Estimate the \DeltaΔH° for the combustion of one mole of hexane in kJ at 25°C using the table of bond energies provided below.
C6H14(l) + 19/2O2(g) --------------> 6CO2(g) + 7H2O(g)
CH3-CH2-CH2-CH2-CH2-CH3(l) + 19/2(O=O)(g) --------------> 6(O=C=O) + 7(H-O-H)
Hrxn = bond energies of reactants - bond energies of products
= 14(C-H) + 5(C-C) +19/2(O=O) - [ 6(O=C=O) + 7(H-O-H)]
= 14*413 + 5*347 + 19/2*498 - (12*799 + 14*467)
= 14*413 + 5*347 + 4731 - (12*799 + 14*467)
= -3878KJ/mole
Estimate the \DeltaΔH° for the combustion of one mole of hexane in kJ at 25°C using...
Estimate the A Hº for the following reaction in kJ at 25°C using the table of bond energies provided CH3-CH-CH, SO CH3-C-CH, below: OH 2-propanol 2-propanone Just enter a number (no units). This is an oxidation reaction converting an alcohol to a ketone (specifically nail polish remover). Ignore the compounds above and below the reaction arrow; they are the inorganic reagents needed for this acid-catalyzed reaction to proceed. Table 9.2 Average Bond Energles (kJ/mol) and Bond Lengths (pm) Bond Energy...
Estimate the ΔH° for the following reaction in kJ at 25°C using the table of bond energies provided below: CH. Estimate the AH° for the following reaction in kJ at 25°C using the table of bond CH energies provided below: CH,-¢-CH, -hy, CH3-C=CH2 Он Just enter a number (no units). This is an elimination reaction converting an alcohol to an alkene. Ignore the water above the reaction arrow. The water is what is being eliminated. Table 9.2 Average Bond Energies...
If you have 1 mol of HBr molecules, and you have a source of 269.7 nm photons that you can use to dissociate those bonds. What is the excess energy (given in eV) that 1 mole of those photons carry over what is needed for the dissociation of the bonds? Give answer in eV/mol 1 eV = 1.6022x10-19 J Average Bond Energles (kJ/mol) and Bond Lengths (pm) Table 9.2 Energy Length Bond Energy Length Bond Bond Length Bond Length Energy...
By using photons of specific wavelengths, chemists can dissociate gaseous HI to produce H atoms with accurately known speeds. When HI dissociates, the H atoms move away rapidly, whereas the relatively heavy I atoms move little. Use Table 9.2 in your textbook to answer the following questions: (a) What is the longest wavelength (in nm) that can dissociate a molecule of HI? 4.9) 406 nm (b) If a photon of 226 nm is used, what is the excess energy (in...
The enthalpy change for the following reaction is 95.4 kJ. Using bond energies, estimate the N-H bond energy in N2H4(g). N2(g) + 2H2(g) N2H4(g) kJ/mol The enthalpy change for the following reaction is -92.2 kJ. Using bond energies, estimate the H-H bond energy in H2(g). 2NH3(g) N2(g) + 3H2(g) kJ/mol D Single Bonds Multiple Bonds C N O F Si P S a Br 1 H 436 413 391 463 565 318 322 347 C 413 346 305 358 485...
Given the following chemical equation: CClBr3 + O2 -> CO2 + Br2 + Cl2 Determine the if this reaction is exothermic or endothermic based on bond energies. Energy Length Bond Energy Length NH 347 Table 92 Average Bond Energies (kJ/mol) and Bond Langths (pm) Bond Energy Length Bend Energy Length Bond Single Bonds H-H 101 SIH HF 565 SIS Hea 427 Si-O H-Br N-O S-S H-I Si-F N-a Si-CI Si-Br Si- 271 216 234 P-H 213 200 227 221 P-F...
a. b. For b is this table below: Bond Bond Energy, D (kJ/mol) C=0 1072 C1-C1 242 C-CI 339 C=0 732 Using the values of bond energy from the table above, estimate the enthalpy change for the following reaction: CO(g) + Cl2(9)—>COC12(E) DkJ Using average bond enthalpies (linked above), estimate the enthalpy change for the following reaction: H2(g) + 12(8)—2HI(g) kJ Submit Answer Retry Entire Group 6 more group attempts remaining Single Bonds H C N O F Si P...
Using the bond enthalpies in the Average Bond Enthalpies table, determine the approximate enthalpy (in kJ) for each of the following reactions. (Assume the average bond enthalpy of the Cl–F bond is 254 kJ/mol.) (a) Cl2(g) + 3 F2(g) → 2 ClF3(g) (b) H2C=CH2(g) + H2(g) → H3CCH3(g) (c) 2 CH3(C=O)H(g) + 5 O2(g) → 4 CO2(g) + 4 H2O(g) ITITIT Average Bond Enthalpies AH bond (kJ/mol) bond AHond (kJ/mol) bond AH bond (kJ/mol) bond bond AH bond (kJ/mol) С-Н...
can you please help me with #10 yes i am sorry here it is 0202 =120.4+ -343. 'L'UT1. 10. Ethanol (CH3CH2OH) is a fuel additive. And has the following structure: HCVE-238,+KO HH CHOSE = pana lang 2015 nosioci brod H-CC-O H os os 3.304 - HH Use the average bond energies found in Table 9.3, Tro p. 390 to calculate AHrxn for the combustion of ethanol. CH3CH2OH() + 3 02 (6) ► 2 CO2 (6) + 3 H20 (1) Bond...
.The enthalpy change for the following reaction is -137 kJ. The enthalpy change for the following reaction is -137 kJ. C2H4(g) + H2(g) -> C2H6(g) To analyze the reaction, first draw Lewis structures for all reactant and product molecules. Estimate the C-C bond energy in C2H6(g) , using tabulated bond energies (linked above) for the remaining bonds H C N O F Si P S Cl Br I H 436 413 391 463 565 318 322 347 432 366 299...