Homework Answers
Add Answer to:
6. Describe a method for how you would identify the components of your mixture using GC....
4. The compounds in a mixture separated by GC can be identified by their retention times....
4. The compounds in a mixture separated by GC can be identified by their retention times. If you Suructor nad not told you which peak in the GC chromatogram corresponded to which alker you didn't know the boiling points of the alkenes, how could you determine the identity or each peak by its retention time? Identities of the components in a mixture separated by GC can also be determined by the technique called "spiking". Suppose you had run a chromatogram...
Briefly explain how you would perform a quantitative analysis of the components of a mixture of...
Briefly explain how you would perform a quantitative analysis of the components of a mixture of ethanol, n-propanol, and iso-propanol using HPLC. Begin with the preparation of standard solutions. Explain how you would use the HPLC chromatogram to both identify the molecules and quantify the amount of each alcohol in the mixture. You don’t have to provide volume or concentration numbers or other technical experimental details. Provide a description of the general approach. Be complete and concise.
3. Compare your GC and TLC analysis of the reaction mixture, which method provides more accurate...
3. Compare your GC and TLC analysis of the reaction mixture, which method provides more accurate information about the reaction composition?
In a chromatography experiment, how do you identify the components of an unknown mixture? Select one:...
In a chromatography experiment, how do you identify the components of an unknown mixture? Select one: Combine the mixture with multiple known compounds and look for the largest spots. Compare the Rf values of the mixture components to the Rf values of pure known compounds. Combine the mixture with a series of known compounds and observe the color of the dots. Compare the color of the mixture spots to the colors of pure known compounds.
(d) Describe the strategy you would use to solve the general BVP 4 pts using the shooting method....
Could anyone please help me?
Thank you very much.
(d) Describe the strategy you would use to solve the general BVP 4 pts using the shooting method. Describe the functions you need to write, what you need to guess, and how you can check the validity of your solution
(d) Describe the strategy you would use to solve the general BVP 4 pts using the shooting method. Describe the functions you need to write, what you need to guess, and...
1.84 Mixtures can always be separated by physical means. Describe how you would separate the components...
1.84 Mixtures can always be separated by physical means. Describe how you would separate the components in a mixture of table salt and sand.
How would your initial answer for Sau3A change if you knew that the average GC content of the human genome was 35%? Express your answer using three significant figures. fragments Submit Previous Answ...
How would your initial answer for Sau3A change if you knew that the average GC content of the human genome was 35%? Express your answer using three significant figures. fragments Submit Previous Answers Request Answer X Incorrect: Try Again; 4 attempts remaining Part F How would your initial answer for BamHI change if you knew that the average GC content of the human genome was 35%? Express your answer using three significant figures. fragments
How would your initial answer for...
Explain the various factors responsible for separation of components of a mixture in chromatography. Explain about...
Explain the various factors responsible for separation of components of a mixture in chromatography. Explain about the classification of chromatography with few examples. Draw a block diagram of gas chromatograph and explain the function of each component Write a note on the micro syringe use to inject the liquid sample into gas chromatograph. Write a note on principle of working of Gas chromatograph. (How to prepare GC for analysis) Write a note on analysis of chromatogram (Types the method of...
NEED ANSWER WITHIN 6 HOURS a) In quantitative PCR, what detection method would you use to...
NEED ANSWER WITHIN 6 HOURS
a) In quantitative PCR, what detection method would you use to quantify the threshold concentration, ct of a specific gene in a mixture. Describe the fluorescent probe that would be used and the mechanism that generates a fluorescent signal that is proportional to the number of copies in the PCR reaction. b) Describe how you could use this approach to quantify the relative concentrations of multiple, different genes in a complex mixture, using qPCR. c)...
Table 2: Alcohol and Ketone Standards GC Retention Times GC#: Retention time Alcohol Standard Mixture Phent...
Table 2: Alcohol and Ketone Standards GC Retention Times GC#: Retention time Alcohol Standard Mixture Phent ion= 2.05Smin low Peak 1 Compound Name: athanol Rapesnal utanal aclapeatanal 4.755min oilng 6.895min .230 min Peak 2 Compound Name: Peak 3 Compound Name: Peak 4 Compound Name: GC#:1 Ketone Standard Mixture Retention time 2.575un Peak 1 Compound Name: Acclono Butanon a Pentanone 2tHex anon Peak 2 Compound Name: min Peak 3 Compound Name: 615 min 1D. 307 min Peak 4 Compound Name: Part...
4. The compounds in a mixture separated by GC can be identified by their retention times. If you Suructor nad not told you which peak in the GC chromatogram corresponded to which alker you didn't know the boiling points of the alkenes, how could you determine the identity or each peak by its retention time? Identities of the components in a mixture separated by GC can also be determined by the technique called "spiking". Suppose you had run a chromatogram...
3. Compare your GC and TLC analysis of the reaction mixture, which method provides more accurate information about the reaction composition?
Could anyone please help me?
Thank you very much.
(d) Describe the strategy you would use to solve the general BVP 4 pts using the shooting method. Describe the functions you need to write, what you need to guess, and how you can check the validity of your solution
(d) Describe the strategy you would use to solve the general BVP 4 pts using the shooting method. Describe the functions you need to write, what you need to guess, and...
1.84 Mixtures can always be separated by physical means. Describe how you would separate the components in a mixture of table salt and sand.
How would your initial answer for Sau3A change if you knew that the average GC content of the human genome was 35%? Express your answer using three significant figures. fragments Submit Previous Answers Request Answer X Incorrect: Try Again; 4 attempts remaining Part F How would your initial answer for BamHI change if you knew that the average GC content of the human genome was 35%? Express your answer using three significant figures. fragments
How would your initial answer for...
NEED ANSWER WITHIN 6 HOURS
a) In quantitative PCR, what detection method would you use to quantify the threshold concentration, ct of a specific gene in a mixture. Describe the fluorescent probe that would be used and the mechanism that generates a fluorescent signal that is proportional to the number of copies in the PCR reaction. b) Describe how you could use this approach to quantify the relative concentrations of multiple, different genes in a complex mixture, using qPCR. c)...
Table 2: Alcohol and Ketone Standards GC Retention Times GC#: Retention time Alcohol Standard Mixture Phent ion= 2.05Smin low Peak 1 Compound Name: athanol Rapesnal utanal aclapeatanal 4.755min oilng 6.895min .230 min Peak 2 Compound Name: Peak 3 Compound Name: Peak 4 Compound Name: GC#:1 Ketone Standard Mixture Retention time 2.575un Peak 1 Compound Name: Acclono Butanon a Pentanone 2tHex anon Peak 2 Compound Name: min Peak 3 Compound Name: 615 min 1D. 307 min Peak 4 Compound Name: Part...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 53 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago