Homework Answers
Add Answer to:
B. Boiling Point of Unknown Organic Liquid 4. Calculate the boiling point of you unknown liquid...
Part A What is the boiling point of water at an elevation of 1.25*10* ft ?...
Part A What is the boiling point of water at an elevation of 1.25*10* ft ? Express your answer with the appropriate units using three significant figures View Available Hint(s) CHAR O ? T= Value Submit Provide Feedback <Ch 11 Assignment Vapor Pressure The vapor pressure of a substance describes how readily molecules at the surface of the substance enter the gaseous phase. At the boiling point of a liquid, the liquid's vapor pressure is equal to or greater than...
The ____ of a liquid is the boiling point when the surrounding pressure is equal to...
The ____ of a liquid is the boiling point when the surrounding pressure is equal to 1 atm, 101.3 kPa, 760 mm Hg, or 760 torr. normal boiling point normal freezing point boiling point freezing point
Boiling Point vs. Atomspheric Pressure The boiling point of water depends on atmospheric pressure. At high...
Boiling Point vs. Atomspheric Pressure The boiling point of water depends on atmospheric pressure. At high altitudes, atmospheric pressure is lower, and hence water boils at a slightly lower temperature. Plot a graph by hand for the following data treating atmospheric pressure as the independent variable. Atm Press (mm of Hg) Temperature (Co) 750 752 754 756 758 760 762 764 766 768 99.63 99.70 99.78 99.85 99.93 100.00 100.07 100.15 100.22 100.29 a) Calculate the slope of the line....
In an attempt to identify a particular liquid unknown substance, you follow the procedures in this...
In an attempt to identify a particular liquid unknown substance, you follow the procedures in this experiment and obtain the following data… Solubility: s (in water); s (in cyclohexane); s (in ethyl alcohol) Density: A. Volume of liquid: 10.0 mL B. Mass of 50-mL Erlenmeyer flask plus liquid: 54.2066 g C. Mass of 50-mL Erlenmeyer flask: 40.4957 g Boiling Pt.: Observed boiling point: 59.5 °C; Barometric pressure: 650.0 mm Hg What is the mass (in g) of the liquid used...
760 You perform the Dumas method experiment. The mass of the empty flask with a boiling...
760 You perform the Dumas method experiment. The mass of the empty flask with a boiling stone it is 32.5500 g. After you add the volatile liquid, heat the flask, and condense the remaining liquid, the mass of the flask with the boiling stone and condensed liquid is 33.8802 . The temperature of the water bath is 99.5°C. Atmospheric pressure when you perform the experiment is 745 mm Hg. The volume of the flask is 272 mL. a) Calculate the...
An unknown molecule has a normal boiling point of 329.15 K and a vapour pressure of...
An unknown molecule has a normal boiling point of 329.15 K and a vapour pressure of 0.670 atm at 318 K. Determine the pressure, in mmHg, at which this unknown liquid will boil at 313 K. Assume that Hvap is constant over this range of temperatures and pressures. Round your final answer to three significant figures.
The enthalpy of an unknown liquid is 29.86 kJ/mol. and its normal boiling point is 77.0oC....
The enthalpy of an unknown liquid is 29.86 kJ/mol. and its normal boiling point is 77.0oC. Use the Clausius-Clapeyron equation to calculate the vapor pressure of the unknown liquid at 24.0oC. Enter your answer in units of torr.
The enthalpy of an unknown liquid is 28.96 kJ/mol. and its normal boiling point is 65.0oC....
The enthalpy of an unknown liquid is 28.96 kJ/mol. and its normal boiling point is 65.0oC. Use the Clausius-Clapeyron equation to calculate the vapor pressure of the unknown liquid at 21.0oC. Enter your answer in units of torr.
Please do the following questions! thank you! Experiment 12: Generating Hydrogen Gas Part B: Molar mass...
Please do the following questions! thank you!
Experiment 12: Generating Hydrogen Gas Part B: Molar mass of unknown metal Unknown #: Mass of unknown metal (X): Volume of H2 gas L K Temperature of H2 gas 0.12588 54.4 mL 23.0 C 765.8 mmHg 21.1 mmHg 744.7 mmHg Atmospheric pressure (see barometer) Vapor pressure of water atm Partial pressure of H, gas Using PV=nRT and your data, calculate the moles of hydrogen gas produced in the experiment: PV = 0.97987x54.4xio RT...
Please show work Calculate the boiling point of water (T_v = ? K) at a pressure...
Please show work
Calculate the boiling point of water (T_v = ? K) at a pressure of P = 2 atm., and at a pressure of 0.8 atm H_2 O (l) rightarrow H_2 O (g) delta H_v degree = 41,000 J/mole at 1 atm, 373 K. Calculate the vapor pressure of liquid zinc (p_Z_n = ? atm) at T = 700 K. Zn(l) rightarrow Zn (g) delta H_V degree = 116,000 J/mole at 1 atm, 1180 K.
Part A What is the boiling point of water at an elevation of 1.25*10* ft ? Express your answer with the appropriate units using three significant figures View Available Hint(s) CHAR O ? T= Value Submit Provide Feedback <Ch 11 Assignment Vapor Pressure The vapor pressure of a substance describes how readily molecules at the surface of the substance enter the gaseous phase. At the boiling point of a liquid, the liquid's vapor pressure is equal to or greater than...
The ____ of a liquid is the boiling point when the surrounding pressure is equal to 1 atm, 101.3 kPa, 760 mm Hg, or 760 torr. normal boiling point normal freezing point boiling point freezing point
760 You perform the Dumas method experiment. The mass of the empty flask with a boiling stone it is 32.5500 g. After you add the volatile liquid, heat the flask, and condense the remaining liquid, the mass of the flask with the boiling stone and condensed liquid is 33.8802 . The temperature of the water bath is 99.5°C. Atmospheric pressure when you perform the experiment is 745 mm Hg. The volume of the flask is 272 mL. a) Calculate the...
An unknown molecule has a normal boiling point of 329.15 K and a vapour pressure of 0.670 atm at 318 K. Determine the pressure, in mmHg, at which this unknown liquid will boil at 313 K. Assume that Hvap is constant over this range of temperatures and pressures. Round your final answer to three significant figures.
Please do the following questions! thank you!
Experiment 12: Generating Hydrogen Gas Part B: Molar mass of unknown metal Unknown #: Mass of unknown metal (X): Volume of H2 gas L K Temperature of H2 gas 0.12588 54.4 mL 23.0 C 765.8 mmHg 21.1 mmHg 744.7 mmHg Atmospheric pressure (see barometer) Vapor pressure of water atm Partial pressure of H, gas Using PV=nRT and your data, calculate the moles of hydrogen gas produced in the experiment: PV = 0.97987x54.4xio RT...
Please show work
Calculate the boiling point of water (T_v = ? K) at a pressure of P = 2 atm., and at a pressure of 0.8 atm H_2 O (l) rightarrow H_2 O (g) delta H_v degree = 41,000 J/mole at 1 atm, 373 K. Calculate the vapor pressure of liquid zinc (p_Z_n = ? atm) at T = 700 K. Zn(l) rightarrow Zn (g) delta H_V degree = 116,000 J/mole at 1 atm, 1180 K.
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 50 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago