Homework Answers
Applications of alkenes.
Add Answer to:
coton (h) (h) HI H4 KOH Et, ale, a I (CHI) 1.3 ACETONE 2. ZnO (the...
Give the structure of the major organic product, reactant, or catalyst in each incomplete equation. (e...
Give the structure of the major organic product, reactant, or
catalyst in each incomplete equation.
(e to i) please thanks!
CHE R ethylcyclohexane HCl Naoh CH,OH, Et, Y CH14) (an isomer of Y) Hg (0Ac), Nabtle H2SO4 (8) "3,3-dimethyl-1-butene 44. THE KOH ale, a НІ Et, o (h) 1.3 ACETONE 2.2nº (the only product!) (HOA) (an isomer of D I (C6H12) NaHSO4 + ACETONE 1. Ha (Ach, ng 2. NaBHA, THE II (C8H14) 1. O 2.Z, HOA (an isomer of...
REACTION UPPURIUNITI Give the structure of the MAJOR organic product, reactant, or catalyst in each incomplete...
REACTION UPPURIUNITI Give the structure of the MAJOR organic product, reactant, or catalyst in each incomplete equation. (a)-3-methyl-1-butene grond Na BH HT OH CH3 HCI ethylcyclohexane E,O Каон CH,CH, A (an isomer of Y) ВАМ 3,3-dimethyl-1-butene KOH ale, a L. O 2. Zn ACETONE (the only product!) (an isomer of D) CHOAC) I (CH2) Lhe Dach 2. NaBihy, THF NGASOL + ACETONE Y 2.2,HOA (an isomer of II) I (CH her, b - exco, T o Abbreviations: HO - peroxides,...
REAC Give the structure of the MAJOR arganic product , reactant, or cataiyst in each incomplete...
REAC Give the structure of the MAJOR arganic product , reactant, or cataiyst in each incomplete equation. Mа Pод THE (a) -3-methyl-1-butene glGAch Na B Кон HI сHон, а (b) H2SO4 (вн THF Hао OH, 4 (c) НВ- Bre X Etzo x-CaHsBr (d) "isobutene a4 CHs CH3 Br Br Br Ha NaOH HCI ethylcyclohexane Et2O Y (CsH14 (an isomer of Y) 3,3-dimethyl-1-butene" HglOAc) Na 6i 04 МЕСI THF oton 1 HI (h) Кон ale, A LO3 EtO 1 (CaH12) H-...
a.) H H_Cro acetone b.) 1. XS KMnO,/KOH/HOIA 2.H30* c.) ni XS NaBH,, H,0 H OH...
a.) H H_Cro acetone b.) 1. XS KMnO,/KOH/HOIA 2.H30* c.) ni XS NaBH,, H,0 H OH d.) o 1. XS LAIH/THF/-78 °C 2. H20 H OH e.) NaNH / lig NH3 f.) Br 1. Mg/THE 2. CO2 3. H30 9.) Ph Ph cyclopropene HF CH h.) OH 1. PCCICH.CH 2. Pri 3. N,Cag) 1. LITHF 2.CO 3. NH.Ca) HNO, NH 1. HNO () 2. NaSCH CH.CH AICI, 3-chloro-2-methylpentane m.) 1.Pr.CI. AICI 2. NBS, CCH n.) OH XS H.COM acetone OH...
Give the structure of the major organic product, reactant, or
catalyst in each incomplete equation.
(e to i) please thanks!
CHE R ethylcyclohexane HCl Naoh CH,OH, Et, Y CH14) (an isomer of Y) Hg (0Ac), Nabtle H2SO4 (8) "3,3-dimethyl-1-butene 44. THE KOH ale, a НІ Et, o (h) 1.3 ACETONE 2.2nº (the only product!) (HOA) (an isomer of D I (C6H12) NaHSO4 + ACETONE 1. Ha (Ach, ng 2. NaBHA, THE II (C8H14) 1. O 2.Z, HOA (an isomer of...
REACTION UPPURIUNITI Give the structure of the MAJOR organic product, reactant, or catalyst in each incomplete equation. (a)-3-methyl-1-butene grond Na BH HT OH CH3 HCI ethylcyclohexane E,O Каон CH,CH, A (an isomer of Y) ВАМ 3,3-dimethyl-1-butene KOH ale, a L. O 2. Zn ACETONE (the only product!) (an isomer of D) CHOAC) I (CH2) Lhe Dach 2. NaBihy, THF NGASOL + ACETONE Y 2.2,HOA (an isomer of II) I (CH her, b - exco, T o Abbreviations: HO - peroxides,...
REAC Give the structure of the MAJOR arganic product , reactant, or cataiyst in each incomplete equation. Mа Pод THE (a) -3-methyl-1-butene glGAch Na B Кон HI сHон, а (b) H2SO4 (вн THF Hао OH, 4 (c) НВ- Bre X Etzo x-CaHsBr (d) "isobutene a4 CHs CH3 Br Br Br Ha NaOH HCI ethylcyclohexane Et2O Y (CsH14 (an isomer of Y) 3,3-dimethyl-1-butene" HglOAc) Na 6i 04 МЕСI THF oton 1 HI (h) Кон ale, A LO3 EtO 1 (CaH12) H-...
a.) H H_Cro acetone b.) 1. XS KMnO,/KOH/HOIA 2.H30* c.) ni XS NaBH,, H,0 H OH d.) o 1. XS LAIH/THF/-78 °C 2. H20 H OH e.) NaNH / lig NH3 f.) Br 1. Mg/THE 2. CO2 3. H30 9.) Ph Ph cyclopropene HF CH h.) OH 1. PCCICH.CH 2. Pri 3. N,Cag) 1. LITHF 2.CO 3. NH.Ca) HNO, NH 1. HNO () 2. NaSCH CH.CH AICI, 3-chloro-2-methylpentane m.) 1.Pr.CI. AICI 2. NBS, CCH n.) OH XS H.COM acetone OH...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 57 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago