Homework Answers
Add Answer to:
3. Identify the alkyl halide product that forms when KI react with the following substance in...
1. Select the best reagent(s) from the list below to accomplish the following transformations. In some...
1. Select the best reagent(s) from the list below to accomplish the following transformations. In some cases, more than one reagent may be required. 3. HSO3(aq) A.HCI B. Br? C. Hg(OAc)/H20 D. BH3 E. H30*/Hz0 E. Hz02 G. Os04 H. Brz/Hz0 NaBH4 J. H2O, in aq NaOH Reagent(s)? NaHSO3 Product CH3 Starting Material сн. Н.c = — сна BR — Br Br CH₂ На сна нс сна HC нас нас н сну нас НАС СНА оfo/Acal НО н а )...
please answer for me all questions 1-20 1) Identify the alkyl halide that reacts the fastest...
please answer for me all questions 1-20
1) Identify the alkyl halide that reacts the fastest in a Sn2 reaction. A) chloromethane B) 2-chloro-2-methylpropane C) 2-chlorobutane D) 1-chlorobutane 2) Identify the alkyl halide that reacts the fastest in an SN 2 reaction. A) 1-bromopropane B) 1-fluoropropane C) 1-chloropropane D) 1-iodopropane 3) Which of the following alkyl halides gives the slowest SN2 reaction? A) CH3CH2C1 B) Ci CH3CCH2CH3 CH3 C) CH3CHCH2CH3 CH2 CH3CHCHCH3 C1 СН3 4) Which of the following alkyl...
() 1. Which of the following alkyl holides would you expect to be most reactive in a unimolecular reaction? CH3 a)...
() 1. Which of the following alkyl holides would you expect to be most reactive in a unimolecular reaction? CH3 a) CsM , CH, CH, CH, Br b) CEHCH CH BY c) CH, CCH, Br d) CH, CH2 CH CHE сн. он сня Br e) CHICCHE CH3 (4). 2. What would you expect to be the chief organic product(s) when tert-butyl bromide reacts with sodium acetylide, i.e.. CH + - CH3-C-Br + Na CECH ? CH a) 1 b) II...
1. Rank the alkyl halides in each group in order of increasing E2 reactivity. a. Br...
1. Rank the alkyl halides in each group in order of increasing E2 reactivity. a. Br Br Br I П III b. Cн, Br Нас CI CH3 П III Rank the alkyl halides in each group of problem one in order of increasing El reactivity. 2. Which elimination reaction in each pair is faster? (I or II) 3. а. сн, Нас. Он Он II. b. HO DMSO он (CH),CCI (CH),CCI П. I. Н.о What alkenes are formed from each alkyl...
predict the major organic product formed in the following reaction alkyl halide nucleophile CH, e) H...
predict the major organic product formed in the following
reaction
alkyl halide nucleophile CH, e) H Br KOBu" HOBu Br Н CH Br CH,CH,OH two products formed 8 + CHI h) Br NaOCH H
1. For the following Alkyl halide indicate which position will react under SN1 reaction conditions and...
1. For the following Alkyl halide indicate which position will react under SN1 reaction conditions and under SN2 reaction conditions. Explain your answer. mer 2. Draw the complete mechanism and the products for of the following SN1 reaction paying close attention to stereochemistry. H3C CI CH OH CH2CH3 општироотип солио 3. Provide the product/s for the following reactions. Indicate if the reactions proceed via an SN1, or SN2 mechanism. Indicate proper stereochemistry if it is applicable. Show the mechanisms NaCN...
CH3 (4) 1. Which of the following alkyl halides would you expect to be most reactive...
CH3 (4) 1. Which of the following alkyl halides would you expect to be most reactive in a unimolecular reaction? a) C&H, CH, CH, CH, BY b) CH 1 CH CH Br C) CH11CCH, Br d) C6H CH2 CH CHỊ CHỊ CH3 CHỊ e) C&H, CCH Br CHE (4) 2. What would you expect to be the chief organic product(s) when tert-butyl bromide reacts with sodium acetylide, i.e., CH3 + - CH2-C-Br + Na :CECH — ? CH a) I...
What is the major product of the following reaction? Hy(excess) Lindlar's cat. A B D Ос...
What is the major product of the following reaction? Hy(excess) Lindlar's cat. A B D Ос B A D What is the major product of the following reaction? Cl2 Н,0 НО СІ. A \ Он С В с D CI CI ОН ОН Ов ОА D с What is the major product of the following reaction? CH3 нс Н сH,CH, NaNH2 DMSO Br А В CH3 CHCH3 9 CH3 с CH,CH H4C. D нс CH2CH3 CH3 "NH, нс Сн HECH...
alexis Naming Hydrocarbons Compatibility Mode Review View Help Mailings References Layout 1 I 2 3 Naming...
alexis Naming Hydrocarbons Compatibility Mode Review View Help Mailings References Layout 1 I 2 3 Naming Worksheet - Hydrocarbons Name: Name of compound H,с- CH CH сH, 1 CH2 CH3 Нас Сн CH 2. Нас нас Methylcyclohexane 3. CHз I Br 4. Hас-нс -сн>-CH-CH, Н.с -сн CH3 -CHз 5. Н.с — сн — с CH3 H3C-CH-CHECH-CH2 CH3 6 но 7. Нс с сн 8 DFocus он DELL O co 6 1 Нас - CH2 CH3 C-CH3 CH3 H3C-CH2-CHECH-CH2 CH3 5....
pleas help 5,6,7,8,9,10 III IV 5. The product of free-radical halogenation reactions is an alkyl halide....
pleas help 5,6,7,8,9,10
III IV 5. The product of free-radical halogenation reactions is an alkyl halide. The major amount of this halide forms during the second step of propagation. However, you should be aware that one possible termination step also forms alkyl halides. Why does the majority of the alkyl halide product come from the propagation step and not the termination step? A. At any given time during the reaction, the concentration of both the alkyl radical and the halide...
1. Select the best reagent(s) from the list below to accomplish the following transformations. In some cases, more than one reagent may be required. 3. HSO3(aq) A.HCI B. Br? C. Hg(OAc)/H20 D. BH3 E. H30*/Hz0 E. Hz02 G. Os04 H. Brz/Hz0 NaBH4 J. H2O, in aq NaOH Reagent(s)? NaHSO3 Product CH3 Starting Material сн. Н.c = — сна BR — Br Br CH₂ На сна нс сна HC нас нас н сну нас НАС СНА оfo/Acal НО н а )...
please answer for me all questions 1-20
1) Identify the alkyl halide that reacts the fastest in a Sn2 reaction. A) chloromethane B) 2-chloro-2-methylpropane C) 2-chlorobutane D) 1-chlorobutane 2) Identify the alkyl halide that reacts the fastest in an SN 2 reaction. A) 1-bromopropane B) 1-fluoropropane C) 1-chloropropane D) 1-iodopropane 3) Which of the following alkyl halides gives the slowest SN2 reaction? A) CH3CH2C1 B) Ci CH3CCH2CH3 CH3 C) CH3CHCH2CH3 CH2 CH3CHCHCH3 C1 СН3 4) Which of the following alkyl...
() 1. Which of the following alkyl holides would you expect to be most reactive in a unimolecular reaction? CH3 a) CsM , CH, CH, CH, Br b) CEHCH CH BY c) CH, CCH, Br d) CH, CH2 CH CHE сн. он сня Br e) CHICCHE CH3 (4). 2. What would you expect to be the chief organic product(s) when tert-butyl bromide reacts with sodium acetylide, i.e.. CH + - CH3-C-Br + Na CECH ? CH a) 1 b) II...
1. Rank the alkyl halides in each group in order of increasing E2 reactivity. a. Br Br Br I П III b. Cн, Br Нас CI CH3 П III Rank the alkyl halides in each group of problem one in order of increasing El reactivity. 2. Which elimination reaction in each pair is faster? (I or II) 3. а. сн, Нас. Он Он II. b. HO DMSO он (CH),CCI (CH),CCI П. I. Н.о What alkenes are formed from each alkyl...
predict the major organic product formed in the following
reaction
alkyl halide nucleophile CH, e) H Br KOBu" HOBu Br Н CH Br CH,CH,OH two products formed 8 + CHI h) Br NaOCH H
1. For the following Alkyl halide indicate which position will react under SN1 reaction conditions and under SN2 reaction conditions. Explain your answer. mer 2. Draw the complete mechanism and the products for of the following SN1 reaction paying close attention to stereochemistry. H3C CI CH OH CH2CH3 општироотип солио 3. Provide the product/s for the following reactions. Indicate if the reactions proceed via an SN1, or SN2 mechanism. Indicate proper stereochemistry if it is applicable. Show the mechanisms NaCN...
CH3 (4) 1. Which of the following alkyl halides would you expect to be most reactive in a unimolecular reaction? a) C&H, CH, CH, CH, BY b) CH 1 CH CH Br C) CH11CCH, Br d) C6H CH2 CH CHỊ CHỊ CH3 CHỊ e) C&H, CCH Br CHE (4) 2. What would you expect to be the chief organic product(s) when tert-butyl bromide reacts with sodium acetylide, i.e., CH3 + - CH2-C-Br + Na :CECH — ? CH a) I...
What is the major product of the following reaction? Hy(excess) Lindlar's cat. A B D Ос B A D What is the major product of the following reaction? Cl2 Н,0 НО СІ. A \ Он С В с D CI CI ОН ОН Ов ОА D с What is the major product of the following reaction? CH3 нс Н сH,CH, NaNH2 DMSO Br А В CH3 CHCH3 9 CH3 с CH,CH H4C. D нс CH2CH3 CH3 "NH, нс Сн HECH...
alexis Naming Hydrocarbons Compatibility Mode Review View Help Mailings References Layout 1 I 2 3 Naming Worksheet - Hydrocarbons Name: Name of compound H,с- CH CH сH, 1 CH2 CH3 Нас Сн CH 2. Нас нас Methylcyclohexane 3. CHз I Br 4. Hас-нс -сн>-CH-CH, Н.с -сн CH3 -CHз 5. Н.с — сн — с CH3 H3C-CH-CHECH-CH2 CH3 6 но 7. Нс с сн 8 DFocus он DELL O co 6 1 Нас - CH2 CH3 C-CH3 CH3 H3C-CH2-CHECH-CH2 CH3 5....
pleas help 5,6,7,8,9,10
III IV 5. The product of free-radical halogenation reactions is an alkyl halide. The major amount of this halide forms during the second step of propagation. However, you should be aware that one possible termination step also forms alkyl halides. Why does the majority of the alkyl halide product come from the propagation step and not the termination step? A. At any given time during the reaction, the concentration of both the alkyl radical and the halide...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 43 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago