Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
soap making lab organic chem 2
Post Lab Questions 1. What is an emulsion? Which mixture...
If you did not collect any data or are missing some data to complete this post-lab,...
If you did not collect any data or are missing some data to complete this post-lab, then give your source of data here and give a brief explanation why you have missing data. If you use your own data you can go straight to question 1, no need to add anything here. Calcium chloride was added to the water in the "testing" experiments to simulate hard water. What was the effect of adding the calcium ions to the ability of...
lab report on the preparation of soap (Saponification) 1. Write the reaction for the saponification of...
lab report on the preparation of soap
(Saponification)
1. Write the reaction for the saponification of glyceryl tripalmitate with sodium 2. 3. 4. hydroxide. Why is the product of saponification called a salt? Why was ethanol added to the reaction mixture of fat and base? Do you think the solid soap that you made contains glycerol? Why or why not? Explain. 5. Describe the appearance of your soap. 6. Explain how soaps emulsify oils and fats. 7. Explain why soaps...
Lab 12: Saponification – Making Soap Objective: To make soap using the process call saponification, an...
Lab 12: Saponification – Making Soap Objective: To make soap using the process call saponification, an organic form of the neutralization reaction that an acid reacts with a base to form a salt. Introduction: A soap is the sodium or potassium salt of a long chained carbohydrate called a fatty acid. A fatty acid usually contains between 12 – 18 carbon atoms. Fatty acids are esters of either animal or vegetable fats. They are called triglycerides if they are solids at room...
Post Lab Questions Fermentation: 1. What physical property enables one to use distillation for the separation...
Post Lab Questions Fermentation: 1. What physical property enables one to use distillation for the separation of ethyl alcohol enriched from the water mixture? 2 What is an Azeotrope? Explain how can azeotropes be used to purify mixtures? 3. Azeotropes are also defined as liquid mixtures having a vapor pressure at constant temperature, as a function of composition. Explain with your own words why vapor pressure depends on the composition of the mixture. 4 If the distillation temperature is different...
what are the products of acid hydrolysis of glycertrioleate? Additional Lab questions 1. What are the...
what are the products of acid hydrolysis of
glycertrioleate?
Additional Lab questions 1. What are the products of acid hydrolysis of glyceryltrioleate. Give structures and names. (8 pts) 2. The "salting out process is used commercially. Using this process, what product is separated from soap? (4 pts) 3. Review from CHEM 1151: Write a balance equation for the reaction of CaCl2 with sodium acetate (NaCH:COO). (6 pts) 4. If necessary, using your answer from the previous question as a guide,...
(1 pts) . PUSL HD Questions 8. TA signature POST LAB QUESTIONS: 1. What major alkene...
(1 pts) . PUSL HD Questions 8. TA signature POST LAB QUESTIONS: 1. What major alkene product is produced by dehydrating the following alcohols? a. Cyclohexanol b. 1-Methylcyclohexanol c. 4-Methylcyclohexanol d. 3,3-Dimethylcyclohexanol 2. What is the purpose of the calcium chloride in this experiment? 3. There are three possible isomers when dehydrating 2-methylcyclohexanol. Which do you expect to be the major product and can IR be used to determine which one you have? 4. In this experiment, 1.0 mL of...
What would be my percent yield if i retrieved 3.1020 grams of soap? thank you, please show all work.
what would be my percent yield if i retrieved 3.1020 grams of
soap? thank you, please show all work.
SAPONIFICATION (HYDROLYSIS OF A FAD Fats and edible oils consitute a special class of esters called riglycerides in which alcohol part of the molecule, the trihydroxy compound glycerol, forms with three molecules of various long-chain carboxylic acids (called fatty acids). Ty reactions of simple esters can also be carried out on fats and oils,i acid-or-base-catalyzed hydrolysis. three ester linkages carboxylic acids...
I need helppp with my AP chem lab
Purpose: To calculate the amount of AgNO3 present in an unknown solution of water through the process of gravimetric analysis with NaCl. Background: Have you ever had difficulty lathering soap or find that the scum in your shower constantly needs to be removed? These are signs of “hard water.” Soap does not lather well in hard water because metal ions, such as Ca2+, form precipitates, creating “soap scum.” A precipitate is an insoluble compound that forms when soluble ions in...
Experiment Properties of Solutions 112/ Roll No. Name: Section:__ Date: Post-lab Questions 1. Did you observe...
Experiment Properties of Solutions 112/ Roll No. Name: Section:__ Date: Post-lab Questions 1. Did you observe a difference in conductivity of deionized water and tap water. If yes, explain why there is a difference 2. What was the conductivity of solid sodium chloride? What was the conductivity of the mixture when water was added to the salt? Explain your observations 3. Indicate whether solutions of each of the following contain (a) only ions, (b) only molecules, or (c) mostly molecules...
If you did not collect any data or are missing some data to complete this post-lab, then give your source of data here and give a brief explanation why you have missing data. If you use your own data you can go straight to question 1, no need to add anything here. Calcium chloride was added to the water in the "testing" experiments to simulate hard water. What was the effect of adding the calcium ions to the ability of...
lab report on the preparation of soap
(Saponification)
1. Write the reaction for the saponification of glyceryl tripalmitate with sodium 2. 3. 4. hydroxide. Why is the product of saponification called a salt? Why was ethanol added to the reaction mixture of fat and base? Do you think the solid soap that you made contains glycerol? Why or why not? Explain. 5. Describe the appearance of your soap. 6. Explain how soaps emulsify oils and fats. 7. Explain why soaps...
what are the products of acid hydrolysis of
glycertrioleate?
Additional Lab questions 1. What are the products of acid hydrolysis of glyceryltrioleate. Give structures and names. (8 pts) 2. The "salting out process is used commercially. Using this process, what product is separated from soap? (4 pts) 3. Review from CHEM 1151: Write a balance equation for the reaction of CaCl2 with sodium acetate (NaCH:COO). (6 pts) 4. If necessary, using your answer from the previous question as a guide,...
(1 pts) . PUSL HD Questions 8. TA signature POST LAB QUESTIONS: 1. What major alkene product is produced by dehydrating the following alcohols? a. Cyclohexanol b. 1-Methylcyclohexanol c. 4-Methylcyclohexanol d. 3,3-Dimethylcyclohexanol 2. What is the purpose of the calcium chloride in this experiment? 3. There are three possible isomers when dehydrating 2-methylcyclohexanol. Which do you expect to be the major product and can IR be used to determine which one you have? 4. In this experiment, 1.0 mL of...
what would be my percent yield if i retrieved 3.1020 grams of
soap? thank you, please show all work.
SAPONIFICATION (HYDROLYSIS OF A FAD Fats and edible oils consitute a special class of esters called riglycerides in which alcohol part of the molecule, the trihydroxy compound glycerol, forms with three molecules of various long-chain carboxylic acids (called fatty acids). Ty reactions of simple esters can also be carried out on fats and oils,i acid-or-base-catalyzed hydrolysis. three ester linkages carboxylic acids...
Experiment Properties of Solutions 112/ Roll No. Name: Section:__ Date: Post-lab Questions 1. Did you observe a difference in conductivity of deionized water and tap water. If yes, explain why there is a difference 2. What was the conductivity of solid sodium chloride? What was the conductivity of the mixture when water was added to the salt? Explain your observations 3. Indicate whether solutions of each of the following contain (a) only ions, (b) only molecules, or (c) mostly molecules...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 36 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago