Homework Answers
Add Answer to:
complete the following reactions with the proper
stereochemistry as need
оCHbb H2SO4 (dilute) OH H2O HBr...
1. Provide the Major Product from the following reactions CrO3, H2S04 Acetone HBr Me OH OH...
1. Provide the Major Product from the following reactions CrO3, H2S04 Acetone HBr Me OH OH Tsci, Pyr, NaH он Br 2. Provide Reagents for each Letter in the REDOX Ladder See list of Reagents OH on Back OH PCC DIBAL-H (Diisobutylaluminum Hydride) DMSO, COCh then Et:N Swern Oxidation NaBH4 Sodium Borohydride) H2SO4, CrO Jones Oxidation LiAIH4 Lithium Aluminum Hydride KMnO4 NaOCI HNO3 NaOCI/TEMPC DMP (Dess-Martin Periodinane) H2CrO4 A. B. C. D. E. F.
1. Give the missing reagents, reactants or products for each of the following reactions. KOC(CH3)2 (E2)...
1. Give the missing reagents, reactants or products for each of the following reactions. KOC(CH3)2 (E2) 1. BH3 2. H2O2, NaOH, H2O PCC HBr/ROOR how many stereoisomers? PCC ad Excess H, H CH2Cl2 OT_HBr SN2 give one stereoisomer SN2 NaCN ACN (solvent) KMnO4 H2SO4 NaOEt (E2) mCPBA H2SO4 (cat) don't worry about this reaction ОН PCC CH2Cl2 NaOEt (E2) mCPBA H2SO4 (cat) don't worry about this reaction OH PCC CH2Cl2 HI (SN1)
Predict the products, if any, of the following reactions. COOH (1) LiAlH (2) H2O* (b) CH...
Predict the products, if any, of the following reactions. COOH (1) LiAlH (2) H2O* (b) CH B (1) NaCN (2) 40*, heat (1) SOCI2 (a) oct-4-ino KMnO4 H20 (warm , conc.) (2) AICI COOH Ph 10 O Na,Cr,O, H,SO4 BH CH,OHN_C6:0, 14,50. CHCH.–CH-COOH BH, CH,OH (1) CH,CH, -CH-COOH CH,OH KMnO4, H2O (warm, conc.) KMnO,H,O (hot , conc.)
Practice: Write the products for the following reactions. Propene Cyclohexene HBr | CH 3 CH Br...
Practice: Write the products for the following reactions. Propene Cyclohexene HBr | CH 3 CH Br CH₂ Hert Cl2, CH2Cl2 NBS, H2O, DMSO Cl2, CH3OH 1) Hg(OAc)2, H2O/THF 2) NaBH 1) BHz in THF 2) H2O2, OH-
Which of the below reaction sequences will complete the transformation given? OH NH2 Ph1 PhV2 03...
Which of the below reaction sequences will complete the transformation given? OH NH2 Ph1 PhV2 03 NaCN 1. LiAIH4 DMS HCN 2. H2O MCPBA NaN3 H2 Pt (111) 1. Oso PCC NH3, H2SO4 (cat.) 2. NaHSO3 NaBH3CN H2O (A) I, II only (B) I, III only (C) I only Question 14 An unknown compound exhibits the following is in the NMR spectrum 1.34ppm 3 405 om 2 7.17 om det 787 pom p om inget they the own compound (A)...
1. Give the major product of the following reactions, write N.R. if no reaction happens. Indicate...
1. Give the major product of the following reactions, write N.R. if no reaction happens. Indicate the stereochemistry if necessary: i 1. NaBH, MOH 2. H, H2O 3. conc. H2SO4, heat 1. LiAlH4, THE 2. H, H2O 3. MSCI, Pyr, 0 °C 1. SOCI, EIN -D 2. LAIH, ether 1. Li, hexane 2. i . THE 3. acidic work-up Jone's reagent ОН OH 1. PBT 2. NaCN, THE PH conc. H2SO4 NaCl 0°C conc. HBO OH heat
1. Give the missing reagents, reactants or products for each of the following reactions. KOC(CH ....
1. Give the missing reagents, reactants or products for each of the following reactions. KOC(CH . (E2) 1.BH 2. H2O NaOH, HÔ PCC HB/ROOR how many stereoisomers? how many stereoisomers? PCC Excess H2O H CH2C12 HB Nal SN2 give one stereoisomer SN2 NaCN ACN (solvent) KMnO4 HO H2SO mCPBA NaOEt (E2) H2SO4 (cat) don't worry about this reaction OH OH KMnO4 H2SO4 NaOEt (E2) mCPBA H2SO4 (cat) don't worry about this reaction OH Рcc CH2C12 HI (SN1)
Hi I need help predicting the products for these reactions OEt NaOCH.CH CH,CH OH b. H,...
Hi I need help predicting the products for these
reactions
OEt NaOCH.CH CH,CH OH b. H, O/H,0 a. NaOCH.CH CH,CH,OH b. Br c. NaOHH O, beat d. H2O*/H2O 1. NaCN, DMSO 2. CH,MgBr, Eto 3. H.O/H,O EN 2. NaH, CH,Br chemoselective 1. a. NaOet, EtOH Br b. 2. a. NaOH/H,O, heat b. H30+/H20 CY.NECEN cy OH b. then add HC-NH2 a. NaCN, DMSO b. HO*/H,0
Provide the major product(s) for the following reactions: Show Stereochemistry when necessary (10 points total) Br...
Provide the major product(s) for the following reactions: Show Stereochemistry when necessary (10 points total) Br HBr CH2CI Br2 HBr Но ROOR CH,OH Н,о н* Н,о° 1) Hg(O,CCF3)2 CH,OH 1) BН, THF 2) H,О, NaOH, Нао 2) NaBH, NaOH 1) Hg(OAc) Н0, THF/ Hа Pd/C 2) NaBH, NaOH
4. Complete the following reactions, providing the proper stereochemistry where required. If more than one product...
4. Complete the following reactions, providing the proper stereochemistry where required. If more than one product is possible, indicate the major product. a) Bry CH Но b) 1) ВН THF CH3 2) Н,О, NaOH Hа сн, Pd сн, d) Нer ROOR e) RCO H 1) Hg(OAch, H2O 2) NaBH З/19
1. Provide the Major Product from the following reactions CrO3, H2S04 Acetone HBr Me OH OH Tsci, Pyr, NaH он Br 2. Provide Reagents for each Letter in the REDOX Ladder See list of Reagents OH on Back OH PCC DIBAL-H (Diisobutylaluminum Hydride) DMSO, COCh then Et:N Swern Oxidation NaBH4 Sodium Borohydride) H2SO4, CrO Jones Oxidation LiAIH4 Lithium Aluminum Hydride KMnO4 NaOCI HNO3 NaOCI/TEMPC DMP (Dess-Martin Periodinane) H2CrO4 A. B. C. D. E. F.
1. Give the missing reagents, reactants or products for each of the following reactions. KOC(CH3)2 (E2) 1. BH3 2. H2O2, NaOH, H2O PCC HBr/ROOR how many stereoisomers? PCC ad Excess H, H CH2Cl2 OT_HBr SN2 give one stereoisomer SN2 NaCN ACN (solvent) KMnO4 H2SO4 NaOEt (E2) mCPBA H2SO4 (cat) don't worry about this reaction ОН PCC CH2Cl2 NaOEt (E2) mCPBA H2SO4 (cat) don't worry about this reaction OH PCC CH2Cl2 HI (SN1)
Predict the products, if any, of the following reactions. COOH (1) LiAlH (2) H2O* (b) CH B (1) NaCN (2) 40*, heat (1) SOCI2 (a) oct-4-ino KMnO4 H20 (warm , conc.) (2) AICI COOH Ph 10 O Na,Cr,O, H,SO4 BH CH,OHN_C6:0, 14,50. CHCH.–CH-COOH BH, CH,OH (1) CH,CH, -CH-COOH CH,OH KMnO4, H2O (warm, conc.) KMnO,H,O (hot , conc.)
Practice: Write the products for the following reactions. Propene Cyclohexene HBr | CH 3 CH Br CH₂ Hert Cl2, CH2Cl2 NBS, H2O, DMSO Cl2, CH3OH 1) Hg(OAc)2, H2O/THF 2) NaBH 1) BHz in THF 2) H2O2, OH-
Which of the below reaction sequences will complete the transformation given? OH NH2 Ph1 PhV2 03 NaCN 1. LiAIH4 DMS HCN 2. H2O MCPBA NaN3 H2 Pt (111) 1. Oso PCC NH3, H2SO4 (cat.) 2. NaHSO3 NaBH3CN H2O (A) I, II only (B) I, III only (C) I only Question 14 An unknown compound exhibits the following is in the NMR spectrum 1.34ppm 3 405 om 2 7.17 om det 787 pom p om inget they the own compound (A)...
1. Give the major product of the following reactions, write N.R. if no reaction happens. Indicate the stereochemistry if necessary: i 1. NaBH, MOH 2. H, H2O 3. conc. H2SO4, heat 1. LiAlH4, THE 2. H, H2O 3. MSCI, Pyr, 0 °C 1. SOCI, EIN -D 2. LAIH, ether 1. Li, hexane 2. i . THE 3. acidic work-up Jone's reagent ОН OH 1. PBT 2. NaCN, THE PH conc. H2SO4 NaCl 0°C conc. HBO OH heat
1. Give the missing reagents, reactants or products for each of the following reactions. KOC(CH . (E2) 1.BH 2. H2O NaOH, HÔ PCC HB/ROOR how many stereoisomers? how many stereoisomers? PCC Excess H2O H CH2C12 HB Nal SN2 give one stereoisomer SN2 NaCN ACN (solvent) KMnO4 HO H2SO mCPBA NaOEt (E2) H2SO4 (cat) don't worry about this reaction OH OH KMnO4 H2SO4 NaOEt (E2) mCPBA H2SO4 (cat) don't worry about this reaction OH Рcc CH2C12 HI (SN1)
Hi I need help predicting the products for these
reactions
OEt NaOCH.CH CH,CH OH b. H, O/H,0 a. NaOCH.CH CH,CH,OH b. Br c. NaOHH O, beat d. H2O*/H2O 1. NaCN, DMSO 2. CH,MgBr, Eto 3. H.O/H,O EN 2. NaH, CH,Br chemoselective 1. a. NaOet, EtOH Br b. 2. a. NaOH/H,O, heat b. H30+/H20 CY.NECEN cy OH b. then add HC-NH2 a. NaCN, DMSO b. HO*/H,0
Provide the major product(s) for the following reactions: Show Stereochemistry when necessary (10 points total) Br HBr CH2CI Br2 HBr Но ROOR CH,OH Н,о н* Н,о° 1) Hg(O,CCF3)2 CH,OH 1) BН, THF 2) H,О, NaOH, Нао 2) NaBH, NaOH 1) Hg(OAc) Н0, THF/ Hа Pd/C 2) NaBH, NaOH
4. Complete the following reactions, providing the proper stereochemistry where required. If more than one product is possible, indicate the major product. a) Bry CH Но b) 1) ВН THF CH3 2) Н,О, NaOH Hа сн, Pd сн, d) Нer ROOR e) RCO H 1) Hg(OAch, H2O 2) NaBH З/19
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 11 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 42 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago