Homework Answers
Add Answer to:
10. Consider the reaction below: 45 4Fe + 30, 2Fe 0, 2 27.90 IH-08 + 47,97...
41. Consider the following reaction: 4 Fe + 3 02 → 2 Fe203 How many grams of oxygen gas are needed to react complet...
41. Consider the following reaction: 4 Fe + 3 02 → 2 Fe203 How many grams of oxygen gas are needed to react completely with 44.2 grams of iron?
Q5: Unit 8 Consider the reaction: 4Fe +30, Ⓡ 2Fe,0, If 4 moles of Fe are...
Q5: Unit 8 Consider the reaction: 4Fe +30, Ⓡ 2Fe,0, If 4 moles of Fe are allowed to react with 4 moles of O,, how many moles of the excess reagent will remain unreacted? A. 2.0 moles B. 1.5 moles C. 1.0 mole D. 0.5 moles
40. Consider the following reaction: 4 Fe + 3 02 → 2 Fe2O3 14.2 grams of...
40. Consider the following reaction: 4 Fe + 3 02 → 2 Fe2O3 14.2 grams of iron react with an excess of oxygen gas, what mass of Fe2O3 can form? (Fe2O3 = 159.70 g/mol)
8 The Following reaction is classified as: 2HCl(aq) + Ba(OH)2(aq) → BaCl(aq) + 2 H20(0) b)...
8 The Following reaction is classified as: 2HCl(aq) + Ba(OH)2(aq) → BaCl(aq) + 2 H20(0) b) precipitation reaction oxidation-reduction reaction d) acid-base neutralization reaction 9. c) single replacement What is the volume of 0.1220 M HNO, solution required to completely neutralize 17.50 ml of 0.1211M NAOH? Reaction is: HNO, (aq) + NaOH(aq) -NaNO, (aq) + H:0 (aq) a) 17.37 ml b) 16.31 ml. c) 15.39 ml. d) 17.84 mL 10. Which one of the following reactions is the reduction reaction?...
39) What property of liquids explains the formation of leaves? A) surface tension B) adhesion C)...
39) What property of liquids explains the formation of leaves? A) surface tension B) adhesion C) viscosity D) vapor pressure E) None of the choices are correct. mation of spherical water droplets on green 3 9) - um at constant pressure and temperature has the volume 40) 40) A balloon containing helium at constant pres doubled by adding a more helium. Which ' adding a more helium. Which statement(s) isare) TRUE? A) The number of moles of helium doubled. B)...
CHEM 1033, Sample Exam II (Homework) Chapters 3,4,6 Name: 1. What volume of 0.132 M KOH...
CHEM 1033, Sample Exam II (Homework) Chapters 3,4,6 Name: 1. What volume of 0.132 M KOH solution would react completely with 25.8 ml. of 0.198 M HCl according to the following cquation? HCI+KOH --->KCI+H.O a) 86.4 ml. b) 25.7 ml. c) 38.7 ml d) 17.2 ml. 2. Which one of the following is a strong soluble base? a) Ni(OH): b) Mg(OH): c) RLOH d) ChOH) c) Fe(OH) 3. Which one of the following is a strong acid? a) HF b)...
in need of everything, take your time 11. 13 Consider the following reaction 2 NO, --->...
in need of everything, take your time
11. 13 Consider the following reaction 2 NO, ---> 2N, + 50, The number of moles of o: obtained from 12 moles of N, O, (a) 30 (b) 4.8 (c) 60 (e) none of the above. (d) 6 Consider the reaction 2 N, 50, ---> 2 N, O, If 4 moles of nitrogen is mixed with 96 g of oxygen, what is the limiting reagent? a) , (b) N (c) there is no...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the question. 1) 1) One mole of any substance contains Avogadro's number of particles of that substance. What is the numerical value of Avogadro's number? A) 12.01 23 Avagrans t Male aton 6022 x1o atums B) 6.022 x 1023 C) 6.022 x 10-23 D) 1.661 x10-24 E) 1.00 x10-14 2) What is the mass of 4.00 moles of helium, the gas commonly used to fill...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
41. Consider the following reaction: 4 Fe + 3 02 → 2 Fe203 How many grams of oxygen gas are needed to react completely with 44.2 grams of iron?
Q5: Unit 8 Consider the reaction: 4Fe +30, Ⓡ 2Fe,0, If 4 moles of Fe are allowed to react with 4 moles of O,, how many moles of the excess reagent will remain unreacted? A. 2.0 moles B. 1.5 moles C. 1.0 mole D. 0.5 moles
40. Consider the following reaction: 4 Fe + 3 02 → 2 Fe2O3 14.2 grams of iron react with an excess of oxygen gas, what mass of Fe2O3 can form? (Fe2O3 = 159.70 g/mol)
8 The Following reaction is classified as: 2HCl(aq) + Ba(OH)2(aq) → BaCl(aq) + 2 H20(0) b) precipitation reaction oxidation-reduction reaction d) acid-base neutralization reaction 9. c) single replacement What is the volume of 0.1220 M HNO, solution required to completely neutralize 17.50 ml of 0.1211M NAOH? Reaction is: HNO, (aq) + NaOH(aq) -NaNO, (aq) + H:0 (aq) a) 17.37 ml b) 16.31 ml. c) 15.39 ml. d) 17.84 mL 10. Which one of the following reactions is the reduction reaction?...
39) What property of liquids explains the formation of leaves? A) surface tension B) adhesion C) viscosity D) vapor pressure E) None of the choices are correct. mation of spherical water droplets on green 3 9) - um at constant pressure and temperature has the volume 40) 40) A balloon containing helium at constant pres doubled by adding a more helium. Which ' adding a more helium. Which statement(s) isare) TRUE? A) The number of moles of helium doubled. B)...
CHEM 1033, Sample Exam II (Homework) Chapters 3,4,6 Name: 1. What volume of 0.132 M KOH solution would react completely with 25.8 ml. of 0.198 M HCl according to the following cquation? HCI+KOH --->KCI+H.O a) 86.4 ml. b) 25.7 ml. c) 38.7 ml d) 17.2 ml. 2. Which one of the following is a strong soluble base? a) Ni(OH): b) Mg(OH): c) RLOH d) ChOH) c) Fe(OH) 3. Which one of the following is a strong acid? a) HF b)...
in need of everything, take your time
11. 13 Consider the following reaction 2 NO, ---> 2N, + 50, The number of moles of o: obtained from 12 moles of N, O, (a) 30 (b) 4.8 (c) 60 (e) none of the above. (d) 6 Consider the reaction 2 N, 50, ---> 2 N, O, If 4 moles of nitrogen is mixed with 96 g of oxygen, what is the limiting reagent? a) , (b) N (c) there is no...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the question. 1) 1) One mole of any substance contains Avogadro's number of particles of that substance. What is the numerical value of Avogadro's number? A) 12.01 23 Avagrans t Male aton 6022 x1o atums B) 6.022 x 1023 C) 6.022 x 10-23 D) 1.661 x10-24 E) 1.00 x10-14 2) What is the mass of 4.00 moles of helium, the gas commonly used to fill...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 43 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago