Homework Answers
Add Answer to:
2) Consider the mixed aldol condensation reaction of 1-(1-methyleyclopentyl ethanone (shown in question 1) and propiophenone...
la) Consider the mixed aldol condensation reaction of 1-methylcyclopentane-1-carbaldehyde (shown below) and 3,3-dimethyl-2-butanone (shown below) in...
la) Consider the mixed aldol condensation reaction of 1-methylcyclopentane-1-carbaldehyde (shown below) and 3,3-dimethyl-2-butanone (shown below) in the presence of sodium hydroxide Provide the expected major MIXED aldol condensation product for this reaction (can exist as E or Z isomer so you can draw either) b) Would you have to heat the reaction mixture in order for the reaction to form the aldol condensation product? Why or wh y not? 2) Consider the mixed aldol condensation reaction of 3,3-dimethyl-2-butanone (shown in...
Which of the following statements about the Aldol reaction is correct. Select all that apply. The...
Which of the following statements about the Aldol reaction is correct. Select all that apply. The aldol condensation reaction requires only a catalytic amount of base to form the a, -unsaturated carbonyl product In an Aldol reaction, the enolate is the electrophile that reacts with a neutral carbonyl nucleophile. Reacting 1 equivalent of LDA (lithium diisopropylamide) with 3-pentanone, the enolate will be formed quantitatively. Two equivalents of a ketone can be reacted with NaOH to form a B-hydroxycarbonyl product. Aldol...
1. The aldol condensation reaction belongs to a group of reactions characterized by formation of an...
1. The aldol condensation reaction belongs to a group of reactions characterized by formation of an enolate. For each of the following aldehydes or ketones, draw the enolate ion that forms when treated with a strong base such as sodium hydroxide. If an enolate cannot form, put NR (no reaction). 2. The first step in the aldol addition of acetaldehyde is an acid base reaction (proton transfer). pka = 16 pka = 15 OH a. The pk, for each acid...
QUESTION 1 Which of the following will not undergo an aldol condensation reaction? butanal C 2-methylbutanal...
QUESTION 1 Which of the following will not undergo an aldol condensation reaction? butanal C 2-methylbutanal C 2,2-dimethylbutanal 3,3-dimethyl-2-butanone QUESTION 2 Which of the following constitutes a difference between an aldol and a Claisen condensation? basic conditions Ctetrahedral intermediate Cenolate ion formation protonation of the intermediate QUESTION 3 The product of an aldol condensation reaction is generally favored if Can unsymmetrical ketone and aldehyde are used Can unsymmetrical ester and ketone are used Cone of the carbonyl partners contains no...
How to solve question 2 to question 5. 2. Why does the mixed aldol condensation, producing...
How to solve question 2 to question 5.
2. Why does the mixed aldol condensation, producing benzalacetophenone is the main reaction in this experiment and NOT both other possible reactions; acetophenone condensation and Cannizzaro benzaladehyde reaction? 3. Propose a reason to explain the statement that the trans-benzalacctophenone isomer is the major product in aldol condensation 4, Explain why the main product from the bromine addition to the trans-acetophenone is crythro-dibromide 5. Write a mechanism for the addition of aniline to...
D Question 6 5p Compound 6, below is the product of which reaction: A mixed Aldol...
D Question 6 5p Compound 6, below is the product of which reaction: A mixed Aldol reaction between benzaldehyde and acetone O Amixed Aldol condensation between cyclohexanone and formaldehyde A mixed Aldol reaction between cyclohexanone and acetaldehyde A mixed Aldol condensation between cycloheptanone and formaldehyde
Determine the theoretical and percent yield for this lab Wednerdouy 13 CH 4521-8: Crossed Aldol Condensation:...
Determine the theoretical and percent yield for this lab
Wednerdouy 13 CH 4521-8: Crossed Aldol Condensation: Synthesls of trans-p-anisalacetophenone Ketones that contain an a-hydrogen (a hydrogen on the C right next door to the carbonyl group) can be tabilized via keto-enol tautomerization, or through the loss of the a-hydrogen to form an enolate anion. enolate anion Enolate ions actas nudbophiles and are considerable more reactive than tois. The enolate on i the subject of today's experiment. The formation of an...
1. Draw a mechanism for the following Aldol condensation reaction under basic conditions, including the formation...
1. Draw a mechanism for the following Aldol condensation reaction under basic conditions, including the formation of the enolate. Please include ALL lone pair electrons, formal charges, and stereo/regiochemistry whenever applicable. 1) LDA, H2O 2) LAH 2. Draw a mechanism for the following Dieckmann reaction under basic conditions, including the formation of the enolate. Please include ALL lone pair electrons, formal charges, and stereo/regiochemistry whenever applicable. 1) NaOEt 2) Hзо* OEt 3. Draw a mechanism for the following alkylation reaction...
Exercise 23-1: Aldol Condensation Outcomes: After completing this activity, you should be able to Provide products...
Exercise 23-1: Aldol Condensation Outcomes: After completing this activity, you should be able to Provide products and mechanisms for aldol and mixed aldol reactions and condensations. Exercise I: Spartan 11.12 Llor) -a 1. Examine atomic charges and display the electrostatic potential map for 2,7-octanedione. Which hydrogens are most likely to be abstracted by a base? Explain your reasoning, 2. Record the energies (Click-Properties-Energy) of the enolates a and b. a: -457.6520 a.u. b: -457.6425 a.u. 3. Which enolate is more...
la) Consider the mixed aldol condensation reaction of 1-methylcyclopentane-1-carbaldehyde (shown below) and 3,3-dimethyl-2-butanone (shown below) in the presence of sodium hydroxide Provide the expected major MIXED aldol condensation product for this reaction (can exist as E or Z isomer so you can draw either) b) Would you have to heat the reaction mixture in order for the reaction to form the aldol condensation product? Why or wh y not? 2) Consider the mixed aldol condensation reaction of 3,3-dimethyl-2-butanone (shown in...
Which of the following statements about the Aldol reaction is correct. Select all that apply. The aldol condensation reaction requires only a catalytic amount of base to form the a, -unsaturated carbonyl product In an Aldol reaction, the enolate is the electrophile that reacts with a neutral carbonyl nucleophile. Reacting 1 equivalent of LDA (lithium diisopropylamide) with 3-pentanone, the enolate will be formed quantitatively. Two equivalents of a ketone can be reacted with NaOH to form a B-hydroxycarbonyl product. Aldol...
1. The aldol condensation reaction belongs to a group of reactions characterized by formation of an enolate. For each of the following aldehydes or ketones, draw the enolate ion that forms when treated with a strong base such as sodium hydroxide. If an enolate cannot form, put NR (no reaction). 2. The first step in the aldol addition of acetaldehyde is an acid base reaction (proton transfer). pka = 16 pka = 15 OH a. The pk, for each acid...
QUESTION 1 Which of the following will not undergo an aldol condensation reaction? butanal C 2-methylbutanal C 2,2-dimethylbutanal 3,3-dimethyl-2-butanone QUESTION 2 Which of the following constitutes a difference between an aldol and a Claisen condensation? basic conditions Ctetrahedral intermediate Cenolate ion formation protonation of the intermediate QUESTION 3 The product of an aldol condensation reaction is generally favored if Can unsymmetrical ketone and aldehyde are used Can unsymmetrical ester and ketone are used Cone of the carbonyl partners contains no...
How to solve question 2 to question 5.
2. Why does the mixed aldol condensation, producing benzalacetophenone is the main reaction in this experiment and NOT both other possible reactions; acetophenone condensation and Cannizzaro benzaladehyde reaction? 3. Propose a reason to explain the statement that the trans-benzalacctophenone isomer is the major product in aldol condensation 4, Explain why the main product from the bromine addition to the trans-acetophenone is crythro-dibromide 5. Write a mechanism for the addition of aniline to...
D Question 6 5p Compound 6, below is the product of which reaction: A mixed Aldol reaction between benzaldehyde and acetone O Amixed Aldol condensation between cyclohexanone and formaldehyde A mixed Aldol reaction between cyclohexanone and acetaldehyde A mixed Aldol condensation between cycloheptanone and formaldehyde
Determine the theoretical and percent yield for this lab
Wednerdouy 13 CH 4521-8: Crossed Aldol Condensation: Synthesls of trans-p-anisalacetophenone Ketones that contain an a-hydrogen (a hydrogen on the C right next door to the carbonyl group) can be tabilized via keto-enol tautomerization, or through the loss of the a-hydrogen to form an enolate anion. enolate anion Enolate ions actas nudbophiles and are considerable more reactive than tois. The enolate on i the subject of today's experiment. The formation of an...
1. Draw a mechanism for the following Aldol condensation reaction under basic conditions, including the formation of the enolate. Please include ALL lone pair electrons, formal charges, and stereo/regiochemistry whenever applicable. 1) LDA, H2O 2) LAH 2. Draw a mechanism for the following Dieckmann reaction under basic conditions, including the formation of the enolate. Please include ALL lone pair electrons, formal charges, and stereo/regiochemistry whenever applicable. 1) NaOEt 2) Hзо* OEt 3. Draw a mechanism for the following alkylation reaction...
Exercise 23-1: Aldol Condensation Outcomes: After completing this activity, you should be able to Provide products and mechanisms for aldol and mixed aldol reactions and condensations. Exercise I: Spartan 11.12 Llor) -a 1. Examine atomic charges and display the electrostatic potential map for 2,7-octanedione. Which hydrogens are most likely to be abstracted by a base? Explain your reasoning, 2. Record the energies (Click-Properties-Energy) of the enolates a and b. a: -457.6520 a.u. b: -457.6425 a.u. 3. Which enolate is more...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 37 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago