. Formic acid (methanoic acid) is completely soluble in water, Draw the struct acid is completely soluble in water. Draw the structures showing what happens when formic acid is added to water. Name the product. 2. Formic acid can be neutralized with NaOH. Draw the structures for the neutralization reaction. Name the product. 3. Hexanoic acid has an unpleasant odor, like the smell of goats. If you accidentally spilled some hexanoic acid on your hands, how could you...
Identify the compound with the higher boiling point in each of the following pairs of compounds:...
Identify the compound with the higher boiling point in each of the following pairs of compounds: 1. CH2-CH2-OH or H--C--0--CHz OH 2. CHz---0-CH3 or CH3-CH-CH2-CH3 0 2, CH, -- pH 3. CHz--2-0-CH, or CH3-CH2-CH2-CH2-CH3 Write the products of hydrolysis or saponification for the following esters. н" 1. CH3-CH-CH2--0--0--CH3 + H2O O 2, CH4-C-0-CH + NaOH 3. O -8-6-CH2-CH; -CH ---CH3 + KOH — -0--CH-CH2-CH3 + H20 - Properties of Esters sters shave higher boiling points than alkanes but lower than...
Question 19 2.5 pts Order the following compounds from most acidic to least acidic. دهد تا با 2 >1 >4 > 3 @ 1 > 4>2 > 3 1 >2>4> 2 > 3 * Previous Next → Question 20 2.5 pts What is required to complete the synthesis? H30+ Reactant 1. NaOE 2. bromoethane 1. NaOE 2. 1-brom malonic ester acetoacetic ester 2 ethyl methyl ketone pentane-2,4-dione Question 22 2.5 pts Which compound below has the most acidic proton(s)? H2CO...
1. Predict the products of the following reactions (18 points, 3 each) Catalytic KOH methanol/water solvent Catalytic KOH methanol/water solvent Catalytic KOH methanol water solvent Catalye KOH. 1 equivalent NaOCH.CH ethanol solvent I equivalent NaOCH.CH ethanol solvent 2. Write the product of the following reaction and the full mechanism by which it is formed. Clearly show which steps are reversible and which one step is irreversible. (8 points). 1 equivalent NaOCH CH3 cthanol solvent + excess 3. Circle the most...
show stepwise how you would prepare the following compounds
from the provided starting material and any other organic or
inorganic compound.
in order to have full credit you mush show all the reactions
conditions and the structure of your oroducts in each
transformation
(30 points) Show stepwise how would you prepare the following compounds from the provided starting material and any other organic or inorganic compound. In order to have full credit you must show all the reaction conditions and...
HW 22: Enolates 1. Provide a detailed, stepwise mechanism for the base-catalyzed enolization (keto enol tautomerism) of acetaldehyde. 2. Provide the major organic product of the folowing reaction. 3. Provide the major organic product of the following reaction LDA 4. Which of the following ketones will give a positive iodoform test? A) 4-heptanone D) cyclohexanone B) 3-hexanone C)2-hexanone 5. Provide the major organic product of the following reaction. 6. Provide the structure of the major organic product which results when...
1. Write the structural formula of each of the following co (1) m-chlorobenzoyl chloride; (b) p-ethylbenzamide: (©) (e) 2-ethyl-1-butanamine; (f) dibenzylamine; (g) a B-lacta the following compounds: (28 pts) Pethylben (s) acetoacetic ester; (d) diethyl malonate: of each of the following reactions: (30 pts) 2. Identify the principal organic product of each of the (a) acetic anhydride and 2-pentanol (b) 4-methyl-3-penten-2-one and ammonia in water solut er solution (c) acetophenone (methyl phenyi ketone) and benzalder (d) methyl butanoate and LDA...
Carboxylic Acids and Esters EXPERIMENT 22 OBSERVATIONS AND RESULTS Synthesis and Identification of an Ester: Esterification 1. Give the name and structure of the ester which you synthesized. What fruit did you associate with the odor of the ester? to noldsoinogs w to esar bnn eaman sd vio stolpi Look up the ester and its fruit sburce in your textbook. (If it is not in your textbook, ask your instructor.) Did you associate the ester with the right fruit? If...
COLLOQUIUM Nel I. Define in the structure of alanine (2-aminopropanoic acid) a. the hybridization type of carbon atoms and hetero b. the type of conjugation and show the electronic structure of the conjugated systems by atoms (pyridine and pyrrole type) overlapping of non hybrid p-orbitals. Designate electron's movement with curved arrowS 2. Write two chair conformations for trans-cyclohexanediol-1,3. Indicate the most stable 3. Classification of organic reactions according to the result and the mechanism. The types of 4. Compare reactivity...
**(left structure)****(right
structure)**
The two structures for the assignment are above and
the task is:
1. Perform a retrosynthetic analysis on the two target
molecules assigned to you. In each case the organic
starting material (what you have to work backwards toward) depends
upon the target. For the structure given above (structure on left),
the starting material is either malonic ester or acetoacetic ester
and any halide. For the structure given above (structure on right),
the starting material is any...
Post-Lab Questions 1. Formic acid (methanoic acid) is completely soluble in water, Draw the struct acid is completely soluble in water. Draw the structures showing what happens when formic acid is added to water. Name the product. 2. Formic acid can be neutralized with NaOH. Draw the structures for the neutralization reaction. Name the product. 3. Hexanoic acid has an unpleasant odor, like the smell of goats. If you accidentally spilled some hexanoic acid on your hands, how could you...
Identify the compound with the higher boiling point in each of the following pairs of compounds: 1. CH2-CH2-OH or H--C--0--CHz OH 2. CHz---0-CH3 or CH3-CH-CH2-CH3 0 2, CH, -- pH 3. CHz--2-0-CH, or CH3-CH2-CH2-CH2-CH3 Write the products of hydrolysis or saponification for the following esters. н" 1. CH3-CH-CH2--0--0--CH3 + H2O O 2, CH4-C-0-CH + NaOH 3. O -8-6-CH2-CH; -CH ---CH3 + KOH — -0--CH-CH2-CH3 + H20 - Properties of Esters sters shave higher boiling points than alkanes but lower than...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 43 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago